| Revision as of 19:43, 12 May 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 11:19, 24 December 2024 edit undoCitation bot (talk | contribs)Bots5,424,092 edits Added date. | Use this bot. Report bugs. | Suggested by Graeme Bartlett | #UCB_toolbar |
| (22 intermediate revisions by 18 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
| verifiedrevid = 403244852 |
|
| verifiedrevid = 428808022 |
|
|ImageFile=E160f.png |
|
| ImageFile=E160f.png |
|
|ImageSize=250px |
|
| ImageSize=290 |
|
|
| ImageAlt=Skeletal formula of food orange 7 |
| ⚫ |
|IUPACName= <small>(2''E'',4''E'',6''E'',8''E'',10''E'',12''E'',14''E'',16''E'')-2,6,11,15-Tetramethyl-17-(2,6,6-trimethyl-1-cyclohexenyl)heptadeca-2,4,6,8,10,12,14,16-octaenoic acid ethyl ester</small> |
|
|
|
| ImageFile1=Food orange 7 3D spacefill.png |
|
|OtherNames=•Ethyl ester of beta-apo-8'-carotenic acid<br>•Ethyl 8'-apo-beta,psi-carotenoate<br>•E160f |
|
|
|
| ImageSize1=300 |
|
|Section1= {{Chembox Identifiers |
|
|
|
| ImageAlt1=Space-filling model of the food orange 7 molecule |
| ⚫ |
| CASNo=1109-11-1 |
|
|
|
| IUPACName=Ethyl 8′-apo-β-caroten-8′-oate |
| ⚫ |
| PubChem=6391647 |
|
|
⚫ |
| SystematicName=Ethyl (2''E'',4''E'',6''E'',8''E'',10''E'',12''E'',14''E'',16''E'')-2,6,11,15-tetramethyl-17-(2,6,6-trimethylcyclohex-1-en-1-yl)heptadeca-2,4,6,8,10,12,14,16-octaenoate |
| ⚫ |
| SMILES=CCOC(=O)/C(=C/C=C/C(=C/C=C/C=C(\C)/C=C/C=C(\C)/C=C/C1=C(CCCC1(C)C)C)/C)/C |
|
|
|
| OtherNames={{Unbulleted list |
|
|
| Ethyl ester of beta-apo-8'-carotenic acid |
|
|
| Ethyl 8'-apo-beta,psi-carotenoate |
|
⚫ |
| E160f |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| Formula=C<sub>32</sub>H<sub>44</sub>O<sub>2</sub> |
|
|
⚫ |
| CASNo=1109-11-1 |
|
| MolarMass=460.69 g/mol |
|
|
|
| ChemSpiderID = 4907239 |
|
| Appearance= |
|
|
|
| EC_number = 214-173-7 |
| ⚫ |
| Density= |
|
|
⚫ |
| PubChem=6391647 |
| ⚫ |
| MeltingPt= |
|
|
|
| StdInChI=1S/C32H44O2/c1-9-34-31(33)29(6)20-13-19-26(3)16-11-10-15-25(2)17-12-18-27(4)22-23-30-28(5)21-14-24-32(30,7)8/h10-13,15-20,22-23H,9,14,21,24H2,1-8H3/b11-10+,17-12+,19-13+,23-22+,25-15+,26-16+,27-18+,29-20+ |
| ⚫ |
| BoilingPt= |
|
|
|
| StdInChIKey = GIRXTOSJOKKBHO-BQTUIHPCSA-N |
| ⚫ |
| Solubility= |
|
|
⚫ |
| SMILES=CCOC(=O)/C(=C/C=C/C(=C/C=C/C=C(\C)/C=C/C=C(\C)/C=C/C1=C(CCCC1(C)C)C)/C)/C |
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section2={{Chembox Properties |
|
|
| C=32 | H=44 | O=2 |
| ⚫ |
| MainHazards= |
|
|
| FlashPt= |
|
| Appearance= |
|
⚫ |
| Density= |
|
| Autoignition= |
|
|
⚫ |
| MeltingPt= |
|
⚫ |
| BoilingPt= |
|
⚫ |
| Solubility= |
|
|
}} |
|
|
|Section3={{Chembox Hazards |
|
⚫ |
| MainHazards= |
|
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Food orange 7''', the ] ] of ], is a ] with an orange-red color. It is found in small quantities in some plants, but is often produced commercially from ] (E160e).<ref>, food-info.net</ref> It is used as a ] under the ] E160f. |
|
'''Food orange 7''', the ] ] of ], is a ] with an orange-red color. It is found in small quantities in some plants, but is often produced commercially from ] (E160e).<ref>, food-info.net</ref> It is used as a ] under the ] E160f and is approved for use in the EU,<ref>UK Food Standards Agency: {{cite web |url=http://www.food.gov.uk/safereating/chemsafe/additivesbranch/enumberlist |title=Current EU approved additives and their E Numbers |access-date=2011-10-27}}</ref> Australia, and New Zealand.<ref>Australia New Zealand Food Standards Code{{cite web |url=http://www.comlaw.gov.au/Details/F2011C00827 |title=Standard 1.2.4 - Labelling of ingredients |date=8 September 2011 |access-date=2011-10-27}}</ref> |
|
|
|
|
|
==References== |
|
==References== |
| Line 35: |
Line 48: |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
| ⚫ |
] |
|
|
] |
|
|
] |
|