| Revision as of 16:35, 29 June 2011 editZéroBot (talk | contribs)704,777 editsm r2.7.1) (robot Adding: fr:Acide formiminoglutamique← Previous edit |
Latest revision as of 13:00, 18 September 2023 edit undoKoIobok (talk | contribs)Extended confirmed users1,350 edits Added Category:Glutamic acids |
| (36 intermediate revisions by 23 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 381486690 |
|
| verifiedrevid = 436877363 |
|
|ImageFile=Formiminoglutamic acid.svg |
|
| ImageFile=Formiminoglutamic acid.svg |
|
|ImageSize= |
|
| ImageSize= |
|
|IUPACName= ''N''-(aminomethylidene)-<small>L</small>-glutamic acid |
|
| IUPACName= ''N''-(aminomethylidene)-<small>L</small>-glutamic acid |
|
|OtherNames=FIGLU |
|
| OtherNames=FIGLU |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo=816-90-0 |
|
| CASNo=816-90-0 |
| ⚫ |
| PubChem=909 |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| SMILES=C(CC(=O)O)C(C(=O)O)N=CN |
|
|
|
| UNII = YV703N7VOG |
| ⚫ |
| MeSHName=Formiminoglutamic+acid |
|
|
⚫ |
| PubChem=909 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 388370 |
|
⚫ |
| SMILES=C(CC(=O)O)C(C(=O)O)N=CN |
|
⚫ |
| MeSHName=Formiminoglutamic+acid |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|C=6|H=10|N=2|O=4 |
|
| C=6 | H=10 | N=2 | O=4 |
|
|
| Appearance= |
|
| MolarMass=174.155 g/mol |
|
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Formiminoglutamic acid''' ('''FIGLU''') is an intermediate in the metabolism of ]. |
|
|
|
|
|
|
|
'''Formiminoglutamic acid''' ('''FIGLU'''; ], '''formiminoglutamate''') is an intermediate in the ] of ] to ]. It thus is also a ] for ] levels of ]. The FIGLU test is used to identify ], ], and ] or ].<ref>{{Cite book | doi=10.1007/978-94-009-1846-7_31|chapter = Formiminoglutamic Acid (FIGLU) Test|title = Diagnostic Function Tests in Chemical Pathology| pages=59–60|year = 1989|last1 = Lascelles|first1 = P. T.| last2=Donaldson| first2=D.| isbn=978-0-7462-0107-7}}</ref><ref>{{MeshName|FIGLU+Test}}</ref> It is elevated with folate trapping, where it is accompanied by decreased ], increased folate and a decrease in ].<ref>{{cite journal |last1=Scott |first1=JohnM. |last2=Weir |first2=DonaldG. |title=THE METHYL FOLATE TRAP: A physiological response in man to prevent methyl group deficiency in kwashiorkor (methionine deficiency) and an explanation for folic-acid-induced exacerbation of subacute combined degeneration in pernicious anaemia |journal=The Lancet |date=15 August 1981 |volume=318 |issue=8242 |pages=337–340 |doi=10.1016/S0140-6736(81)90650-4 |pmid=6115113 |s2cid=29977127 |issn=0140-6736}}</ref> |
|
The "FIGLU" test is used to identify deficiency of ] or ] or ]. |
|
|
|
|
|
|
==See also== |
|
==See also== |
| ⚫ |
* ] |
|
| ⚫ |
* ] |
|
|
* ] |
|
* ] |
|
⚫ |
* ] |
|
* ] |
|
* ] |
|
⚫ |
* ] |
|
|
|
|
|
==External links== |
|
==References== |
|
|
{{reflist}} |
|
* {{MeshName|FIGLU+Test}} |
|
|
|
|
|
|
{{Amino acid metabolism intermediates}} |
|
{{Amino acid metabolism intermediates}} |
|
|
|
|
|
] |
|
] |
|
|
] |
|
|
] |
|
|
|
|
| ⚫ |
{{biochem-stub}} |
|
|
|
|
|
|
⚫ |
{{biochem-stub}} |
|
] |
|
|
|
{{Base-stub}} |
|
] |
|
|
] |
|