| Revision as of 16:07, 9 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 468766813 of page Fructose_6-phosphate for the Chem/Drugbox validation project (updated: ''). |
Latest revision as of 18:05, 29 August 2024 edit DinosaursLoveExistence (talk | contribs)Extended confirmed users16,529 editsm →References: Category |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 455070757 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 470454308 |
|
| ImageFile = beta-D-fructose-6-phosphate_wpmp.png |
|
| ImageFile = beta-D-fructose-6-phosphate_wpmp.png |
|
|
| ImageFile2= Fructose 6-phosphate.png |
|
| ImageSize = 150px |
|
| ImageSize = 150px |
|
|
| IUPACName = 6-''O''-Phosphono-α-<small>D</small>-fructofuranose |
|
| IUPACName = <br>methoxyphosphonic acid |
|
|
| OtherNames = β-D-fructose 6-phosphate, <br>fructose 6-phosphate |
|
| OtherNames = β-D-fructose 6-phosphate, <br>fructose 6-phosphate |
|
| Section1 = {{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
| Line 10: |
Line 12: |
|
| EINECS = |
|
| EINECS = |
|
| PubChem = 444848 |
|
| PubChem = 444848 |
|
|
| KEGG = C00085 |
|
| SMILES = O=P(O)(O)OC1O(O)(CO)(O)1O |
|
| SMILES = O=P(O)(O)OC1O(O)(CO)(O)1O |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 392657 |
|
| ChemSpiderID = 392657 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 16084 |
|
| InChIKey = BGWGXPAPYGQALX-ZXXMMSQZBI |
|
| InChIKey = BGWGXPAPYGQALX-ZXXMMSQZBI |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| Line 20: |
Line 25: |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = 643-13-0 |
|
| CASNo = 643-13-0 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 2012QM764Y |
|
| InChI = 1/C6H13O9P/c7-2-6(10)5(9)4(8)3(15-6)1-14-16(11,12)13/h3-5,7-10H,1-2H2,(H2,11,12,13)/t3-,4-,5+,6+/m1/s1 |
|
| InChI = 1/C6H13O9P/c7-2-6(10)5(9)4(8)3(15-6)1-14-16(11,12)13/h3-5,7-10H,1-2H2,(H2,11,12,13)/t3-,4-,5+,6+/m1/s1 |
|
}} |
|
}} |
| Line 32: |
Line 39: |
|
| pKb = |
|
| pKb = |
|
| IsoelectricPt = |
|
| IsoelectricPt = |
|
| DeltaHf = |
|
|
| DeltaHc = |
|
| ⚫ |
}} |
|
|
}} |
|
}} |
|
⚫ |
}} |
|
|
|
|
|
'''Fructose 6-phosphate''' (sometimes called the '''Neuberg ester''') is a derivative of ], which has been ] at the 6-hydroxy group. It is one of several possible ]s. The β-<small>D</small>-form of this compound is very common in ].<ref>{{cite book |last=Berg |first=Jeremy M. |author2=Tymoczko, Stryer |title=Biochemistry |year=2002 |edition=5th |publisher=] |location=New York |isbn=0-7167-3051-0 |url=https://archive.org/details/biochemistrychap00jere |url-access=registration }}</ref><ref>Nelson, D. L.; Cox, M. M. "Lehninger, Principles of Biochemistry" 3rd Ed. Worth Publishing: New York, 2000. {{ISBN|1-57259-153-6}}.</ref> The great majority of ] is converted to fructose 6-phosphate upon entering a cell. ] is predominantly converted to ] by ] following cellular import. |
|
|
|
|
|
==History== |
|
|
The name ''Neuberg ester'' comes from the German biochemist ]. In 1918, he found that the compound (later identified as fructose 6-phosphate) was produced by mild acid hydrolysis of ].<ref>Fruton, Joseph S. ''Proteins, Enzymes, Genes: The Interplay of Chemistry and Biology''. Yale University Press: New Haven, 1999. p 292</ref> |
|
|
|
|
|
==In glycolysis== |
|
|
|
|
|
Fructose 6-phosphate lies within the ] ] and is produced by isomerisation of ]. It is in turn further phosphorylated to ]. |
|
|
{| style="background: white; text-align:center;" |
|
|
|- |
|
|
| style="background:lightgreen" | α-{{small|D}}-] |
|
|
| colspan="2" style="background:pink; width:75px" | ] |
|
|
| style="background:lightgreen" | α-{{small|D}}-fructose 6-phosphate |
|
|
| colspan="2" style="background:pink; width:75px" | ] |
|
|
| style="background:lightgreen" | α-{{small|D}}-] |
|
|
|- |
|
|
| rowspan="5" | ] |
|
|
| colspan="2" style="width:75px" | |
|
|
| rowspan="5" | ] |
|
|
| colspan="2" style="width:75px" | |
|
|
| rowspan="5" | ] |
|
|
|- |
|
|
| |
|
|
| |
|
|
| ] |
|
|
| ] |
|
|
|- |
|
|
| colspan="2" style="width:75px" | ] |
|
|
| colspan="2" style="width:75px" | ] |
|
|
|- |
|
|
| |
|
|
| |
|
|
| P<sub>i</sub> |
|
|
| H<sub>2</sub>O |
|
|
|- |
|
|
| colspan="2" style="width:75px" | |
|
|
| colspan="2" style="width:75px" | |
|
|
|- |
|
|
| |
|
|
| colspan="2" style="background:pink; width:75px" | ] |
|
|
| |
|
|
| colspan="2" style="background:pink; width:75px" | ] |
|
|
| align="right" | |
|
|
|} |
|
|
{{KEGG compound|C00668}} {{KEGG enzyme|5.3.1.9}} {{KEGG compound|C05345}} {{KEGG enzyme|2.7.1.11}} {{KEGG enzyme|3.1.3.11}} {{KEGG reaction|}} {{KEGG compound|C05378}} |
|
|
|
|
|
{{GlycolysisGluconeogenesis_WP534|highlight=Fructose_6-phosphate}} |
|
|
|
|
|
|
|
|
==See also== |
|
|
* ] |
|
|
|
|
|
{{Glycolysis}} |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
{{DEFAULTSORT:Fructosephosphate6}} |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |