| Revision as of 11:57, 11 July 2011 editEdgar181 (talk | contribs)Extended confirmed users196,325 edits +Category:Xanthines; +Category:Furans using HotCat← Previous edit |
Latest revision as of 12:33, 30 January 2023 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers170,249 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
| (21 intermediate revisions by 16 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
| ⚫ |
| name = Furafylline |
|
|
|
| Watchedfields = changed |
| ⚫ |
| IUPAC_name = 3-(furan-2-ylmethyl)-1,8-dimethyl-7H-purine-2,6-dione |
|
|
|
| verifiedrevid = 438896400 |
|
| image = Furafylline.svg |
|
|
⚫ |
| IUPAC_name = 3-(Furan-2-ylmethyl)-1,8-dimethyl-7''H''-purine-2,6-dione |
|
| alt = |
|
|
⚫ |
| image = Furafylline structure.svg |
|
| caption = |
|
|
| tradename = |
|
| width = 150 |
|
| Drugs.com = |
|
| alt = |
|
| MedlinePlus = |
|
| caption = |
|
|
|
| ⚫ |
| CAS_number = 80288-49-9 |
|
|
|
<!--Clinical data--> |
| ⚫ |
| ATCvet = |
|
|
|
| tradename = |
|
| ATC_prefix = <!-- 'none' if uncategorised --> |
|
|
| ATC_suffix = |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| PubChem = 3433 |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
| ⚫ |
| DrugBank = |
|
|
| chemical_formula = C<sub>12</sub>H<sub>12</sub>N<sub>4</sub>O<sub>3</sub> |
|
|
| molecular_weight = 60.25 g/mol |
|
| ⚫ |
| bioavailability = |
|
| ⚫ |
| protein_bound = |
|
| ⚫ |
| metabolism = |
|
| ⚫ |
| elimination_half-life = |
|
| ⚫ |
| excretion = |
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| ⚫ |
| pregnancy_category= |
|
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| legal_CA = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_CA = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_UK = <!-- GSL, P, POM, CD, CD Lic, CD POM, CD No Reg POM, CD (Benz) POM, CD (Anab) POM or CD Inv POM --> |
|
| legal_UK = <!-- GSL, P, POM, CD, CD Lic, CD POM, CD No Reg POM, CD (Benz) POM, CD (Anab) POM or CD Inv POM --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
⚫ |
| CAS_number = 80288-49-9 |
|
⚫ |
| ATCvet = |
|
|
| ATC_prefix = None |
|
|
| ATC_suffix = |
|
|
| PubChem = 3433 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = C2087G0XX3 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 372638 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 3315 |
|
|
|
|
|
<!--Chemical data--> |
|
|
| C=12 | H=12 | N=4 | O=3 |
|
|
| smiles = Cc1c2c(n1)n(c(=O)n(c2=O)C)Cc3ccco3 |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C12H12N4O3/c1-7-13-9-10(14-7)16(6-8-4-3-5-19-8)12(18)15(2)11(9)17/h3-5H,6H2,1-2H3,(H,13,14) |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = KGQZGCIVHYLPBH-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|
|
|
'''Furafylline''' is a ] derivative that was introduced in hope of being a long-acting replacement for ] in the treatment of ].<ref name=Sesardic1990>{{cite pmid| 2378786}}</ref> It is an inhibitor of ].<ref name=Sesardic1990/> |
|
'''Furafylline''' is a ] derivative that was introduced in hope of being a long-acting replacement for ] in the treatment of ].<ref name=Sesardic1990>{{cite journal | vauthors = Sesardic D, Boobis AR, Murray BP, Murray S, Segura J, de la Torre R, Davies DS | title = Furafylline is a potent and selective inhibitor of cytochrome P450IA2 in man | journal = British Journal of Clinical Pharmacology | volume = 29 | issue = 6 | pages = 651–63 | date = June 1990 | pmid = 2378786 | pmc = 1380167 | doi = 10.1111/j.1365-2125.1990.tb03686.x }}</ref> It is an inhibitor of ].<ref name=Sesardic1990/> |
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist}} |
|
{{Reflist}} |
|
|
|
|
|
|
{{Asthma and copd rx}} |
| ⚫ |
{{drug-stub}} |
|
|
|
{{Phosphodiesterase inhibitors}} |
|
|
|
|
⚫ |
] |
|
|
] |
|
|
] |
|
] |
|
] |
|
|
|
| ⚫ |
] |
|
|
⚫ |
{{respiratory-system-drug-stub}} |