| Revision as of 23:26, 12 May 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 20:19, 18 January 2024 edit undoMichael7604 (talk | contribs)Extended confirmed users8,895 edits more specific category |
| (9 intermediate revisions by 9 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
| verifiedrevid = 371142740 |
|
| verifiedrevid = 428839881 |
|
| ImageFile = Furantetracarboxylic acid.svg |
|
| ImageFile = Furantetracarboxylic acid.svg |
|
| ImageSize = 250px |
|
| ImageSize = 250px |
|
| IUPACName = furan-2,3,4,5-tetracarboxylic acid |
|
| PIN = Furantetracarboxylic acid |
|
| OtherNames = |
|
| OtherNames = |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| CASNo = 20416-04-0 |
|
| CASNo = 20416-04-0 |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 526V46EZC7 |
|
| PubChem = 237617 |
|
| PubChem = 237617 |
|
| SMILES = C1(=C(OC(=C1C(=O)O)C(=O)O)C(=O)O)C(=O)O }} |
|
| SMILES = C1(=C(OC(=C1C(=O)O)C(=O)O)C(=O)O)C(=O)O |
|
|
| ChemSpiderID = 207476 |
| ⚫ |
| Section2 = {{Chembox Properties |
|
|
|
| StdInChI = 1S/C8H4O9/c9-5(10)1-2(6(11)12)4(8(15)16)17-3(1)7(13)14/h(H,9,10)(H,11,12)(H,13,14)(H,15,16) |
|
|
|
|
|
| StdInChIKey = IREPGQRTQFRMQR-UHFFFAOYSA-N}} |
|
⚫ |
|Section2={{Chembox Properties |
|
| Formula = C<sub>8</sub>H<sub>4</sub>O<sub>9</sub> |
|
| Formula = C<sub>8</sub>H<sub>4</sub>O<sub>9</sub> |
|
| MolarMass = 244.11 g/mol |
|
| MolarMass = 244.11 g/mol |
| Line 17: |
Line 24: |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
|
|
|
|
In ], '''furantetracarboxylic acid''' is an ] with formula {{chem|C|8|H|4|O|9}}, or (C<sub>4</sub>O)(-(CO)OH)<sub>4</sub>, which can be viewed as deriving from ] {{chem|C|4|H|4|O}} through replacement of the four hydrogen atoms by ] ] -(CO)OH. |
|
In ], '''furantetracarboxylic acid''' is an ] with formula {{chem|C|8|H|4|O|9}}, or (C<sub>4</sub>O)(-(CO)OH)<sub>4</sub>, which can be viewed as deriving from ] {{chem|C|4|H|4|O}} through replacement of the four hydrogen atoms by ] ] -(CO)OH. |
|
|
|
|
|
By removal of four protons, the acid is expected to yield the anion {{chem|C|8|O|9|4-}}, '''furantetracarboxylate''', which is one of the ]s (consisting solely of ] and ]. By loss of 1 through 3 ]s it forms the anions {{chem|C|8|H|3|O|9|-}}, {{chem|C|8|H|2|O|9|2-}}, and {{chem|C|8|H|1|O|9|3-}}, called respectivey '''trihydrogen-''', '''dihydrogen'''-, and '''hydrogenfurantetracarboxylate'''. The same names are used for the corresponding ]s. |
|
By removal of four protons, the acid is expected to yield the anion {{chem|C|8|O|9|4-}}, '''furantetracarboxylate''', which is one of the ]s (consisting solely of ] and ]. By loss of 1 through 3 ]s it forms the anions {{chem|C|8|H|3|O|9|-}}, {{chem|C|8|H|2|O|9|2-}}, and {{chem|C|8|HO|9|3-}}, called respectively '''trihydrogen-''', '''dihydrogen'''-, and '''hydrogenfurantetracarboxylate'''. The same names are used for the corresponding ]s. |
|
|
|
|
|
The acid can be obtained by from dioxalylsuccinate.<ref name=zapa> |
|
The acid can be obtained by from dioxalylsuccinate.<ref name=zapa> |
| Line 36: |
Line 43: |
|
|
|
|
|
The salt ] trihydrogenfurantetracarboxylate {{chem|RbH|3|C|8|O|9}} crystallizes as white needles.<ref name=paul> |
|
The salt ] trihydrogenfurantetracarboxylate {{chem|RbH|3|C|8|O|9}} crystallizes as white needles.<ref name=paul> |
|
Iain C. Paul and Leslie L. Martin (1967), ''The crystal and molecular structure of the monorubidium salt of furantetracarboxylic acid''. Acta Cryst. volume 22 pages 559-567 {{doi|10.1107/S0365110X67001136}} |
|
Iain C. Paul and Leslie L. Martin (1967), ''The crystal and molecular structure of the monorubidium salt of furantetracarboxylic acid''. Acta Crystallogr. volume 22 pages 559-567 {{doi|10.1107/S0365110X67001136}} |
|
</ref> |
|
</ref> |
|
|
|
|
| Line 48: |
Line 55: |
|
|
|
|
|
] |
|
] |
|
] |
|
] |