| Revision as of 05:34, 7 December 2010 editحسن علي البط (talk | contribs)Extended confirmed users, Pending changes reviewers19,940 edits added Category:Catechols using HotCat← Previous edit |
Latest revision as of 23:32, 1 May 2023 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 edits move systematic name |
| (19 intermediate revisions by 15 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Watchedfields = changed |
| ⚫ |
| name = Fustin |
|
|
|
| verifiedrevid = 424693354 |
|
| ImageFile = Fustin.svg |
|
|
| ImageSize = 250px |
|
| Name = Fustin |
|
⚫ |
| ImageFile = Fustin.svg |
|
| IUPACName = 2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-2,3-dihydrochromen-4-one |
|
|
|
| ImageSize = 200px |
| ⚫ |
| OtherNames = Dihydrofisetin<br>Tetrahydroxyflavanone<br>3,7,3',4'-Tetrahydroxyflavanone<br>2,3-Dihydrofisetin<br>3′,4′,7-trihydroxyflavanol |
|
|
|
| IUPACName = (2''R'',3''R'')-3,3′,4′,7-Tetrahydroxyflavan-4-one |
| ⚫ |
| Section1= {{Chembox Identifiers |
|
|
|
| SystematicName = (2''R'',3''R'')-2-(3,4-Dihydroxyphenyl)-3,7-dihydroxy-2,3-dihydro-4''H''-1-benzopyran-4-one |
| ⚫ |
| CASNo = 20725-03-5 |
|
|
⚫ |
| OtherNames = 2,3-Dihydrofisetin<br>3,7,3',4'-Tetrahydroxyflavanone<br>2,3-Dihydrofisetin<br>3′,4′,7-Trihydroxyflavanol |
| ⚫ |
| PubChem = 5317435 |
|
|
⚫ |
|Section1={{Chembox Identifiers |
| ⚫ |
| SMILES = C1=CC(=C(C=C1C2C(C(=O)C3=C(O2)C=C(C=C3)O)O)O)O |
|
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
⚫ |
| CASNo = 20725-03-5 |
|
|
| ChEBI = 5202 |
|
|
| ChEMBL = 470267 |
|
|
| ChemSpiderID = 4476304 |
|
|
| EINECS = 243-989-6 |
|
|
| KEGG = C01378 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 4994C1X19A |
|
⚫ |
| PubChem = 5317435 |
|
|
| StdInChI=1S/C15H12O6/c16-8-2-3-9-12(6-8)21-15(14(20)13(9)19)7-1-4-10(17)11(18)5-7/h1-6,14-18,20H/t14-,15+/m0/s1 |
|
|
| StdInChIKey = FNUPUYFWZXZMIE-LSDHHAIUSA-N |
|
⚫ |
| SMILES = C1=CC(=C(C=C12(C(=O)C3=C(O2)C=C(C=C3)O)O)O)O |
|
}} |
|
}} |
|
| Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=15|H=12|O=6 |
|
| Formula=C<sub>15</sub>H<sub>12</sub>O<sub>6</sub> |
|
|
|
| Appearance = |
|
| MolarMass = 288.25 g/mol |
|
|
|
| Density = |
|
| ExactMass = 288.063388 |
|
|
| Appearance = |
|
| MeltingPt = |
|
| Density = |
|
| BoilingPt = |
|
| MeltingPt = |
|
| Solubility = |
|
| BoilingPt = |
|
|
| Solubility = |
|
|
}} |
|
}} |
|
| Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Fustin''' is a ], a type of flavonoid. It can be found in ] (''Cotinus coggygria'')<ref></ref> and in the lacquer tree<ref name="Park"></ref> ('']'', aka ''Rhus verniciflua''). |
|
|
|
|
|
|
|
'''Fustin''', sometimes called "dihydrofisetin", is a ], a type of flavonoid. It can be found in ] (''Cotinus coggygria'')<ref>{{cite journal | doi = 10.1007/s00216-009-2767-z| pmid = 19352635| title = Phytochemical analysis of young fustic (Cotinus coggygria heartwood) and identification of isolated colourants in historical textiles| journal = Analytical and Bioanalytical Chemistry| volume = 394| issue = 3| pages = 871| year = 2009| last1 = Valianou| first1 = Lemonia| last2 = Stathopoulou| first2 = Konstantina| last3 = Karapanagiotis| first3 = Ioannis| last4 = Magiatis| first4 = Prokopios| last5 = Pavlidou| first5 = Eleni| last6 = Skaltsounis| first6 = Alexios-Leandros| last7 = Chryssoulakis| first7 = Yannis| s2cid = 22188491}}</ref> and in the lacquer tree ('']'').<ref name="Park">{{cite journal | doi = 10.1038/emm.2007.35| title = Protective effects of fustin, a flavonoid from Rhus verniciflua Stokes, on 6-hydroxydopamine-induced neuronal cell death| journal = Experimental & Molecular Medicine| volume = 39| issue = 3| pages = 316| year = 2007| last1 = Park| first1 = Byung Chul| last2 = Lee| first2 = Yong Soo| last3 = Park| first3 = Hee-Juhn| last4 = Kwak| first4 = Mi-Kyoung| last5 = Yoo| first5 = Bong Kyu| last6 = Kim| first6 = Joo Young| last7 = Kim| first7 = Jung-Ae| pmid = 17603285| doi-access = free}}</ref> |
| ⚫ |
Fustin shows protective effects on 6-hydroxydopamine-induced neuronal cell death<ref name="Park"/>. |
|
|
|
|
|
|
⚫ |
Fustin shows protective effects on 6-hydroxydopamine-induced neuronal cell death.<ref name="Park"/> |
|
Fustin is also known as "dihydrofisetin"; see ]. |
|
|
|
|
|
|
|
Unlike ], fustin has no double bond in the C-ring. This makes fustin a ], with two ]s and four ]s. |
|
Fustin possesses stereoisomers : (-)-Fustin and (+)-Fustin. |
|
|
|
|
|
|
==References== |
|
==References== |