| Revision as of 08:16, 1 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (changes to watched fields - added verified revid - updated 'ChEMBL_Ref', 'ChEBI_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report errors or [[user talk:CheMoBot|b← Previous edit |
Latest revision as of 18:33, 8 September 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,129 edits removed Category:Chloroarenes; added Category:4-Chlorophenyl compounds using HotCat |
| (21 intermediate revisions by 16 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 444597591 |
|
| verifiedrevid = 447821040 |
|
| IUPAC_name = isopropyl 5-(4-chlorophenoxy)-4-(methoxymethyl)-9''H''-β-carboline-3-carboxylate |
|
| IUPAC_name = isopropyl 5-(4-chlorophenoxy)-4-(methoxymethyl)-9''H''-β-carboline-3-carboxylate |
|
| image = Gedocarnil.svg |
|
| image = Gedocarnil.svg |
| Line 15: |
Line 16: |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
| Line 22: |
Line 23: |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 109623-97-4 |
|
| CAS_number = 109623-97-4 |
|
| ATC_prefix = N05 |
|
| ATC_prefix = N05 |
|
| ATC_suffix = BX02 |
|
| ATC_suffix = BX02 |
|
| PubChem = 219095 |
|
| PubChem = 219095 |
|
|
| ChEMBL = 2105080 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
| Line 40: |
Line 43: |
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=23 | H=21 | Cl=1 | N=2 | O=4 |
|
| C=23 | H=21 | Cl=1 | N=2 | O=4 |
|
|
| smiles = ClC1=CC=C(OC2=CC=CC3=C2C4=C(N3)C=NC(C(OC(C)C)=O)=C4COC)C=C1 |
|
| molecular_weight = 424.877 g/mol |
|
|
| smiles = Clc4ccc(Oc3c2c1c(c(ncc1nc2ccc3)C(=O)OC(C)C)COC)cc4 |
|
|
| InChI = 1/C23H21ClN2O4/c1-13(2)29-23(27)22-16(12-28-3)20-18(11-25-22)26-17-5-4-6-19(21(17)20)30-15-9-7-14(24)8-10-15/h4-11,13,26H,12H2,1-3H3 |
|
|
| InChIKey = SLYDYLLJUXFULK-UHFFFAOYAP |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C23H21ClN2O4/c1-13(2)29-23(27)22-16(12-28-3)20-18(11-25-22)26-17-5-4-6-19(21(17)20)30-15-9-7-14(24)8-10-15/h4-11,13,26H,12H2,1-3H3 |
|
| StdInChI = 1S/C23H21ClN2O4/c1-13(2)29-23(27)22-16(12-28-3)20-18(11-25-22)26-17-5-4-6-19(21(17)20)30-15-9-7-14(24)8-10-15/h4-11,13,26H,12H2,1-3H3 |
| Line 50: |
Line 50: |
|
| synonyms = <small>propan-2-yl 5-(4-chlorophenoxy)-4-(methoxymethyl)-9''H''-pyridoindole-3-carboxylate</small> |
|
| synonyms = <small>propan-2-yl 5-(4-chlorophenoxy)-4-(methoxymethyl)-9''H''-pyridoindole-3-carboxylate</small> |
|
}} |
|
}} |
|
|
|
|
'''Gedocarnil''' is an ]. |
|
|
|
'''Gedocarnil''' (]) is an ] of the ] class related to ]. It is registered as an anxiolytic under the ]'s ] classification system; however, there are no trade names associated with it and it does not appear to have ever been marketed.<ref name="Muller1998">{{cite book | vauthors = Muller NF, Dessing RP | title = European Drug Index: European Drug Registrations | edition = Fourth | url = https://books.google.com/books?id=HiSdvzs2pPAC&pg=PA1440 | date = 19 June 1998 | publisher = CRC Press | isbn = 978-3-7692-2114-5 | page = 1440}}</ref> |
|
|
|
|
|
==See also== |
|
|
* ] |
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
{{Anxiolytics}} |
|
{{Anxiolytics}} |
|
|
{{GABAAR PAMs}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|
|
{{nervous-system-drug-stub}} |
|
{{Anxiolytic-stub}} |