| Revision as of 17:41, 17 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 476864376 of page Glabridin for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CASNo'). |
Latest revision as of 07:55, 18 May 2024 edit GreenLipstickLesbian (talk | contribs)Autopatrolled, Extended confirmed users, New page reviewers, Pending changes reviewers13,364 edits fixing attribution for text copied in https://en.wikipedia.org/search/?diff=1116247095&oldid=1024342174 from https://www.mdpi.com/1422-0067/23/19/11372#:~:text=Thus%2C%20glabridin%20effectively%20inhibits%20the,therapeutic%20agent%20for%20thromboembolic%20disorders.Tag: 2017 wikitext editor |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
|
| verifiedrevid = 477396557 |
|
| ImageFile = Glabridin.svg |
|
| ImageFile = Glabridin.svg |
|
|
| IUPACName = (3''R'')-6′′,6′′-Dimethyl-6′′''H''-pyranoisoflavan-2′,4′-diol |
|
| ImageSize = 200px |
|
|
| IUPACName = 4-chromen-3-yl]-1,3-benzenediol |
|
| SystematicName = 4-dipyran)-3-yl]benzene-1,3-diol |
|
| OtherNames = |
|
| OtherNames = |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = <!-- blanked - oldvalue: 59870-68-7 --> |
|
|
| ChEMBL = 480477 |
|
| CASNo = 59870-68-7 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = HOC5567T41 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 480477 |
|
| PubChem = 124052 |
|
| PubChem = 124052 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 110560 |
|
| ChemSpiderID = 110560 |
| ⚫ |
| SMILES = O4c2c1\C=C/C(Oc1ccc2C(c3ccc(O)cc3O)C4)(C)C |
|
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
| ⚫ |
| InChI = 1/C20H20O4/c1-20(2)8-7-16-18(24-20)6-3-12-9-13(11-23-19(12)16)15-5-4-14(21)10-17(15)22/h3-8,10,13,21-22H,9,11H2,1-2H3/t13-/m0/s1 |
|
|
|
| ChEBI = 5369 |
| ⚫ |
| InChIKey = LBQIJVLKGVZRIW-ZDUSSCGKBA |
|
|
⚫ |
| SMILES = O4c2c1\C=C/C(Oc1ccc2C(c3ccc(O)cc3O)C4)(C)C |
| ⚫ |
| StdInChI = 1S/C20H20O4/c1-20(2)8-7-16-18(24-20)6-3-12-9-13(11-23-19(12)16)15-5-4-14(21)10-17(15)22/h3-8,10,13,21-22H,9,11H2,1-2H3/t13-/m0/s1 |
|
|
⚫ |
| InChI = 1/C20H20O4/c1-20(2)8-7-16-18(24-20)6-3-12-9-13(11-23-19(12)16)15-5-4-14(21)10-17(15)22/h3-8,10,13,21-22H,9,11H2,1-2H3/t13-/m0/s1 |
| ⚫ |
| StdInChIKey = LBQIJVLKGVZRIW-ZDUSSCGKSA-N |
|
|
⚫ |
| InChIKey = LBQIJVLKGVZRIW-ZDUSSCGKBA |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChI = 1S/C20H20O4/c1-20(2)8-7-16-18(24-20)6-3-12-9-13(11-23-19(12)16)15-5-4-14(21)10-17(15)22/h3-8,10,13,21-22H,9,11H2,1-2H3/t13-/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChIKey = LBQIJVLKGVZRIW-ZDUSSCGKSA-N |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=20|H=20|O=4 |
|
| C=20 | H=20 | O=4 |
|
| Appearance = Yellowish-brown powder |
|
| Appearance = Yellowish-brown powder |
|
| Density = |
|
| Density = |
|
| MeltingPtCL = 156 |
|
| MeltingPtC = 238-240 |
|
|
| MeltingPt_ref = <ref>] Record for CAS#59870-68-7</ref> |
|
| MeltingPtCH = 158 |
|
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Glabridin''' is a chemical compound that is found in the root extract of ] (''Glycyrrhiza glabra'').<ref>{{Cite journal | vauthors = Kinoshita T, Kajiyama K, Hiraga Y, Takahashi K, Tamura Y, Mizutani K | journal = Heterocycles | title = Isoflavan derivatives from Glycyrrhiza glabra (licorice) | date = 1996 | volume = 43 | issue = 3 | pages = 581–588}}</ref> Glabridin is an ], a type of isoflavonoid. This product is part of a larger family of plant-derived molecules, the ]s. Glabridin effectively inhibits platelet activation, so it might become therapeutic agent for thromboembolic disorders.<ref name="pmid">{{cite journal | vauthors = Chung CL, Chen JH, Huang WC, Sheu JR, Hsia CW, Jayakumar T, Hsia CH, Chiou KR, Hou SM | title = Glabridin, a Bioactive Flavonoid from Licorice, Effectively Inhibits Platelet Activation in Humans and Mice | journal = International Journal of Molecular Sciences | volume = 23 | issue = 19 | date = September 2022 | page = 11372 | pmid = 36232674| pmc = 9570097 | doi = 10.3390/ijms231911372 | doi-access = free }}{{Creative Commons text attribution notice|cc=by4|from this source=yes}}</ref> |
|
|
|
|
|
It is used as an ingredient in cosmetics and is listed in ] (INCI). |
|
|
|
|
|
Glabridin is yellowish-brown powder. It is insoluble in water, but soluble in organic solvents such as ]. |
|
|
|
|
|
==See also== |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
|
|
|
==References== |
|
|
<references /> |
|
|
|
|
|
{{Isoflavane}} |
|
|
|
|
|
] |