| Revision as of 08:05, 3 August 2011 editYobot (talk | contribs)Bots4,733,870 editsm →References: WP:CHECKWIKI error 18 (category with first letter small) + general fixes (BRFA 15) using AWB (7800)← Previous edit |
Latest revision as of 00:39, 12 July 2024 edit undoحسن علي البط (talk | contribs)Extended confirmed users, Pending changes reviewers19,940 edits added Category:Propionic acids using HotCat |
| (18 intermediate revisions by 11 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 400269674 |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageFile=Globoidnan A.svg |
|
|
⚫ |
| verifiedrevid = 442810872 |
| ⚫ |
|ImageSize= |
|
|
⚫ |
| ImageFile=Globoidnan A.svg |
| ⚫ |
|IUPACName=(2''R'')-(3,4-dihydroxyphenyl)-2-{oxy}propanoic acid |
|
|
⚫ |
| ImageSize= |
| ⚫ |
|OtherNames= |
|
|
⚫ |
| PIN=(2''R'')-3-(3,4-Dihydroxyphenyl)-2-<nowiki/>{oxy}propanoic acid |
| ⚫ |
|Section1= {{Chembox Identifiers |
|
|
⚫ |
| OtherNames= |
| ⚫ |
| CASNo=827322-48-5 |
|
|
⚫ |
|Section1={{Chembox Identifiers |
| ⚫ |
| PubChem=3013628 |
|
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| SMILES=C1=CC(=C(C=C1CC(C(=O)O)OC(=O)C2=CC(=C3C=C(C(=CC3=C2)O)O)C4=CC(=C(C=C4)O)O)O)O |
|
|
⚫ |
| CASNo=827322-48-5 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 8UFJ4K6MGW |
|
⚫ |
| PubChem=3013628 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 26333277 |
|
|
| SMILES = c1cc(c(cc1C(C(=O)O)OC(=O)c2cc3cc(c(cc3c(c2)c4ccc(c(c4)O)O)O)O)O)O |
|
|
| InChI = 1/C26H20O10/c27-18-3-1-12(5-20(18)29)6-24(25(33)34)36-26(35)15-7-14-10-22(31)23(32)11-17(14)16(8-15)13-2-4-19(28)21(30)9-13/h1-5,7-11,24,27-32H,6H2,(H,33,34)/t24-/m1/s1 |
|
|
| InChIKey = DHZIDIIBBCIIEG-XMMPIXPABS |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C26H20O10/c27-18-3-1-12(5-20(18)29)6-24(25(33)34)36-26(35)15-7-14-10-22(31)23(32)11-17(14)16(8-15)13-2-4-19(28)21(30)9-13/h1-5,7-11,24,27-32H,6H2,(H,33,34)/t24-/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = DHZIDIIBBCIIEG-XMMPIXPASA-N |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=26|H=20|O=10 |
|
| C=26 | H=20 | O=10 |
|
| MolarMass= |
|
| MolarMass= |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
'''Globoidnan A''' is a ] found in '']'', a tree native to Australia. |
|
'''Globoidnan A''' is a ] found in '']'', a tree native to Australia. |
|
|
|
|
|
The molecule has been found to inhibit the action of HIV ],<ref>{{cite journal |author=Ovenden SP, Yu J, Wan SS, ''et al.'' |title=Globoidnan A: a lignan from Eucalyptus globoidea inhibits HIV integrase |journal = ] |volume=65 |issue=24 |pages=3255–9 |year=2004 |pmid=15561191 |doi=10.1016/j.phytochem.2004.10.006}}</ref> an enzyme which is responsible for the introduction of ] viral ] into a host's cellular ]. So far it is not known that globoidnan A inhibits the action of other retroviral integrases, although it is likely that this possibility will be investigated further. |
|
The molecule has been found to weakly inhibit the action of HIV ] (] = 0.64 μM) '']''.<ref>{{cite journal |vauthors=Ovenden SP, Yu J, Wan SS, etal |title=Globoidnan A: a lignan from Eucalyptus globoidea inhibits HIV integrase |journal=] |volume=65 |issue=24 |pages=3255–59 |year=2004 |pmid=15561191 |doi=10.1016/j.phytochem.2004.10.006 }}</ref> HIV integrase is an enzyme which is responsible for the introduction of ] viral ] into a host's cellular ]. It is not known that globoidnan A inhibits the action of other retroviral integrases. |
|
|
|
|
|
==References== |
|
== References == |
|
{{Reflist}} |
|
{{Reflist}} |
|
|
|
|
|
|
{{organic-compound-stub}} |
|
{{HIVpharm}} |
|
|
|
|
|
{{lignan}} |
|
|
|
{{Lignan}} |
|
|
|
|
|
] |
|
] |
| ⚫ |
] |
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
⚫ |
] |
|
|
|
|
|
|
|
{{antiinfective-drug-stub}} |
|