| Revision as of 05:58, 6 July 2011 editZéroBot (talk | contribs)704,777 editsm r2.7.1) (robot Adding: fr:Glutaconyl-coenzyme A← Previous edit |
Latest revision as of 00:07, 17 July 2024 edit undoCitation bot (talk | contribs)Bots5,391,734 edits Add: doi-access, pmid, authors 1-1. Removed URL that duplicated identifier. Removed parameters. Some additions/deletions were parameter name changes. | Use this bot. Report bugs. | Suggested by Jay8g | #UCB_toolbar |
| (14 intermediate revisions by 12 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 265862814 |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageFile=Glutaconyl-coenzyme A.png |
|
|
⚫ |
| verifiedrevid = 438003154 |
| ⚫ |
|ImageSize=250px |
|
|
⚫ |
| ImageFile=Glutaconyl-coenzyme A.png |
|
|IUPACName=<small>5-methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-2-hydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethylsulfanyl]-5-oxopent-3-enoic acid</small> |
|
|
⚫ |
| ImageSize=250px |
| ⚫ |
|OtherNames=Glutaconyl-coenzyme A |
|
|
|
| IUPACName=(3''E'')-5-oxy}-3,3-dimethylbutanamido]propanamido}ethyl)sulfanyl]-5-oxopent-3-enoic acid |
|
|
| SystematicName=(9''R'',20''E'')-1--3,5,9-trihydroxy-8,8-dimethyl-3,5,10,14,19-pentaoxo-2,4,6-trioxa-18-thia-11,15-diaza-3λ<sup>5</sup>,5λ<sup>5</sup>-diphosphatricos-20-en-23-oic acid |
|
⚫ |
| OtherNames=Glutaconyl-coenzyme A |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo=6712-05-6 |
|
| CASNo=6712-05-6 |
| ⚫ |
| PubChem=741 |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| SMILES=CC(C)(COP(=O)(O)OP(=O)(O)OCC1C(C(C(O1) N2C=NC3=C2N=CN=C3N)O)OP(=O)(O)O)C(C (=O)NCCC(=O)NCCSC(=O)C=CCC(=O)O)O |
|
|
|
| UNII = 281DQF1ZC5 |
| ⚫ |
| MeSHName=glutaconyl-coenzyme+A |
|
|
⚫ |
| PubChem = 9543050 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 7822023 |
|
|
| SMILES = O=C(O)C/C=C/C(=O)SCCNC(=O)CCNC(=O)(O)C(C)(C)COP(=O)(O)OP(=O)(O)OC3O(n2cnc1c(ncnc12)N)(O)3OP(=O)(O)O |
|
|
| InChI = 1/C26H40N7O19P3S/c1-26(2,21(39)24(40)29-7-6-15(34)28-8-9-56-17(37)5-3-4-16(35)36)11-49-55(46,47)52-54(44,45)48-10-14-20(51-53(41,42)43)19(38)25(50-14)33-13-32-18-22(27)30-12-31-23(18)33/h3,5,12-14,19-21,25,38-39H,4,6-11H2,1-2H3,(H,28,34)(H,29,40)(H,35,36)(H,44,45)(H,46,47)(H2,27,30,31)(H2,41,42,43)/b5-3+/t14-,19-,20-,21+,25-/m1/s1 |
|
|
| InChIKey = URTLOTISFJPPOU-DEGQQWIJBS |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C26H40N7O19P3S/c1-26(2,21(39)24(40)29-7-6-15(34)28-8-9-56-17(37)5-3-4-16(35)36)11-49-55(46,47)52-54(44,45)48-10-14-20(51-53(41,42)43)19(38)25(50-14)33-13-32-18-22(27)30-12-31-23(18)33/h3,5,12-14,19-21,25,38-39H,4,6-11H2,1-2H3,(H,28,34)(H,29,40)(H,35,36)(H,44,45)(H,46,47)(H2,27,30,31)(H2,41,42,43)/b5-3+/t14-,19-,20-,21+,25-/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = URTLOTISFJPPOU-DEGQQWIJSA-N |
|
⚫ |
| MeSHName=glutaconyl-coenzyme+A |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>26</sub>H<sub>40</sub>N<sub>7</sub>O<sub>19</sub>P<sub>3</sub>S |
|
| Formula=C<sub>26</sub>H<sub>40</sub>N<sub>7</sub>O<sub>19</sub>P<sub>3</sub>S |
|
| MolarMass=879.62 g/mol |
|
| MolarMass=879.62 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
|
'''Glutaconyl-CoA''' is an intermediate in the metabolism of ].<ref>{{Cite web |title=Glutaryl-CoA Dehydrogenase - an overview |url=https://www.sciencedirect.com/topics/neuroscience/glutaryl-coa-dehydrogenase |access-date=2022-10-18 |website=www.sciencedirect.com}}</ref> It is an organic compound containing a coenzyme substructure, which classifies it as a fatty ester lipid molecule. Being a lipid makes the molecule hydrophobic, which makes it insoluble in water. The molecule has a molecular formula of {{chem2|C26H40N7O19P3S}}, and a molecular weight 879.62 grams per mole.<ref>{{Cite web |title=Human Metabolome Database: Showing metabocard for Glutaconyl-CoA (HMDB0001290) |url=https://hmdb.ca/metabolites/HMDB0001290 |access-date=2022-10-18 |website=hmdb.ca}}</ref> |
|
'''Glutaconyl-CoA''' is an intermediate in the metabolism of ]. |
|
|
|
|
|
|
Glutaconyl-CoA is postulated to be the main toxin in ].<ref>{{Cite journal |last1=Lehnert |first1=Willy |last2=Sass |first2=Jörn Oliver |date=2005-01-01 |title=Glutaconyl-CoA is the main toxic agent in glutaryl-CoA dehydrogenase deficiency (glutaric aciduria type I) |url=https://www.sciencedirect.com/science/article/pii/S0306987705001246 |journal=Medical Hypotheses |volume=65 |issue=2 |pages=330–333 |doi=10.1016/j.mehy.2005.02.021 |pmid=15922108 |issn=0306-9877}}</ref> In certain fermentative bacteria, glutaconyl-CoA decarboxylation is catalyzed by a ] ({{EnzExplorer|7.2.4.5}}) and is coupled with Na<sup>+</sup> ion translocation, which creates a ] as an alternate energy source for these organisms.<ref>{{Cite journal |last1=Kress |first1=Daniel |last2=Brügel |first2=Daniela |last3=Schall |first3=Iris |last4=Linder |first4=Dietmar |last5=Buckel |first5=Wolfgang |last6=Essen |first6=Lars-Oliver |date=October 2009 |title=An Asymmetric Model for Na+-translocating Glutaconyl-CoA Decarboxylases |journal=Journal of Biological Chemistry |volume=284 |issue=41 |pages=28401–28409 |doi=10.1074/jbc.m109.037762 |doi-access=free |issn=0021-9258 |pmc=2788889 |pmid=19654317}}</ref> |
|
|
|
|
|
==See also== |
|
==See also== |
| Line 33: |
Line 49: |
|
* ] |
|
* ] |
|
|
|
|
|
|
== References == |
|
{{Amino acid metabolism intermediates}} |
|
<references />{{Amino acid metabolism intermediates}} |
|
|
|
|
|
] |
|
] |
|
|
|
|
|
|
|
|
|
{{organic-compound-stub}} |
|
{{organic-compound-stub}} |
|
|
|
|
] |
|