| Revision as of 11:07, 8 June 2011 editMystBot (talk | contribs)177,678 editsm r2.7.1) (robot Adding: fr:Glutaryl-coenzyme A← Previous edit |
Latest revision as of 21:33, 13 June 2024 edit undoKormiSK (talk | contribs)Extended confirmed users919 edits - made up info |
| (14 intermediate revisions by 10 users not shown) |
| Line 1: |
Line 1: |
|
|
{{refimprove|date=January 2017}} |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 356739578 |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageFile=Glutaryl coenzyme A.svg |
|
|
⚫ |
| verifiedrevid = 433188358 |
| ⚫ |
|ImageSize=300px |
|
|
⚫ |
| ImageFile=Glutaryl coenzyme A.svg |
|
|IUPACName= |
|
|
⚫ |
| ImageSize=300px |
| ⚫ |
|OtherNames= |
|
|
|
| IUPACName=5-oxy}-3,3-dimethylbutanamido]propanamido}ethyl)sulfanyl]-5-oxopentanoic acid |
| ⚫ |
|Section1= {{Chembox Identifiers |
|
|
|
| SystematicName=(9''R'')-1--3,5,9-trihydroxy-8,8-dimethyl-3,5,10,14,19-pentaoxo-2,4,6-trioxa-18-thia-11,15-diaza-3λ<sup>5</sup>,5λ<sup>5</sup>-diphosphatricosan-23-oic acid |
| ⚫ |
| CASNo=3131-84-8 |
|
|
⚫ |
| OtherNames= |
| ⚫ |
| PubChem=3081383 |
|
|
⚫ |
|Section1={{Chembox Identifiers |
|
| SMILES= |
|
|
|
| CASNo_Ref = {{cascite|correct|??}} |
| ⚫ |
| MeSHName=Glutaryl-coenzyme+A |
|
|
⚫ |
| CASNo=3131-84-8 |
|
⚫ |
| PubChem=3081383 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 2338999 |
|
|
| SMILES = O=C(O)CCCC(=O)SCCNC(=O)CCNC(=O)(O)C(C)(C)COP(=O)(O)OP(=O)(O)OC3O(n2cnc1c(ncnc12)N)(O)3OP(=O)(O)O |
|
|
| InChI = 1/C26H42N7O19P3S/c1-26(2,21(39)24(40)29-7-6-15(34)28-8-9-56-17(37)5-3-4-16(35)36)11-49-55(46,47)52-54(44,45)48-10-14-20(51-53(41,42)43)19(38)25(50-14)33-13-32-18-22(27)30-12-31-23(18)33/h12-14,19-21,25,38-39H,3-11H2,1-2H3,(H,28,34)(H,29,40)(H,35,36)(H,44,45)(H,46,47)(H2,27,30,31)(H2,41,42,43)/t14-,19-,20-,21+,25-/m1/s1 |
|
|
| InChIKey = SYKWLIJQEHRDNH-CKRMAKSABC |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C26H42N7O19P3S/c1-26(2,21(39)24(40)29-7-6-15(34)28-8-9-56-17(37)5-3-4-16(35)36)11-49-55(46,47)52-54(44,45)48-10-14-20(51-53(41,42)43)19(38)25(50-14)33-13-32-18-22(27)30-12-31-23(18)33/h12-14,19-21,25,38-39H,3-11H2,1-2H3,(H,28,34)(H,29,40)(H,35,36)(H,44,45)(H,46,47)(H2,27,30,31)(H2,41,42,43)/t14-,19-,20-,21+,25-/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = SYKWLIJQEHRDNH-CKRMAKSASA-N |
|
⚫ |
| MeSHName=Glutaryl-coenzyme+A |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>26</sub>H<sub>42</sub>N<sub>7</sub>O<sub>19</sub>P<sub>3</sub>S |
|
| Formula=C<sub>26</sub>H<sub>42</sub>N<sub>7</sub>O<sub>19</sub>P<sub>3</sub>S |
|
| MolarMass=881.635 g/mol |
|
| MolarMass=881.635 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
'''Glutaryl-coenzyme A''' is an intermediate in the metabolism of ] and ]. |
|
|
|
'''Glutaryl-coenzyme A''' is an intermediate in the metabolism of ] and ].<ref name="pmid17176108">{{cite journal | vauthors = Rao KS, Albro M, Dwyer TM, Frerman FE | title = Kinetic mechanism of glutaryl-CoA dehydrogenase | journal = Biochemistry | volume = 45 | issue = 51 | pages = 15853–61 | date = Dec 2006 | pmid = 17176108 | doi = 10.1021/bi0609016 }}</ref> |
|
|
|
|
|
==See also== |
|
==See also== |
|
* ] |
|
* ] |
|
|
|
|
|
|
==References== |
| ⚫ |
{{Amino acid metabolism intermediates}} |
|
|
|
{{reflist}} |
|
|
|
|
] |
|
|
|
|
|
|
|
|
|
{{biochem-stub}} |
|
{{biochem-stub}} |
|
|
|
|
|
⚫ |
{{Amino acid metabolism intermediates}} |
| ⚫ |
] |
|
|
|
|
|
] |
|
|
⚫ |
] |