| Revision as of 10:32, 18 January 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: ChEMBL.← Previous edit |
Latest revision as of 12:01, 21 October 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,126 edits removed Category:Phenols; added Category:Hydroxyarenes using HotCat |
| (30 intermediate revisions by 19 users not shown) |
| Line 1: |
Line 1: |
|
{{Orphan|date=February 2009}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 400100916 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 408565402 |
|
| Name=Glycyrrhizol A |
|
| Name=Glycyrrhizol A |
|
| ImageFile = Glycyrrhizol A.png |
|
| ImageFile = Glycyrrhizol A.png |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
| IUPACName = 1-Methoxy-2,8-bis-(3-methyl-but-2-enyl)-6''H''-benzofurochromene-3,9-diol |
|
| PIN = 1-Methoxy-2,8-bis(3-methylbut-2-en-1-yl)-6''H''-benzofuro benzopyran-3,9-diol |
|
| OtherNames = |
|
| OtherNames = |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 9721048 |
|
| ChemSpiderID = 9721048 |
|
| InChI = 1/C26H28O5/c1-14(2)6-8-16-10-18-19-13-30-23-12-21(28)17(9-7-15(3)4)25(29-5)24(23)26(19)31-22(18)11-20(16)27/h6-7,10-12,27-28H,8-9,13H2,1-5H3 |
|
| InChI = 1/C26H28O5/c1-14(2)6-8-16-10-18-19-13-30-23-12-21(28)17(9-7-15(3)4)25(29-5)24(23)26(19)31-22(18)11-20(16)27/h6-7,10-12,27-28H,8-9,13H2,1-5H3 |
|
| InChIKey = CBPFOSMNDISZLV-UHFFFAOYAJ |
|
| InChIKey = CBPFOSMNDISZLV-UHFFFAOYAJ |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 65976 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 522282 |
|
| ChEMBL = 522282 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| Line 17: |
Line 21: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = CBPFOSMNDISZLV-UHFFFAOYSA-N |
|
| StdInChIKey = CBPFOSMNDISZLV-UHFFFAOYSA-N |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 877373-00-7 |
|
| CASNo = 877373-00-7 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 84L7S5MVN5 |
|
| PubChem = 11546269 |
|
| PubChem = 11546269 |
|
| SMILES = o2c1c(cc(c(O)c1)C\C=C(/C)C)c3c2c4c(OC)c(c(O)cc4OC3)C\C=C(/C)C |
|
| SMILES = o2c1c(cc(c(O)c1)C\C=C(/C)C)c3c2c4c(OC)c(c(O)cc4OC3)C\C=C(/C)C |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>26</sub>H<sub>28</sub>O<sub>5</sub> |
|
| Formula = C<sub>26</sub>H<sub>28</sub>O<sub>5</sub> |
|
| MolarMass = 420.50 g/mol |
|
| MolarMass = 420.50 g/mol |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
|
|
|
|
'''Glycyrrhizol A''' is an ] compound isolated from the root of the Chinese ] plant ('']''). |
|
'''Glycyrrhizol A''' is a ] ] and an ] derivative. It is a compound isolated from the root of the ] (''Glycyrrhiza uralensis'').{{cn|date=February 2023}} |
|
|
|
|
|
Recent studies by scientists from ] have suggested that these compounds have ] properties.<ref>{{cite journal | author= He J, Chen L, Shi W, Lu, Q-Y | title=Antibacterial Compounds from ''Glycyrrhiza uralensis'' | journal=] | volume=69| issue=1 | year=2006 | pages=121–124 | id= | doi=10.1021/np058069d | pmid= 16441081}}</ref> The strongest antibacterial activity was observed against '']'', an organism known to cause tooth decay in humans. |
|
It may has '']'' ] properties.<ref name = He>{{cite journal | vauthors= He J, Chen L, Shi W, ((Lu Q-Y)) | title=Antibacterial Compounds from ''Glycyrrhiza uralensis'' | journal= Journal of Natural Products | volume=69| issue=1 | year=2006 | pages=121–124 | doi=10.1021/np058069d | pmid= 16441081| citeseerx=10.1.1.552.7335 }}</ref> In one study, the strongest antibacterial activity was observed against '']'', an organism known to cause tooth decay in humans.<ref name = He/> |
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
|
{{Pterocarpan}} |
| ⚫ |
] |
|
|
|
|
|
⚫ |
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{Polyphenol-stub}} |
|
{{aromatic-stub}} |