| Revision as of 14:07, 9 April 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 479471908 of page Guaiol for the Chem/Drugbox validation project (updated: 'ChEMBL', 'ChEBI', 'CASNo'). |
Latest revision as of 06:59, 13 August 2024 edit Pygos (talk | contribs)Extended confirmed users, New page reviewers2,304 editsNo edit summaryTag: Visual edit |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
|
| verifiedrevid = 486431465 |
|
| ImageFile = Guaiol.svg |
|
| ImageFile = Guaiol.svg |
|
|
| IUPACName = Guai-1(5)-en-11-ol |
|
| ImageSize = 200px |
|
|
| IUPACName = 2--2-propanol |
|
| SystematicName = 2-propan-2-ol |
|
| OtherNames = Champacol |
|
| OtherNames = Champacol,<BR>5-Azulenemethanol |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = <!-- blanked - oldvalue: 489-86-1 --> |
|
|
|
| CASNo = 489-86-1 |
| ⚫ |
| CASN0_Ref = {{cascite|correct|}} |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| ChEMBL = 226915 |
|
|
|
| UNII = I7WP008A91 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
⚫ |
| ChEMBL = 226915 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 5552 |
|
| ChEBI = 5552 |
|
| PubChem = 227829 |
|
| PubChem = 227829 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 198233 |
|
| ChemSpiderID = 198233 |
|
| SMILES = OC(1C\C2=C(/(CC1)C)CC2C)(C)C |
|
| SMILES = OC(1C\C2=C(/(CC1)C)CC2C)(C)C |
|
| InChI = 1/C15H26O/c1-10-5-7-12(15(3,4)16)9-14-11(2)6-8-13(10)14/h10-12,16H,5-9H2,1-4H3/t10-,11-,12+/m0/s1 |
|
| InChI = 1/C15H26O/c1-10-5-7-12(15(3,4)16)9-14-11(2)6-8-13(10)14/h10-12,16H,5-9H2,1-4H3/t10-,11-,12+/m0/s1 |
|
| InChIKey = TWVJWDMOZJXUID-SDDRHHMPBW |
|
| InChIKey = TWVJWDMOZJXUID-SDDRHHMPBW |
| ⚫ |
| StdInChI = 1S/C15H26O/c1-10-5-7-12(15(3,4)16)9-14-11(2)6-8-13(10)14/h10-12,16H,5-9H2,1-4H3/t10-,11-,12+/m0/s1 |
|
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| ⚫ |
| StdInChIKey = TWVJWDMOZJXUID-SDDRHHMPSA-N |
|
|
⚫ |
| StdInChI = 1S/C15H26O/c1-10-5-7-12(15(3,4)16)9-14-11(2)6-8-13(10)14/h10-12,16H,5-9H2,1-4H3/t10-,11-,12+/m0/s1 |
| ⚫ |
}} |
|
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
| ⚫ |
| Section2 = {{Chembox Properties |
|
|
⚫ |
| StdInChIKey = TWVJWDMOZJXUID-SDDRHHMPSA-N |
| ⚫ |
| C=15|H=26|O=1 |
|
|
⚫ |
}} |
|
| Appearance = |
|
|
⚫ |
|Section2={{Chembox Properties |
| ⚫ |
| Density = |
|
|
⚫ |
| C=15|H=26|O=1 |
|
| MeltingPt = |
|
|
| BoilingPtC = 92 |
|
| Appearance = |
|
⚫ |
| Density = 0.961 g/mL |
|
| Solubility = |
|
|
|
| MeltingPtC = 92 |
| ⚫ |
}} |
|
|
|
| BoilingPtC = |
| ⚫ |
| Section3 = {{Chembox Hazards |
|
|
| MainHazards = |
|
| Solubility = |
|
⚫ |
}} |
| ⚫ |
| FlashPt = |
|
|
⚫ |
|Section3={{Chembox Hazards |
|
| Autoignition = |
|
|
|
| MainHazards = |
| ⚫ |
}} |
|
|
⚫ |
| FlashPt = |
|
|
| AutoignitionPt = |
|
⚫ |
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Guaiol''' or '''champacol''' is an ], a ] ] found in several plants, especially in the oil of ] and ].<ref name=webster>The Merriam-Webster Dictionary.</ref> It is a crystalline solid that melts at 92 °].<ref name=alpha>Wolfram Alpha ''Guaiol''</ref> Guaiol is one of many terpenes found in Cannabis and it has been associated with ] activity.<ref>{{Cite journal|last=Hillig|first=Karl W|date=2004-10-01|title=A chemotaxonomic analysis of terpenoid variation in Cannabis|journal=Biochemical Systematics and Ecology|volume=32|issue=10|pages=875–891|doi=10.1016/j.bse.2004.04.004}}</ref><ref>{{Cite journal | doi=10.3389/fnins.2018.00730| title=Cannabis and the Anxiety of Fragmentation—A Systems Approach for Finding an Anxiolytic Cannabis Chemotype| journal=Frontiers in Neuroscience| volume=12| year=2018| last1=Kamal| first1=Brishna S.| last2=Kamal| first2=Fatima| last3=Lantela| first3=Daniel E.| page=730| pmid=30405331| pmc=6204402| doi-access=free}}</ref> |
|
|
|
|
|
==Reactions== |
|
|
|
|
|
Guaiol yields a deep purple color when treated with ] ] reagents.<ref name=waddell>{{cite journal | pmid = 12391567 | year = 2002 | last1 = Waddell | first1 = TG | last2 = Arp | first2 = NW | last3 = Bodine | first3 = KD | last4 = Pagni | first4 = RM | title = The guaiol color reaction | volume = 68 | issue = 10 | pages = 949–50 | doi = 10.1055/s-2002-34931 | journal = Planta Medica}}</ref> Upon heating with ], ] can yield. |
|
|
|
|
|
==See also== |
|
|
* ] |
|
|
* ] |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{alcohol-stub}} |