| Revision as of 12:04, 5 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Wikipedia_talk:WikiProject_Chemicals|error← Previous edit |
Latest revision as of 18:35, 30 September 2024 edit undoMarbletan (talk | contribs)Extended confirmed users5,415 edits →See also: see MOS:NOTSEEALSO |
| (26 intermediate revisions by 19 users not shown) |
| Line 1: |
Line 1: |
|
{{Chembox |
|
{{Chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 438286974 |
|
| verifiedrevid = 448571173 |
|
| ImageFile = HHTDD_structure.png |
|
|
| ImageSize = 150px |
|
| ImageFile = HHTDD.svg |
|
|
| ImageSize = 200px |
|
| IUPACName = 2,6-dioxo-1,3,4,5,7,8-hexanitrodecahydro-1H,5H-diimidazopyrazine |
|
|
|
| PIN = 1,3,4,5,7,8-Hexanitrooctahydrodiimidazopyrazine-2,6(1''H'',3''H'')-dione |
|
| OtherNames = |
|
|
|
| OtherNames = Hexanitrohexaazatricyclododecanedione <br> DTNGU <br> Naza/Namsorguyl/uryl HnHaza/amTcDglcDuryl |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
| ⚫ |
| CASNo = |
|
|
|
| CASNo_Ref = {{cascite|correct|??}} |
| ⚫ |
| PubChem = |
|
|
⚫ |
| CASNo = 115029-33-9 |
| ⚫ |
| SMILES = O=C2N(=O)=O)C3C(N2(=O)=O)N((=O)=O)C1C(N3(=O)=O)N((=O)=O)C(=O)N1(=O)=O |
|
|
⚫ |
| PubChem = 14870237 |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
⚫ |
| SMILES = C12C(N(C3C(N1(=O))N(C(=O)N3(=O))(=O))(=O))N(C(=O)N2(=O))(=O) |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 23078717 |
|
| ChemSpiderID = 23078717 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C6H4N12O14/c19-5-9(15(25)26)1-2(10(5)16(27)28)8(14(23)24)4-3(7(1)13(21)22)11(17(29)30)6(20)12(4)18(31)32/h1-4H |
|
| StdInChI = 1S/C6H4N12O14/c19-5-9(15(25)26)1-2(10(5)16(27)28)8(14(23)24)4-3(7(1)13(21)22)11(17(29)30)6(20)12(4)18(31)32/h1-4H |
|
| InChI=1/C6H4N12O14/c19-5-9(15(25)26)1-2(10(5)16(27)28)8(14(23)24)4-3(7(1)13(21)22)11(17(29)30)6(20)12(4)18(31)32/h1-4H |
|
| InChI=1/C6H4N12O14/c19-5-9(15(25)26)1-2(10(5)16(27)28)8(14(23)24)4-3(7(1)13(21)22)11(17(29)30)6(20)12(4)18(31)32/h1-4H |
|
| InChIKey = ZFBXJPJQJKATGM-UHFFFAOYAE |
|
| InChIKey = ZFBXJPJQJKATGM-UHFFFAOYAE |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = ZFBXJPJQJKATGM-UHFFFAOYSA-N |
|
| StdInChIKey = ZFBXJPJQJKATGM-UHFFFAOYSA-N |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=6|H=4|N=12|O=14 |
|
| Formula = C<sub>6</sub>H<sub>4</sub>N<sub>12</sub>O<sub>14</sub> |
|
|
| MolarMass = 468.168 |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
}} |
|
}} |
|
| Section6 = {{Chembox Explosive |
|
|Section6={{Chembox Explosive |
|
| ShockSens = |
|
| ShockSens = |
|
| FrictionSens = |
|
| FrictionSens = |
|
| ExplosiveV = 9700 ms<sup>-1</sup> |
|
| DetonationV = 9700 m/s |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''HHTDD''' is a powerful but moisture sensitive ] compound. It is essentially an open analogue of the cyclic nitroamine cage compounds such as ]. While it is highly explosive, with a ] even higher than that of CL-20, HHTDD readily decomposes in the presence of even trace amounts of water, making it unsuitable for any practical applications.<ref>{{cite journal|doi =10.1021/jo00010a043|title =Facile synthesis and nitration of cis-syn-cis-2,6-dioxodecahydro-1H,5H-diimidazopyrazine|year =1991|last1 =Vedachalam|first1 =Murugappa|last2 =Ramakrishnan|first2 =Vayalakkavoor T.|last3 =Boyer|first3 =Joseph H.|last4 =Dagley|first4 =Ian J.|last5 =Nelson|first5 =Keith A.|last6 =Adolph|first6 =Horst G.|last7 =Gilardi|first7 =Richard|last8 =George|first8 =Clifford|last9 =Flippen-Anderson|first9 =Judith L.|journal =The Journal of Organic Chemistry|volume =56|issue =10|pages =3413–3419}}</ref> |
|
'''HHTDD''' ('''hexanitrohexaazatricyclododecanedione''') is a powerful but moisture sensitive ] compound. It is essentially an open analogue of the cyclic nitroamine cage compounds such as ]. While it is highly explosive, with a ] even higher than that of CL-20, HHTDD readily decomposes in the presence of even trace amounts of water, making it unsuitable for any practical applications.<ref>{{cite journal|doi =10.1021/jo00010a043|title =Facile synthesis and nitration of cis-syn-cis-2,6-dioxodecahydro-1H,5H-diimidazopyrazine|year =1991|last1 =Vedachalam|first1 =Murugappa|last2 =Ramakrishnan|first2 =Vayalakkavoor T.|last3 =Boyer|first3 =Joseph H.|last4 =Dagley|first4 =Ian J.|last5 =Nelson|first5 =Keith A.|last6 =Adolph|first6 =Horst G.|last7 =Gilardi|first7 =Richard|last8 =George|first8 =Clifford|last9 =Flippen-Anderson|first9 =Judith L.|journal =The Journal of Organic Chemistry|volume =56|issue =10|pages =3413–3419}}</ref> |
|
|
|
|
|
==See also== |
|
==See also== |
| Line 46: |
Line 47: |
|
*] |
|
*] |
|
*] |
|
*] |
|
|
*] |
|
|
|
|
|
==References== |
|
==References== |
| Line 56: |
Line 58: |
|
|
|
|
|
{{Explosive-stub}} |
|
{{Explosive-stub}} |
|
|
|
|
] |
|