| Revision as of 11:12, 9 August 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'UNII').← Previous edit |
Latest revision as of 12:56, 29 January 2023 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers170,249 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
| (28 intermediate revisions by 20 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Orphan|date=April 2011}} |
|
|
|
|
|
{{Drugbox |
|
{{Drugbox |
|
| verifiedrevid = 415517930 |
|
| verifiedrevid = 443853119 |
|
| IUPAC_name = 7,12-bis(1-hydroxyethyl)-3,8,13,17-tetramethyl-21''H'',23''H''-porphine-2,18-dipropanoic acid |
|
| IUPAC_name = 7,12-bis(1-hydroxyethyl)-3,8,13,17-tetramethyl-21''H'',23''H''-porphine-2,18-dipropanoic acid |
|
| image = Hematoporphyrin.png |
|
| image = Hematoporphyrin.png |
|
|
<!--Clinical data--> |
|
| InChI = 1/C34H38N4O6/c1-15-21(7-9-31(41)42)27-14-28-22(8-10-32(43)44)16(2)24(36-28)12-29-34(20(6)40)18(4)26(38-29)13-30-33(19(5)39)17(3)25(37-30)11-23(15)35-27/h11-14,19-20,37-40H,7-10H2,1-6H3,(H,41,42)(H,43,44)/b23-11-,24-12-,25-11-,26-13-,27-14-,28-14-,29-12-,30-13- |
|
|
|
| tradename = |
|
| InChIKey = KFKRXESVMDBTNQ-AMPAVEGJBD |
|
|
⚫ |
| pregnancy_category = |
| ⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
⚫ |
| legal_status = Rx-only |
|
⚫ |
| routes_of_administration = Oral |
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number = 14459-29-1 |
|
⚫ |
| ATC_prefix = none |
|
⚫ |
| ATC_suffix = |
|
⚫ |
| PubChem = 11103 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 10632 |
|
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
⚫ |
| UNII = HBT6M5H379 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 317840 |
|
| ChEMBL = 317840 |
|
|
<!--Chemical data--> |
|
⚫ |
| C=34 | H=38 | N=4 | O=6 |
|
|
| smiles = CC1=C(C2=CC3=NC(=CC4=NC(=CC5=C(C(=C(N5)C=C1N2)C(C)O)C)C(=C4CCC(=O)O)C)C(=C3C)CCC(=O)O)C(C)O |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C34H38N4O6/c1-15-21(7-9-31(41)42)27-14-28-22(8-10-32(43)44)16(2)24(36-28)12-29-34(20(6)40)18(4)26(38-29)13-30-33(19(5)39)17(3)25(37-30)11-23(15)35-27/h11-14,19-20,37-40H,7-10H2,1-6H3,(H,41,42)(H,43,44)/b23-11-,24-12-,25-11-,26-13-,27-14-,28-14-,29-12-,30-13- |
|
| StdInChI = 1S/C34H38N4O6/c1-15-21(7-9-31(41)42)27-14-28-22(8-10-32(43)44)16(2)24(36-28)12-29-34(20(6)40)18(4)26(38-29)13-30-33(19(5)39)17(3)25(37-30)11-23(15)35-27/h11-14,19-20,37-40H,7-10H2,1-6H3,(H,41,42)(H,43,44)/b23-11-,24-12-,25-11-,26-13-,27-14-,28-14-,29-12-,30-13- |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = KFKRXESVMDBTNQ-AMPAVEGJSA-N |
|
| StdInChIKey = KFKRXESVMDBTNQ-AMPAVEGJSA-N |
|
|
| melting_point = 172.5 |
| ⚫ |
| CAS_number = 14459-29-1 |
|
| ⚫ |
| ATC_prefix = none |
|
| ⚫ |
| ATC_suffix = |
|
| ⚫ |
| UNII = HBT6M5H379 |
|
| ⚫ |
| PubChem = 11103 |
|
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ⚫ |
| ChemSpiderID = 10632 |
|
| ⚫ |
| C = 34 | H = 38 | N = 4 | O = 6 |
|
|
| molecular_weight = 598.69 g/mol |
|
|
| smiles = O=C(O)CCC=5c2nc(cc4c(c(c(cc1c(c(c(n1)cc/3nc(c2)\C(=C\3C)CCC(=O)O)C(O)C)C)n4)C(O)C)C)C=5C |
|
| ⚫ |
| bioavailability = |
|
| ⚫ |
| metabolism = |
|
| ⚫ |
| elimination_half-life = |
|
| ⚫ |
| excretion = |
|
| ⚫ |
| pregnancy_category = |
|
| ⚫ |
| legal_status = Rx-only |
|
| ⚫ |
| routes_of_administration = Oral |
|
|
}} |
|
}} |
|
|
|
|
|
'''Hematoporphyrin''' ('''Photodyn''', '''Sensibion''') is an ] ] formed by the ] of ]. Nencki and Zaleski determined its ] in 1900.<ref name="urlSpringerLink - Journal Article">{{cite web | url = http://www.springerlink.com/content/r6116jm001tx1210/ | title = SpringerLink - Journal Article | format = | work = | accessdate = }}</ref> |
|
'''Hematoporphyrin''' ('''Photodyn''', '''Sensibion''') is a ] prepared from ]. It is a derivative of ], where the two vinyl groups have been hydrated (converted to alcohols). It is a deeply colored solid that is usually encountered as a solution. Its ] was determined in 1900.<ref name="urlSpringerLink - Journal Article">{{cite journal | vauthors = Luzgina VN, Filippovich EI, Evstigneeva RP | title = Hematoporphyrin IX | journal = Pharmaceutical Chemistry Journal | date = May 1977 | volume = 11 | issue = 5 | pages = 613–20 | doi = 10.1007/BF00780815 | s2cid = 44554826 | url = https://link.springer.com/article/10.1007%2FBF00780815 }}</ref> |
|
|
|
|
|
|
It is used as a photosensitizer in ]. Acetylation of hematoporphyrin followed by hydrolysis of the product of that reaction affords a mixture called ''hematoporphyrin derivative'' (HPD), which is also used in photodynamic therapy.<ref>{{cite journal | vauthors = Kessel D | title = Hematoporphyrin and HPD: photophysics, photochemistry and phototherapy | journal = Photochemistry and Photobiology | volume = 39 | issue = 6 | pages = 851–9 | date = June 1984 | pmid = 6235529 | doi = 10.1111/j.1751-1097.1984.tb08871.x | s2cid = 20172683 | doi-access = free }}</ref> |
| ⚫ |
Hematoporphyrin has been used as an ] and ] since the 1920s.<ref name="isbn0-911910-13-1">{{cite book | author = O'Neil, Maryadele J. | title = The Merck index: an encyclopedia of chemicals, drugs, and biologicals | publisher = Merck Research Laboratories | location = Rahway, NJ | year = 2001 | pages = | isbn = 0-911910-13-1 | oclc = | doi = | url = }}</ref><ref name="urlHEMATOPORPHYRIN AS A THERAPEUTIC AGENT IN THE PSYCHOSES -- Strecker et al. 90 (6): 1157 -- Am J Psychiatry">{{cite web | url = http://ajp.psychiatryonline.org/cgi/content/abstract/90/6/1157 | title = HEMATOPORPHYRIN AS A THERAPEUTIC AGENT IN THE PSYCHOSES -- Strecker et al. 90 (6): 1157 -- Am J Psychiatry | format = | work = | accessdate = }}</ref> |
|
|
|
|
|
|
⚫ |
Hematoporphyrin has also been used as an ] and ] since the 1920s.<ref name="isbn0-911910-13-1">{{cite book | last = O'Neil | first = Maryadele J. | name-list-style = vanc | title = The Merck index: an encyclopedia of chemicals, drugs, and biologicals | publisher = Merck Research Laboratories | location = Rahway, NJ | year = 2001 | isbn = 0-911910-13-1 | url = https://archive.org/details/merckindexency00onei | url-access = registration }}</ref><ref name="Strecker_1934">{{cite journal | vauthors = Strecker EA, Palmer HP, Braceland FJ | title = Hematoporphyrin as a Therapeutic Agent in the Psychoses | journal = American Journal of Psychiatry | volume = 90 | issue = 6 | pages = 1157–1173 | doi = 10.1176/ajp.90.6.1157 | date = May 1934 }}</ref> |
|
== See also == |
|
|
* ] |
|
|
|
|
|
|
== References == |
|
== References == |
|
{{Reflist|2}} |
|
{{reflist|30em}} |
|
|
|
|
|
{{Antidepressants}} |
|
{{Antidepressants}} |
| Line 50: |
Line 51: |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
{{nervous-system-drug-stub}} |
|
{{nervous-system-drug-stub}} |
|
|
|
|
] |
|