| Revision as of 13:41, 2 January 2011 editThe chemistds (talk | contribs)Extended confirmed users5,761 edits Added stdInChIkey← Previous edit |
Latest revision as of 19:03, 1 June 2021 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 edits move PIN |
| (22 intermediate revisions by 16 users not shown) |
| Line 1: |
Line 1: |
|
|
{{short description|Chemical compound}} |
|
{{Chembox |
|
{{Chembox |
|
|
| Watchedfields = changed |
|
| ImageFile = |
|
|
|
| verifiedrevid = 405493569 |
|
| ImageSize = |
|
|
| IUPACName = heptyl 4-hydroxybenzoate |
|
| ImageFile = heptyl paraben.svg |
|
| OtherNames = |
|
| ImageSize = 200px |
|
|
| ImageFile1 = Heptyl p-hydroxybenzoate ball-and-stick.png |
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
|
| CASNo = |
|
| ImageSize1 = 200px |
|
|
| PIN = Heptyl 4-hydroxybenzoate |
| ⚫ |
| PubChem = 14138 |
|
|
| ChemSpiderID = 13515 |
|
| OtherNames = {{ubl |
|
|
| Heptyl ''p''-hydroxybenzoate; |
| ⚫ |
| SMILES = O=C(OCCCCCCC)c1ccc(O)cc1 |
|
|
|
| Heptyl paraben; |
| ⚫ |
| StdInChI=1S/C14H20O3/c1-2-3-4-5-6-11-17-14(16)12-7-9-13(15)10-8-12/h7-10,15H,2-6,11H2,1H3 |
|
|
|
| Heptylparaben; |
|
|
| Nipaheptyl; |
|
|
| ''n''-Heptyl 4-hydroxybenzoate; |
|
|
| ''n''-Heptyl ''p''-hydroxybenzoate; |
|
|
| Heptyl ''para''-hydroxybenzoate; |
|
|
| E209 |
|
|
}} |
|
⚫ |
|Section1={{Chembox Identifiers |
|
|
| CASNo = 1085-12-7 |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
⚫ |
| PubChem = 14138 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 13515 |
|
|
| UNII = K2CIJ448IX |
|
⚫ |
| SMILES = O=C(OCCCCCCC)c1ccc(O)cc1 |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChI=1S/C14H20O3/c1-2-3-4-5-6-11-17-14(16)12-7-9-13(15)10-8-12/h7-10,15H,2-6,11H2,1H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = ZTJORNVITHUQJA-UHFFFAOYSA-N |
|
| StdInChIKey = ZTJORNVITHUQJA-UHFFFAOYSA-N |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=14 | H=20 | O=3 |
|
| Formula = C<sub>14</sub>H<sub>20</sub>O<sub>3</sub> |
|
|
| MolarMass = 236.307 |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Heptyl ''p''-hydroxybenzoate''' is a ] with formula C<sub>7</sub>H<sub>15</sub>(C<sub>6</sub>H<sub>4</sub>OHCOO). It is the ] ] of ]. |
|
'''Heptylparaben''' (heptyl ''p''-hydroxybenzoate) is a ] with formula C<sub>7</sub>H<sub>15</sub>(C<sub>6</sub>H<sub>4</sub>OHCOO). It is a ] which is the ] ] of ]. |
|
|
|
|
|
|
Heptylparaben has also been found to be produced in some microorganisms including '']''.<ref>{{Cite journal | doi = 10.1128/AEM.00494-06 | pmid = 16885309 | title = Discovery of a Marine Bacterium Producing 4-Hydroxybenzoate and Its Alkyl Esters, Parabens | journal = Applied and Environmental Microbiology | volume = 72 | issue = 8 | pages = 5556 | year = 2006 | last1 = Peng | first1 = X | last2 = Adachi | first2 = K | last3 = Chen | first3 = C | last4 = Kasai | first4 = H | last5 = Kanoh | first5 = K | last6 = Shizuri | first6 = Y | last7 = Misawa | first7 = N | pmc = 1538717 }}</ref> |
|
It has ] "E209". |
|
|
|
|
|
|
|
As a food additive it has ] E209, and is used as a preservative. |
|
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
|
|
|
|
|
{{phenol-stub}} |
|
|
|
|
|
⚫ |
] |
|
{{organic-compound-stub}} |
|
|
|
|
| ⚫ |
] |
|