| Revision as of 00:06, 12 April 2011 editGrutness (talk | contribs)Autopatrolled, Administrators316,282 editsmNo edit summary← Previous edit |
Latest revision as of 17:18, 2 May 2023 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 edits move systematic name |
| (27 intermediate revisions by 19 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 404631640 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 423602723 |
|
| Name = Herbacetin |
|
| Name = Herbacetin |
|
| ImageFile = Herbacetin.PNG |
|
| ImageFile = Herbacetin.svg |
|
⚫ |
| ImageAlt = Chemical structure of herbacetin |
|
| ImageSize = 200px |
|
|
|
| ImageFile1 = Herbacetin-3D-balls.png |
| ⚫ |
| ImageName = Chemical structure of herbacetin |
|
|
|
| ImageAlt1 = Ball-and-stick model of the herbacetin molecule |
| ⚫ |
| IUPACName = 3,5,7,8-tetrahydroxy-2-(4-hydroxyphenyl)chromen-4-one |
|
|
|
| IUPACName = 3,4′,5,7,8-Pentahydroxyflavone |
|
⚫ |
| SystematicName = 3,5,7,8-Tetrahydroxy-2-(4-hydroxyphenyl)-4''H''-1-benzopyran-4-one |
|
| OtherNames = 8-Hydroxykaempferol<!-- <br> --> |
|
| OtherNames = 8-Hydroxykaempferol<!-- <br> --> |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| CASNo = 527-95-7 |
|
| CASNo = 527-95-7 |
|
| CASNo_Ref = |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| CASOther = |
|
|
|
|
|
|
| UNII = 736854V2KE |
|
|
| CASNoOther = |
|
| PubChem = 5280544 |
|
| PubChem = 5280544 |
|
|
| ChEBI = 27673 |
|
| SMILES = C1=CC(=CC=C1C2=C(C(=O)C3=C(O2)C(=C(C=C3O)O)O)O)O |
|
| SMILES = C1=CC(=CC=C1C2=C(C(=O)C3=C(O2)C(=C(C=C3O)O)O)O)O |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| InChI = |
|
|
|
| ChemSpiderID = 4444174 |
|
|
| InChI = 1/C15H10O7/c16-7-3-1-6(2-4-7)14-13(21)12(20)10-8(17)5-9(18)11(19)15(10)22-14/h1-5,16-19,21H |
|
|
| InChIKey = ZDOTZEDNGNPOEW-UHFFFAOYAP |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C15H10O7/c16-7-3-1-6(2-4-7)14-13(21)12(20)10-8(17)5-9(18)11(19)15(10)22-14/h1-5,16-19,21H |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = ZDOTZEDNGNPOEW-UHFFFAOYSA-N |
|
| MeSHName = |
|
| MeSHName = |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=15 | H=10 | O=7 |
|
| Formula = C<sub>15</sub>H<sub>10</sub>O<sub>7</sub> |
|
|
| MolarMass = 302.23 g/mol |
|
|
| ExactMass = 302.042653 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = 1.799 g/mL |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPt = |
|
| BoilingPt = <!-- °C --> |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
| Line 29: |
Line 42: |
|
'''Herbacetin''' is a ], a type of flavonoid. |
|
'''Herbacetin''' is a ], a type of flavonoid. |
|
|
|
|
|
|
== Glycosides == |
| ⚫ |
==Glycoside and other related compounds == |
|
|
] can be isolated from ] hulls.<ref> |
|
] can be isolated from ] hulls.<ref>{{Cite journal | last1 = Struijs | first1 = K. | last2 = Vincken | first2 = J. P. | last3 = Verhoef | first3 = R. | last4 = Van Oostveen-Van Casteren | first4 = W. H. M. | last5 = Voragen | first5 = A. G. J. | last6 = Gruppen | first6 = H. | doi = 10.1016/j.phytochem.2006.10.022 | title = The flavonoid herbacetin diglucoside as a constituent of the lignan macromolecule from flaxseed hulls | journal = Phytochemistry | volume = 68 | issue = 8 | pages = 1227–1235 | year = 2007 | pmid = 17141814}}</ref> |
|
|
|
|
|
] is a herbacetin ] found in '']'' species.<ref>{{Cite journal | last1 = Li | first1 = T. | last2 = Zhang | first2 = H. | doi = 10.1248/cpb.56.807 | title = Identification and Comparative Determination of Rhodionin in Traditional Tibetan Medicinal Plants of Fourteen Rhodiola Species by High-Performance Liquid Chromatography-Photodiode Array Detection and Electrospray Ionization-Mass Spectrometry | journal = Chemical & Pharmaceutical Bulletin | volume = 56 | issue = 6 | pages = 807–14 | year = 2008 | pmid = 18520085| doi-access = free }}</ref> |
|
|
|
|
|
⚫ |
== Other related compounds == |
|
], a ], is the product of the oxidative coupling of ] with the 7,8-dihydroxy grouping of herbacetin. It can be found in the rhizome of '']''.<ref> |
|
], a ], is the product of the oxidative coupling of ] with the 7,8-dihydroxy grouping of herbacetin. It can be found in the rhizome of '']''.<ref>{{Cite journal | last1 = Zapesochnaya | first1 = G. G. | last2 = Kurkin | first2 = V. A. | doi = 10.1007/BF00579955 | title = The flavonoids of the rhizomes ofRhodiola rosea. II. A flavonolignan and glycosides of herbacetin | journal = Chemistry of Natural Compounds | volume = 19 | pages = 21–29 | year = 1983 | s2cid = 7656479 }}</ref> |
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist}} |
|
{{Reflist}} |
|
|
|
|
|
{{flavonol}} |
|
{{flavonol}} |
| Line 42: |
Line 58: |
|
] |
|
] |
|
|
|
|
|
{{Natural-phenol-stub}} |
|
{{aromatic-stub}} |