Misplaced Pages

Hipposudoric acid: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 21:51, 5 December 2010 editحسن علي البط (talk | contribs)Extended confirmed users, Pending changes reviewers19,940 edits added Category:Acetic acids using HotCat← Previous edit Latest revision as of 01:45, 2 December 2024 edit undoCitation bot (talk | contribs)Bots5,418,272 edits Add: date, bibcode. | Use this bot. Report bugs. | Suggested by Whoop whoop pull up | Category:Hippopotamuses | #UCB_Category 10/12 
(38 intermediate revisions by 22 users not shown)
Line 1: Line 1:
{{chembox {{Chembox
| Watchedfields = changed
| verifiedrevid = 400110193 | verifiedrevid = 400736798
| ImageFile1 = Hipposudoric acid.png | ImageFile1 = Hipposudoric acid.png
| ImageSize1 = 200px
| ImageFile2 = Hipposudoric.png | ImageFile2 = Hipposudoric.png
⚫ | PIN = 3-(Carboxymethyl)-5-hydroxy-1,4,8-trioxo-4,8-dihydro-1''H''-fluorene-9-carboxylic acid
| ImageSize2 = 200px
⚫ | IUPACName = 3-Carboxymethyl-5-hydroxy-1,4,8-trioxo-4,8-dihydro-1''H''-fluorene-9-carboxylic acid
| OtherNames = | OtherNames =
| Section1 = {{Chembox Identifiers |Section1={{Chembox Identifiers
| Abbreviations = | Abbreviations =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 21474973 | ChemSpiderID = 26546345
⚫ | InChI =
| InChI = 1/C15H6O8/c16-5-1-2-6(17)9-8(5)11-10(12(9)15(22)23)7(18)3-4(13(11)19)14(20)21/h1-3,16H,(H,20,21)(H,22,23)
| InChIKey = VQUMVNJFHSBVDL-UHFFFAOYAR | InChIKey =
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C15H6O8/c16-5-1-2-6(17)9-8(5)11-10(12(9)15(22)23)7(18)3-4(13(11)19)14(20)21/h1-3,16H,(H,20,21)(H,22,23) | StdInChI = 1S/C16H8O8/c17-6-1-2-7(18)11-10(6)13-12(14(11)16(23)24)8(19)3-5(15(13)22)4-9(20)21/h1-3,17H,4H2,(H,20,21)(H,23,24)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = VQUMVNJFHSBVDL-UHFFFAOYSA-N | StdInChIKey = JTNHFMSBPHUJFI-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|changed|??}}
| CASNo = 851367-73-2 | CASNo = 851367-73-2
| EINECS = | EINECS =
| PubChem = | PubChem = 71308217
| SMILES = c1cc(=O)c-2c(c3=c(c2c1O)c(=O)c(cc3=O)C(=O)O)C(=O)O | SMILES = O=C1C=CC(O)=C2C(C(C(CC(O)=O)=CC3=O)=O)=C3C(C(O)=O)=C12
⚫ | InChI =
| RTECS = | RTECS =
| MeSHName = | MeSHName =
| ChEBI = | ChEBI =
| KEGG = | KEGG =
}}
| ATCCode_prefix =
⚫ |Section2={{Chembox Properties
| ATCCode_suffix =
⚫ | C=16 | H=8 | O=8
| ATC_Supplemental =}}
⚫ | Section2 = {{Chembox Properties
⚫ | C = 16 | H = 8 | O = 8
| Appearance = Red | Appearance = Red
| Density = | Density =
| MeltingPt = | MeltingPt =
| Melting_notes = | MeltingPt_notes =
| BoilingPt = | BoilingPt =
| Boiling_notes = | BoilingPt_notes =
| Solubility = | Solubility =
| SolubleOther = | SolubleOther =
| Solvent = | Solvent =
| pKa = | pKa =
| pKb = }} | pKb =
}}
| Section7 = {{Chembox Hazards |Section7={{Chembox Hazards
| ExternalMSDS = | ExternalSDS =
| EUClass =
| EUIndex =
| MainHazards = | MainHazards =
| NFPA-H = | NFPA-H =
| NFPA-F = | NFPA-F =
| NFPA-R = | NFPA-R =
| NFPA-O = | NFPA-S =
| RPhrases =
| SPhrases =
| RSPhrases =
| FlashPt = | FlashPt =
| Autoignition = | AutoignitionPt =
| ExploLimits = | ExploLimits =
| PEL = }} | PEL =
}}
}} }}


'''Hipposudoric acid''' is a red ] found in the ] secretions of the ];<ref>{{cite journal | journal = Pure Appl. Chem. | volume = 79 | issue = 4 | pages = 507–517 | year = 2007 | doi = 10.1351/pac200779040507 | title = Studies on the red sweat of the Hippopotamus amphibius | author = Kimiko Hashimoto, Yoko Saikawa, and Masaya Nakata | url = http://media.iupac.org/publications/pac/2007/pdf/7904x0507.pdf}}</ref> although the secretions are often known as "blood sweat" (thus the name "hipposudoric", referring to "hippo sweat"), they are neither blood nor sweat. '''Hipposudoric acid''' is a red ] found in the ] secretions of the ];<ref>{{cite journal | journal = Pure Appl. Chem. | volume = 79 | issue = 4 | pages = 507–517 | year = 2007 | doi = 10.1351/pac200779040507 | title = Studies on the red sweat of the Hippopotamus amphibius |author1=Kimiko Hashimoto |author2=Yoko Saikawa |author3=Masaya Nakata | s2cid = 12944558 | url = http://media.iupac.org/publications/pac/2007/pdf/7904x0507.pdf}}</ref> although the secretions are often known as "blood sweat" (thus the name "hipposudoric", referring to "hippo sweat"), they are neither blood nor sweat.


Like its orange-colored ] norhipposudoric acid, hipposudoric acid functions both as a natural ] and as an ] agent. It is derived from the oxidative dimerization of ].<ref>{{cite journal | title = Properties of the enzyme responsible to the synthesis of hipposudoric and norhipposudoric acids, the pigments in the red sweat of the hippopotamus | author = Moriya Kai, Matsuura Masanori, Saikawa Yoko, Hashimoto Kimiko, Yamaguguchi Ayumu, Sakamoto Kazuhiro, Akihisa Narito, Hirata Hiroyoshi | journal = Nippon Kagakkai Koen Yokoshu | volume = 86 | issue = 2 | pages = 1314 | year = 2006 | url = http://sciencelinks.jp/j-east/article/200618/000020061806A0436283.php}}</ref> Like its orange-colored ] norhipposudoric acid, hipposudoric acid functions both as a natural ] and as an ] agent.<ref>{{cite journal | title = The red sweat of the hippopotamus | author1=Yoko Saikawa | author2=Kimiko Hashimoto | author3=Teruyuki Komiya | journal=Nature | year=2004 | volume=429 | issue=6990 | page=363 | doi=10.1038/429363a | pmid=15164051 | s2cid=4404922 | doi-access=free | bibcode=2004Natur.429..363S }}</ref> It is derived from the oxidative dimerization of ].<ref>{{cite journal |title=Properties of the enzyme responsible to the synthesis of hipposudoric and norhipposudoric acids, the pigments in the red sweat of the hippopotamus |author1=Moriya Kai |author2=Matsuura Masanori |author3=Saikawa Yoko |author4=Hashimoto Kimiko |author5=Yamaguguchi Ayumu |author6=Sakamoto Kazuhiro |author7=Akihisa Narito |author8=Hirata Hiroyoshi |journal=Nippon Kagakkai Koen Yokoshu |volume=86 |issue=2 |pages=1314 |year=2006 |url=http://sciencelinks.jp/j-east/article/200618/000020061806A0436283.php |access-date=2009-04-11 |archive-date=2012-02-17 |archive-url=https://web.archive.org/web/20120217004657/http://sciencelinks.jp/j-east/article/200618/000020061806A0436283.php |url-status=dead }}</ref>


It has been both ] that hipposudoric acid colors hippo ] ]. This is not the case; hippo milk is white or beige in color.<ref>{{Cite web|title=FACT CHECK: Is Hippopotamus Milk Pink?|url=https://www.snopes.com/fact-check/false-hippopotamus-milk-pink/|access-date=2022-02-16|website=Snopes.com|date=6 January 2016 |language=en-US}}</ref>
⚫ ]{{clear-left}}

⚫ ]{{clear left}}


==References== ==References==
Line 70: Line 66:


] ]
] ]
] ]
⚫ ]
] ]
⚫ ]
]