| Revision as of 22:07, 19 April 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 08:19, 1 August 2023 edit undoJosve05a (talk | contribs)Autopatrolled, Extended confirmed users, New page reviewers, Pending changes reviewers, Rollbackers155,244 edits →Glycosides: | Alter: template type. Add: s2cid, bibcode, pages, issue, volume, journal, year, title, doi, authors 1-2. Changed bare reference to CS1/2. | Use this tool. Report bugs. | #UCB_Gadget |
| (17 intermediate revisions by 12 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 404640842 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| Name = Hirsutidin |
|
|
⚫ |
| verifiedrevid = 424926720 |
| ⚫ |
| ImageFile = Hirsutidin.svg |
|
|
⚫ |
| Name = Hirsutidin |
|
| ImageSize = 250px |
|
|
⚫ |
| ImageFile = Hirsutidin.svg |
|
| IUPACName = 2-(4-hydroxy-3,5-dimethoxyphenyl)-7-methoxychromenylium-3,5-diol |
|
|
| OtherNames = |
|
| ImageSize = 250px |
|
|
| IUPACName = 3,4′,5-Trihydroxy-3′,5′,7-trimethoxyflavylium |
| ⚫ |
| Section1={{Chembox Identifiers |
|
|
|
| SystematicName = 3,5-Dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-7-methoxy-1λ<sup>4</sup>-benzopyran-1-ylium |
| ⚫ |
| CASNo = 4092-66-4 |
|
|
| PubChem = 441694 |
|
| OtherNames = |
|
⚫ |
|Section1={{Chembox Identifiers |
|
| SMILES = COC1=CC2=C(=C(C=C2C(=C1)O)O)C3=CC(=C(C(=C3)OC)O)OC |
|
|
|
| index2_label = (chloride) |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CASNo = 151776-57-7 |
|
|
| CASNo2_Ref = {{cascite|correct|CAS}} |
|
⚫ |
| CASNo2 = 4092-66-4 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = VV9H579AR2 |
|
|
| UNII2_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII2 = UX37SFW7Y9 |
|
|
| PubChem = 441694 |
|
|
| SMILES = Oc1cc2c(O)cc(OC)cc2c1c3cc(OC)c(O)c(OC)c3 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 390303 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 5728 |
|
|
| InChI = 1/C18H16O7/c1-22-10-6-12(19)11-8-13(20)18(25-14(11)7-10)9-4-15(23-2)17(21)16(5-9)24-3/h4-8H,1-3H3,(H2-,19,20,21)/p+1 |
|
|
| InChIKey = JGPCLGHKWGCWNO-IKLDFBCSAS |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C18H16O7/c1-22-10-6-12(19)11-8-13(20)18(25-14(11)7-10)9-4-15(23-2)17(21)16(5-9)24-3/h4-8H,1-3H3,(H2-,19,20,21)/p+1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = JGPCLGHKWGCWNO-UHFFFAOYSA-O |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>18</sub>H<sub>17</sub>O<sub>7</sub>+ |
|
| Formula = C<sub>18</sub>H<sub>17</sub>O<sub>7</sub>+ |
|
| MolarMass = 345.32 g/mol |
|
| MolarMass = 345.32 g/mol |
|
|
| Appearance = |
|
| ExactMass = 345.097428 |
|
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Hirsutidin''' is an ], a <!-- water soluble, bluish red plant dye -->chemical compound belonging to the anthocyanins. It can be found in '']''<ref></ref> (Madagascar periwinkle) where it is the prominent compound in petals and can also be found in ] cultures.<ref></ref> |
|
'''Hirsutidin''' is an ], a <!-- water soluble, bluish red plant dye -->chemical compound belonging to the anthocyanins. It can be found in '']''<ref></ref> (Madagascar periwinkle) where it is the prominent compound in petals and can also be found in ] cultures.<ref></ref> |
|
|
|
|
|
==glycosides== |
|
== Glycosides == |
|
3-O-(6-O-p-]) ] of hirsutidin can also be found in ''Catharanthus roseus''.<ref> |
|
3-O-(6-O-]) ] of hirsutidin can also be found in ''Catharanthus roseus''.<ref>{{cite journal | url=https://doi.org/10.1007%2Fs11101-006-9052-y | doi=10.1007/s11101-006-9052-y | title=Anthocyanins in Catharanthus roseus in vivo and in vitro: A review | year=2007 | last1=Piovan | first1=Anna | last2=Filippini | first2=Raffaella | journal=Phytochemistry Reviews | volume=6 | issue=2–3 | pages=235–242 | bibcode=2007PChRv...6..235P | s2cid=676724 }}</ref> |
|
|
|
|
|
==References== |
|
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
<!-- ==External links== |
|
<!-- ==External links== |
| Line 38: |
Line 58: |
|
{{anthocyanins}} |
|
{{anthocyanins}} |
|
|
|
|
|
] |
|
] |
|
] |
|