| Revision as of 14:39, 18 July 2011 editNono64 (talk | contribs)Autopatrolled, Pending changes reviewers, Rollbackers96,246 editsm Category:Phenolic compounds in wine← Previous edit |
Latest revision as of 16:46, 17 March 2023 edit undoCitation bot (talk | contribs)Bots5,418,263 edits Add: s2cid, pmid, authors 1-1. Removed parameters. Some additions/deletions were parameter name changes. | Use this bot. Report bugs. | Suggested by Whoop whoop pull up | #UCB_webform 557/3819 |
| (22 intermediate revisions by 12 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 429723589 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 440126165 |
|
| Name = Hopeaphenol |
|
| Name = Hopeaphenol |
|
| ImageFile = Hopeaphenol.svg |
|
| ImageFile = Hopeaphenol.svg |
| Line 7: |
Line 9: |
|
| ImageAlt = Chemical structure of hopeaphenol |
|
| ImageAlt = Chemical structure of hopeaphenol |
|
| IUPACName = |
|
| IUPACName = |
|
| OtherNames = |
|
| OtherNames = (-)-hopeaphenol |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| CASNo = 17912-85-5 |
|
| CASNo = 17912-85-5 |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASOther = |
|
| CASNoOther = |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 8K2E6922LC |
|
| PubChem = 495605 |
|
| PubChem = 495605 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 1082601 |
|
| SMILES = OC(C=C1)=CC=C12OC3=CC(O)=CC4=C32()C(C=C(O)C=C5O)=C5(C6=CC=C(O)C=C6)4()7()(C8=CC=C(O)C=C8)C9=C(C=C(O)C=C9O)%10()C%11=C7C=C(O)C=C%11O%10C%12=CC=C(O)C=C%12 |
|
| SMILES = OC(C=C1)=CC=C12OC3=CC(O)=CC4=C32()C(C=C(O)C=C5O)=C5(C6=CC=C(O)C=C6)4()7()(C8=CC=C(O)C=C8)C9=C(C=C(O)C=C9O)%10()C%11=C7C=C(O)C=C%11O%10C%12=CC=C(O)C=C%12 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| InChI = |
|
|
|
| ChemSpiderID = 10277817 |
|
|
| InChI = 1/C56H42O12/c57-29-9-1-25(2-10-29)45-47-37(17-33(61)21-41(47)65)53-49-39(19-35(63)23-43(49)67-55(53)27-5-13-31(59)14-6-27)51(45)52-40-20-36(64)24-44-50(40)54(56(68-44)28-7-15-32(60)16-8-28)38-18-34(62)22-42(66)48(38)46(52)26-3-11-30(58)12-4-26/h1-24,45-46,51-66H/t45-,46-,51-,52-,53-,54-,55+,56+/m0/s1 |
|
|
| InChIKey = YQQUILZPDYJDQJ-QWJFNKQSBW |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C56H42O12/c57-29-9-1-25(2-10-29)45-47-37(17-33(61)21-41(47)65)53-49-39(19-35(63)23-43(49)67-55(53)27-5-13-31(59)14-6-27)51(45)52-40-20-36(64)24-44-50(40)54(56(68-44)28-7-15-32(60)16-8-28)38-18-34(62)22-42(66)48(38)46(52)26-3-11-30(58)12-4-26/h1-24,45-46,51-66H/t45-,46-,51-,52-,53-,54-,55+,56+/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = YQQUILZPDYJDQJ-QWJFNKQSSA-N |
|
| MeSHName = |
|
| MeSHName = |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=56|H=42|O=12 |
|
| C=56 | H=42 | O=12 |
|
| ExactMass = 906.267627 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPt = |
|
| BoilingPt = <!-- °C --> |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
| RPhrases = |
|
|
| SPhrases = |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
⚫ |
'''Hopeaphenol''' is a ]. It is a ] ]. It has been first isolated from ]<ref>The structure of hopeaphenol. P. Coggon, T. J. King and S. C. Wallwork, Chem. Commun. (London), 1966, pages 439-440, {{doi|10.1039/C19660000439}}</ref> like '']''.<ref>The Isolation of Hopeaphenol, a Tetramer Stilbene, from Shorea ovalis Blume. Advances in Natural & Applied Sciences, January–April 2009, Volume 3, Issue 1, page 107 ()</ref> It has also been isolated from ]s from North Africa.<ref>{{cite journal | title = Hopeaphenol: The First Resveratrol Tetramer in Wines from North Africa |author1=Habiba Amira Guebailia |author2=Kleopatra Chira |author3=Tristan Richard |author4=Teguiche Mabrouk |author5=Aurélie Furiga |author6=Xavier Vitrac |author7=Jean-Pierre Monti |author8=Jean-Claude Delaunay |author9=Jean-Michel Mérillon | journal = J. Agric. Food Chem. | year = 2006 | volume = 54 | pages = 9559–9564 | doi = 10.1021/jf062024g | issue = 25 | pmid = 17147446}}</ref> |
|
|
|
|
|
|
It shows an opposite effect to ] on apoptosis of myocytes isolated from adult rat heart.<ref>{{cite journal | last1=Seya | first1=Kazuhiko | last2=Kanemaru | first2=Kouta | last3=Sugimoto | first3=Chiharu | last4=Suzuki | first4=Megumi | last5=Takeo | first5=Teruko | last6=Motomura | first6=Shigeru | last7=Kitahara | first7=Haruo | last8=Niwa | first8=Masatake | last9=Oshima | first9=Yoshiteru | last10=Furukawa | first10=Ken-Ichi |display-authors=5| title=Opposite Effects of Two Resveratrol (trans-3,5,4′-Trihydroxystilbene) Tetramers, Vitisin A and Hopeaphenol, on Apoptosis of Myocytes Isolated from Adult Rat Heart | journal=Journal of Pharmacology and Experimental Therapeutics | publisher=American Society for Pharmacology & Experimental Therapeutics (ASPET) | volume=328 | issue=1 | date=2008-10-16 | issn=0022-3565 | doi=10.1124/jpet.108.143172 | pages=90–98| pmid=18927354 | s2cid=22844861 }}</ref> |
| ⚫ |
'''Hopeaphenol''' is a ]. It is a ] ] isolated from wines.<ref>{{cite journal | title = Hopeaphenol: The First Resveratrol Tetramer in Wines from North Africa | author = Habiba Amira Guebailia, Kleopatra Chira, Tristan Richard, Teguiche Mabrouk, Aurélie Furiga, Xavier Vitrac, Jean-Pierre Monti, Jean-Claude Delaunay and Jean-Michel Mérillon | journal = J. Agric. Food Chem. | year = 2006 | volume = 54 | pages = 9559–9564 | doi = 10.1021/jf062024g | issue = 25 | pmid = 17147446}}</ref> |
|
|
|
|
|
|
⚫ |
== See also == |
|
It shows an opposite effect to ] on apoptosis of myocytes isolated from adult rat heart.<ref>Opposite Effects of Two Resveratrol (trans-3,5,4′-Trihydroxystilbene) Tetramers, Vitisin A and Hopeaphenol, on Apoptosis of Myocytes Isolated from Adult Rat Heart. Kazuhiko Seya, Kouta Kanemaru, Chiharu Sugimoto, Megumi Suzuki, Teruko Takeo, Shigeru Motomura, Haruo Kitahara, Masatake Niwa, Yoshiteru Oshima and Ken-Ichi Furukawa, JPET January 2009 vol. 328 no. 1 90-98, {{doi|10.1124/jpet.108.143172}}</ref> |
|
|
|
|
| ⚫ |
==See also== |
|
|
* ] |
|
* ] |
|
|
|
|
|
==References== |
|
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
{{stilbenoid}} |
|
{{Oligostilbenoid}} |
|
|
|
| ⚫ |
] |
|
|
] |
|
|
|
|
|
|
|
] |
|
{{Natural-phenol-stub}} |
|
|
|
] |
|
⚫ |
] |