| Revision as of 14:41, 21 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 443861708 of page Hydramethylnon for the Chem/Drugbox validation project (updated: 'ChEMBL'). |
Latest revision as of 21:14, 15 December 2024 edit Bosula (talk | contribs)Extended confirmed users561 edits add linkTag: Visual edit |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 443859726 |
|
| verifiedrevid = 461771725 |
|
| Name = Hydramethylnon |
|
| Name = Hydramethylnon |
|
| ImageFile = Hydramethylnon.png |
|
| ImageFile = Hydramethylnon.svg |
|
| IUPACName = 2(1''H'')-pyrimidinone, tetrahydro-5,5-dimethyl-, |
|
| IUPACName=2(1H-4,4-dimethyl tetrahydro pyrimidinylidene ) |
|
(3-(4-(trifluoromethyl)phenyl) |
|
(3-(4-(trifluoromethyl)phenyl) |
|
-1-(2-(4-(trifluoromethyl)phenyl)ethenyl) |
|
-1-(2-(4-(trifluoromethyl)phenyl)ethenyl) |
|
-2-propenylidene)hydrazone |
|
-2-propenylidene)hydrazone |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 4445168 |
|
| ChemSpiderID = 4445168 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 464812 |
|
| ChEMBL = 464812 |
|
| PubChem = 5281875 |
|
| PubChem = 5281875 |
| Line 21: |
Line 21: |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = 67485-29-4 |
|
| CASNo = 67485-29-4 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = J265GZ7MFJ |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = C10994 |
|
| KEGG = C10994 |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 38531 |
|
| ChEBI = 38531 |
|
| SMILES = FC(F)(F)c1ccc(cc1)\C=C\C(=N/N/C2=N/CC(C)(C)CN2)/C=C/c3ccc(cc3)C(F)(F)F |
|
| SMILES = FC(F)(F)c1ccc(cc1)C=CC(=NNC2=NCC(C)(C)CN2)C=Cc3ccc(cc3)C(F)(F)F |
|
| InChI = 1/C25H24F6N4/c1-23(2)15-32-22(33-16-23)35-34-21(13-7-17-3-9-19(10-4-17)24(26,27)28)14-8-18-5-11-20(12-6-18)25(29,30)31/h3-14H,15-16H2,1-2H3,(H2,32,33,35)/b13-7+,14-8+ |
|
| InChI = 1/C25H24F6N4/c1-23(2)15-32-22(33-16-23)35-34-21(13-7-17-3-9-19(10-4-17)24(26,27)28)14-8-18-5-11-20(12-6-18)25(29,30)31/h3-14H,15-16H2,1-2H3,(H2,32,33,35)/b13-7+,14-8+ |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=25 |
|
| Formula = C<sub>25</sub>H<sub>24</sub>F<sub>6</sub>N<sub>4</sub> |
|
|
|
| H=24 |
| ⚫ |
| Appearance = yellow to orange crystalline solid |
|
|
|
| F=6 |
|
| MolarMass = 494.50 g/mol |
|
|
| Density = |
|
| N=4 |
|
⚫ |
| Appearance = Yellow to orange crystalline solid |
|
| MeltingPt = 185-190 °C |
|
|
| BoilingPt = |
|
| Density = |
|
|
| MeltingPtC = 185 to 190 |
|
|
| MeltingPt_notes = |
|
|
| BoilingPt = |
|
}} |
|
}} |
|
| Section7 = {{Chembox Hazards |
|
|Section7={{Chembox Hazards |
|
| NFPA-H = 1 |
|
| NFPA-H = 1 |
|
| NFPA-F = 1 |
|
| NFPA-F = 1 |
|
| NFPA-R = 0 |
|
| NFPA-R = 0 |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
'''Hydramethylnon''' (AC 217,300) is an ] used primarily in the form of ] for ]es and ]s.<ref name=":02">{{Cite book |last=Jeschke |first=Peter |url=https://onlinelibrary.wiley.com/doi/book/10.1002/9783527699261 |title=Modern Crop Protection Compounds |last2=Witschel |first2=Matthias |last3=Krämer |first3=Wolfgang |last4=Schirmer |first4=Ulrich |date=25 January 2019 |publisher=Wiley‐VCH |year=2019 |isbn=9783527699261 |edition=3rd |pages=1156-1201 |chapter=32.3 Inhibitors of Mitochondrial Electron Transport: Acaricides and Insecticides}}</ref><ref name="vspn"></ref><ref>{{cite web | url = https://pubchem.ncbi.nlm.nih.gov/compound/hydramethylnon#section=Pharmacology-and-Biochemistry | title = Hydramethylnon | publisher = ]}}</ref> It works by inhibiting ] in the mitochondrial inner membrane and leads to a halting of ] (] class 20A). Some brands of hydramethylnon are ], Blatex, Combat, Cyaforce, Cyclon, Faslane, Grant's, Impact, Matox, Maxforce, Pyramdron, Siege, Scuttle and Wipeout. Hydramethylnon is a slow-acting poison with delayed toxicity that needs to be eaten to be effective.<ref name=npic/> |
|
|
|
|
|
==Toxicology== |
|
|
Hydramethylnon has low toxicity in mammals.<ref name=vspn/><ref name=npic>{{cite web | url = http://npic.orst.edu/factsheets/hydragen.pdf | title = Hydramethylnon | publisher = National Pesticide Information Center}}</ref> The oral {{LD50}} is 1100–1300 mg/kg in rats and above 28,000 mg/kg in dogs.<ref name=npic/> Hydramethylnon is ]; the 96-hour LC<sub>50</sub> in rainbow trout is 0.16 mg/L, 0.10 mg/L in ], and 1.70 mg/L in ]. |
|
|
|
|
|
Hydramethylnon, when fed to rats for two years, led to an increase in ] and ]s at the highest dose; therefore, the ] classifies hydramethylnon as a possible human carcinogen.<ref name=npic/> |
|
|
|
|
|
==See also== |
|
|
* ], another insecticide used for similar purposes |
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
==External links== |
|
|
* {{PPDB|386}} |
|
|
* |
|
|
* |
|
|
* |
|
|
* ]. |
|
|
* ] |
|
|
|
|
|
{{Insecticides}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |