| Revision as of 06:07, 31 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[WP:CHEMVALID|Chem/Drugbox validation← Previous edit |
Latest revision as of 23:50, 28 January 2023 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers172,777 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
| (21 intermediate revisions by 14 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Unreferenced stub|auto=yes|date=December 2009}} |
|
|
|
{{See also|hydrocortisone}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 428760702 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| IUPAC_name = (11β)-11-hydroxy-3,20-dioxo-21-(propionyloxy)pregn-4-en-17-yl butyrate |
|
|
⚫ |
| verifiedrevid = 447611730 |
|
| image = Hydrocortisone buteprate.svg |
|
| image = Hydrocortisone buteprate.svg |
|
|
| USAN = hydrocortisone probutate |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = Pandel |
|
| Drugs.com = {{drugs.com|monograph|hydrocortisone}} |
|
| Drugs.com = {{drugs.com|monograph|hydrocortisone-topical}} |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_AU = A |
|
|
| pregnancy_AU_comment = <ref name="Drugs.com pregnancy">{{cite web | title=Hydrocortisone topical Use During Pregnancy | website=Drugs.com | date=5 December 2019 | url=https://www.drugs.com/pregnancy/hydrocortisone-topical.html | access-date=13 September 2020}}</ref> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
|
| pregnancy_category = |
|
| pregnancy_US = C |
|
|
| pregnancy_US_comment = <ref name="Drugs.com pregnancy" /> |
| ⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S8 --> |
|
|
|
| pregnancy_category = |
|
| legal_UK = <!-- GSL / P / POM / CD --> |
|
|
| legal_US = <!-- OTC / Rx-only --> |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S8 --> |
|
⚫ |
| legal_UK = <!-- GSL / P / POM / CD --> |
| ⚫ |
| legal_status = |
|
|
|
| legal_US = OTC |
| ⚫ |
| routes_of_administration = |
|
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = ] |
|
|
| ATC_prefix = D07 |
|
⚫ |
| ATC_suffix = AB11 |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = |
|
| protein_bound = |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 72590-77-3 |
|
| CAS_number = 72590-77-3 |
|
| ATC_prefix = D07 |
|
| PubChem = 636398 |
| ⚫ |
| ATC_suffix = AB11 |
|
|
| PubChem = 51627 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = DB14543 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 552186 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = O6550D6K3A |
|
|
| KEGG = D01886 |
|
|
| KEGG2 = C13358 |
|
|
| ChEBI = 31675 |
|
|
| ChEMBL = 200953 |
|
|
| synonyms = Hydrocortisone probutate; Hydrocortisone 17α-butyrate 21-propionate; Hydrocortisone butyrate propionate |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
⚫ |
| IUPAC_name = (11β)-11-hydroxy-3,20-dioxo-21-(propionyloxy)pregn-4-en-17-yl butyrate |
|
| C=28 | H=40 | O=7 |
|
| C=28 | H=40 | O=7 |
|
|
| SMILES = CCCC(=O)O1(CC21(C(32CCC4=CC(=O)CC34C)O)C)C(=O)COC(=O)CC |
|
| molecular_weight = 488.613 g/mol |
|
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C28H40O7/c1-5-7-24(33)35-28(22(31)16-34-23(32)6-2)13-11-20-19-9-8-17-14-18(29)10-12-26(17,3)25(19)21(30)15-27(20,28)4/h14,19-21,25,30H,5-13,15-16H2,1-4H3/t19-,20-,21-,25+,26-,27-,28-/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = FOGXJPFPZOHSQS-AYVLZSQQSA-N |
|
}} |
|
}} |
|
'''Hydrocortisone buteprate''' (or '''hydrocortisone 17-butyrate 21-propionate''') is a ]. |
|
|
|
|
|
|
|
'''Hydrocortisone buteprate''', also known as '''hydrocortisone probutate''' and as '''hydrocortisone butyrate propionate''', is a ].<ref>Drugs.com: </ref><ref>{{cite journal | vauthors = Sears HW, Bailer JW, Yeadon A | title = Efficacy and safety of hydrocortisone buteprate 0.1% cream in patients with atopic dermatitis | journal = Clinical Therapeutics | volume = 19 | issue = 4 | pages = 710–9 | year = 1997 | pmid = 9377615 | doi = 10.1016/s0149-2918(97)80095-1 }}</ref> It is an ] of ] (cortisol) with ] and ]. |
|
{{Corticosteroids}} |
|
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
== External links == |
|
|
* {{cite web | url = https://druginfo.nlm.nih.gov/drugportal/name/hydrocortisone%20probutate | publisher = U.S. National Library of Medicine | work = Drug Information Portal | title = Hydrocortisone probutate }} |
|
|
|
|
|
|
|
|
{{Portal bar | Medicine}} |
|
|
{{Glucocorticoids and antiglucocorticoids}} |
|
|
{{Glucocorticoid receptor modulators}} |
|
|
|
|
|
{{DEFAULTSORT:Hydrocortisone Buteprate}} |
|
{{DEFAULTSORT:Hydrocortisone Buteprate}} |
|
|
|
|
⚫ |
] |
|
|
] |
|
] |
|
] |
|
] |
|
] |
| ⚫ |
] |
|
|
|
|
|
|
|
|
|
|
{{dermatologic-drug-stub}} |
|
{{Dermatologic-drug-stub}} |