| Revision as of 21:18, 12 May 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 10:13, 10 March 2021 edit undoCitation bot (talk | contribs)Bots5,391,801 edits Add: bibcode. | Use this bot. Report bugs. | Suggested by Abductive | Category:Organic compound stubs | via #UCB_Category 28/1138 |
| (13 intermediate revisions by 10 users not shown) |
| Line 1: |
Line 1: |
|
{{Chembox |
|
{{Chembox |
|
| verifiedrevid = 387712039 |
|
| verifiedrevid = 428822964 |
|
| ImageFile = Hydroxyl aluminium bis(2-ethylhexanoate).png |
|
| ImageFile = Hydroxyl aluminium bis(2-ethylhexanoate).png |
|
| ImageSize = 200px |
|
|
| IUPACName = |
|
| IUPACName = |
|
| OtherNames = Hydroxyl aluminum bis(2-ethylhexanoate); Aluminium 2-ethylhexanoate; Aluminium 2-ethylcaproate |
|
| OtherNames = Hydroxyl aluminum bis(2-ethylhexanoate); Aluminium 2-ethylhexanoate; Aluminium 2-ethylcaproate |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 30745-55-2 |
|
| CASNo = 30745-55-2 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| PubChem = |
|
|
| SMILES = }} |
|
| UNII = 72E28W1P5O |
|
⚫ |
| PubChem = 16684284 |
| ⚫ |
| Section2 = {{Chembox Properties |
|
|
|
| PubChem_Comment = with wrong formula and structure |
|
|
| EC_number = 250-322-2 |
|
|
| SMILES = CCCCC(CC)C(=O)O(O)OC(=O)C(CC)CCCC |
|
|
}} |
|
⚫ |
|Section2={{Chembox Properties |
|
| C=16 | H=31 | Al=1 | O=5 |
|
| C=16 | H=31 | Al=1 | O=5 |
|
| Appearance = |
|
| Appearance = |
| Line 16: |
Line 21: |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
|
| GHSPictograms = {{GHS02}}{{GHS07}} |
|
|
| GHSSignalWord = Warning |
|
|
| HPhrases = {{H-phrases|228|315|319}} |
|
|
| PPhrases = {{P-phrases|210|240|241|264|280|302+352|305+351+338|321|332+313|337+313|362|378}} |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
|
|
|
|
'''Hydroxyl aluminium bis(2-ethylhexanoate)''' is a ] derived from ] and aluminium(III).<ref>{{cite journal | author = Hershey, Harry C.; McCauley, Victoria S.; Kuo, Jeffrey T.; McMillan, Michael L. | title = Solution properties of association colloids of twelve aluminum monohydroxy disoaps in nonaqueous solutions | journal = Journal of Colloid and Interface Science | year = 1984 | volume = 101 | issue = 2 | pages = 424–35}}</ref> Nominally it is the ] with the formula Al(OH)(O<sub>2</sub>CCHEt(CH<sub>2</sub>)<sub>3</sub>CH<sub>3</sub>)<sub>2</sub> where Et = ]. The composition is not a homogeneous compound. It is used as a thickening agent in various products, including in ]. It is slightly hygroscopic. |
|
'''Hydroxyl aluminium bis(2-ethylhexanoate)''' is a ] derived from ] and aluminium(III).<ref>{{cite journal |author1=Hershey, Harry C. |author2=McCauley, Victoria S. |author3=Kuo, Jeffrey T. |author4=McMillan, Michael L. | title = Solution properties of association colloids of twelve aluminum monohydroxy disoaps in nonaqueous solutions | journal = Journal of Colloid and Interface Science | year = 1984 | volume = 101 | issue = 2 | pages = 424–35 | doi=10.1016/0021-9797(84)90054-7|bibcode=1984JCIS..101..424H }}</ref> Nominally it is the ] with the formula Al(OH)(O<sub>2</sub>CCHEt(CH<sub>2</sub>)<sub>3</sub>CH<sub>3</sub>)<sub>2</sub> where Et = ]. The composition is not a homogeneous compound. It is used as a thickening agent in various products, including in ]. It is slightly hygroscopic. |
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
⚫ |
] |
|
|
] |
|
|
|
|
|
|
|
|
|
{{organic-compound-stub}} |
|
{{organic-compound-stub}} |
|
|
|
|
|
|
|
] |
|
|
|
|
|
|
|
| ⚫ |
] |
|