| Revision as of 14:04, 8 December 2010 editحسن علي البط (talk | contribs)Extended confirmed users, Pending changes reviewers19,940 edits removed Category:Naphthols; added Category:2-Naphthols using HotCat← Previous edit |
Latest revision as of 22:01, 26 August 2023 edit undoCitation bot (talk | contribs)Bots5,455,408 edits Add: bibcode, doi, issue. | Use this bot. Report bugs. | Suggested by Whoop whoop pull up | #UCB_webform 564/1148 |
| (18 intermediate revisions by 16 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
|
| verifiedrevid = 432242693 |
|
| ImageFile = Hydroxynaphthol blue.png |
|
| ImageFile = Hydroxynaphthol blue.png |
|
| OtherNames = Hydroxynaphthol blue |
|
| OtherNames = Hydroxynaphthol blue |
|
| Section1 = {{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 63451-35-4 |
|
| CASNo = 63451-35-4 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = VG5SKF7S6C |
|
| PubChem = 9576626 |
|
| PubChem = 9576626 |
|
| SMILES = O=S(C(C=C4)=CC1=C4C(/N=N/C2=C3C(C=CC=C3)=C(S(=O)(O)=O)C=C2O)=C(O)C(S(=O)(O)=O)=C1)(O)=O}} |
|
| SMILES = O=S(C(C=C4)=CC1=C4C(/N=N/C2=C3C(C=CC=C3)=C(S(=O)(O)=O)C=C2O)=C(O)C(S(=O)(O)=O)=C1)(O)=O |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 20157443 |
|
|
| InChI = 1/C20H14N2O11S3.3Na/c23-15-9-16(35(28,29)30)13-3-1-2-4-14(13)18(15)21-22-19-12-6-5-11(34(25,26)27)7-10(12)8-17(20(19)24)36(31,32)33;;;/h1-9,23-24H,(H,25,26,27)(H,28,29,30)(H,31,32,33);;;/q;3*+1/p-3/b22-21+;;; |
|
|
| InChIKey = AUIINJJXRXMPGT-QWKJSYRZBJ |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C20H14N2O11S3.3Na/c23-15-9-16(35(28,29)30)13-3-1-2-4-14(13)18(15)21-22-19-12-6-5-11(34(25,26)27)7-10(12)8-17(20(19)24)36(31,32)33;;;/h1-9,23-24H,(H,25,26,27)(H,28,29,30)(H,31,32,33);;;/q;3*+1/p-3/b22-21+;;; |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = AUIINJJXRXMPGT-ZRUFZDNISA-K |
|
|
}} |
|
| Section2 = {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
| Formula = C<sub>20</sub>H<sub>11</sub>N<sub>2</sub>Na<sub>3</sub>O<sub>11</sub>S<sub>3</sub> |
|
| Formula = C<sub>20</sub>H<sub>11</sub>N<sub>2</sub>Na<sub>3</sub>O<sub>11</sub>S<sub>3</sub> |
| Line 13: |
Line 28: |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = Soluble |
|
|
| pKa = 6.44, 12.93<ref>{{cite journal |author1=Atuko Itoh|author2=Keihei Ueno| title = Evaluation of 2-hydroxy-1-(20hydroxy-4-sulpho-1-naphthylazo)-3-naphthoic acid and hydroxynaphtol blue as metallochromic indicators in the EDTA titration of calcium | journal = Analyst | issn = 1364-5528 | year = 1970| volume = 95 |issue=1131 | pages = 583–589 |doi=10.1039/an9709500583 |bibcode=1970Ana....95..583I | url = https://pubs.rsc.org/en/content/articlelanding/1970/AN/an9709500583}}</ref> |
|
| Water Solubility = Souble |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Hydroxynaphthol blue''' is an ]. It is used for determining the endpoint in ] ]s. |
|
'''Hydroxynaphthol blue''' is an ]. It is used for determining the endpoint in ]s/Metal Titration. |
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|