Misplaced Pages

Hyperoside: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 04:41, 20 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Wikipedia_talk:WikiProject_Chemicals|error← Previous edit Latest revision as of 00:52, 6 May 2023 edit undoFritzmann2002 (talk | contribs)Autopatrolled, Extended confirmed users, Pending changes reviewers13,001 edits added Category:Chemicals in Hypericum using HotCat 
(48 intermediate revisions by 31 users not shown)
Line 1: Line 1:
{{chembox {{chembox
| Verifiedfields = changed
⚫ | verifiedrevid = 400271255
| Watchedfields = changed
⚫ | Name = Hyperoside
⚫ | verifiedrevid = 451447904
⚫ | ImageFile = Hyperoside.svg
⚫ | Name = Hyperoside
⚫ | ImageSize = 250px
⚫ | ImageFile = Hyperoside.svg
⚫ | ImageName =
⚫ | ImageSize = 250px
⚫ | IUPACName = 2-(3,4-dihydroxyphenyl)-3-oxy-4H-chromene-4,5,7-triol
⚫ | ImageName =
⚫ | OtherNames= Hyperozide<br>Hyperasid<br>Hyperosid<br>Hyperin<br>quercetin galactoside<br>Quercetin-3-galactoside<br>Quercetin-3-O-galactoside
| IUPACName = 3-(β-<small>D</small>-Galactopyranosyloxy)-3′,4′,5,7-tetrahydroxyflavone
⚫ | Section1 = {{Chembox Identifiers
⚫ | SystematicName = 2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-3-{oxy}-4''H''-1-benzopyran-4-one
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫ | OtherNames= Hyperozide<br>Hyperasid<br>Hyperosid<br>Hyperin<br>quercetin galactoside<br>Quercetin-3-galactoside<br>Quercetin-3-''O''-galactoside
⚫ | ChemSpiderID = 9926320
⚫ |Section1={{Chembox Identifiers
⚫ | InChI = 1/C21H20O12/c22-6-13-15(27)17(29)18(30)21(32-13)33-20-16(28)14-11(26)4-8(23)5-12(14)31-19(20)7-1-2-9(24)10(25)3-7/h1-5,13,15,17-18,21-27,29-30H,6H2/t13-,15+,17+,18-,21?/m1/s1
⚫ | PubChem = 5281643
⚫ | InChIKey = OVSQVDMCBVZWGM-HBDJNLTOBV
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
⚫ | ChemSpiderID = 4444962
⚫ | StdInChI = 1S/C21H20O12/c22-6-13-15(27)17(29)18(30)21(32-13)33-20-16(28)14-11(26)4-8(23)5-12(14)31-19(20)7-1-2-9(24)10(25)3-7/h1-5,13,15,17-18,21-27,29-30H,6H2/t13-,15+,17+,18-,21?/m1/s1
| SMILES = c1cc(c(cc1c2c(c(=O)c3c(cc(cc3o2)O)O)O4((((O4)CO)O)O)O)O)O
⚫ | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
⚫ | InChI = 1/C21H20O12/c22-6-13-15(27)17(29)18(30)21(32-13)33-20-16(28)14-11(26)4-8(23)5-12(14)31-19(20)7-1-2-9(24)10(25)3-7/h1-5,13,15,17-18,21-27,29-30H,6H2/t13-,15+,17+,18-,21+/m1/s1
⚫ | StdInChIKey = OVSQVDMCBVZWGM-HBDJNLTOSA-N
⚫ | InChIKey = OVSQVDMCBVZWGM-DTGCRPNFBG
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
⚫ | StdInChI = 1S/C21H20O12/c22-6-13-15(27)17(29)18(30)21(32-13)33-20-16(28)14-11(26)4-8(23)5-12(14)31-19(20)7-1-2-9(24)10(25)3-7/h1-5,13,15,17-18,21-27,29-30H,6H2/t13-,15+,17+,18-,21+/m1/s1
⚫ | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
⚫ | StdInChIKey = OVSQVDMCBVZWGM-DTGCRPNFSA-N
| CASNo_Ref = {{cascite|correct|CAS}} | CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 482-36-0 | CASNo = 482-36-0
| UNII_Ref = {{fdacite|correct|FDA}}
⚫ | PubChem = 24835331
| UNII = 8O1CR18L82
| SMILES = O=C2C(\OC1O((O)(O)1O)CO)=C(/Oc3cc(O)cc(O)c23)c4ccc(O)c(O)c4
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = C10073
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 67486
}} }}
| Section2 = {{Chembox Properties |Section2={{Chembox Properties
| C=21 | H=20 | O=12
| Formula = C<sub>21</sub>H<sub>20</sub>O<sub>12</sub>
| MolarMass = 464.38 g/mol | Density = 1.879 g/mL
| Density = | MeltingPt =
⚫ | BoilingPt =
| MeltingPt = <!-- °C -->
⚫ | BoilingPt =
}} }}
}} }}


'''Hyperoside''' is a chemical compound. It is the 3-O-] of ]. It is a medicinally active compound that can be isolated from '']'', from the '']'' plant, from '']'', from '' ],'' ] Chinensis seeds and from ]. '''Hyperoside''' is a chemical compound. It is the 3-''O''-] of ].

== Natural occurrences ==
Hyperoside has been isolated from '']'', from the Lamiaceae ''] sp.'' and '']'', from '']'', '']'' seeds, from ] and from '']''.<ref>{{cite journal | doi = 10.1021/jf0484780 | title = Antifungal Activity of Camptothecin, Trifolin, and Hyperoside Isolated from Camptotheca acuminata | year = 2005 | last1 = Li | first1 = Shiyou | last2 = Zhang | first2 = Zhizhen | last3 = Cain | first3 = Abigail | last4 = Wang | first4 = Bo | last5 = Long | first5 = Melissa | last6 = Taylor | first6 = Josephine | journal = Journal of Agricultural and Food Chemistry | volume = 53 | pages = 32–7 | pmid = 15631505 | issue = 1| url = https://scholarworks.sfasu.edu/cgi/viewcontent.cgi?article=1091&context=biology }}</ref> It is one of the phenolic compounds in the invasive plant '']'' and contributes to the antibacterial<ref>{{Cite journal|doi=10.1016/S0378-8741(01)00197-0|title=Purification and identification of active antibacterial components in Carpobrotus edulis L|year=2001|last1=Van Der Watt|first1=Elmarie|last2=Pretorius|first2=Johan C|journal=Journal of Ethnopharmacology|volume=76|pages=87–91|pmid=11378287|issue=1}}</ref> properties of the plant.


In '']'' and '']'', it serves as a UV blocker found in the bracts. In '']'' and '']'', it serves as a UV blocker found in the bracts.


It is also found in '']''<ref>{{Cite journal|pmid=10346950|year=1999|last1=Calzada|first1=F|last2=Cerda-García-Rojas|first2=CM|last3=Meckes|first3=M|last4=Cedillo-Rivera|first4=R|last5=Bye|first5=R|last6=Mata|first6=R|title=Geranins a and B, new antiprotozoal A-type proanthocyanidins from Geranium niveum|volume=62|issue=5|pages=705–9|doi=10.1021/np980467b|journal=Journal of Natural Products}}</ref> and '']''.<ref name=Konishi>The constituents of Taxillus kaempferi and the host, Pinus thunbergii. I. Catechins and flavones of Taxillus kaempferi. Konishi T, Nishio T, Kiyosawa S, Fujiwara Y and Konoshima T, Yakugaku Zasshi., February 1996, volume 116, issue 2, pages 148-157 (article in Japanese)</ref>
It can have a protective antioxidant effect on cultured ].<ref></ref>


==References== ==References==
{{Reflist}} {{Reflist|2}}


{{flavonol}} {{Opioidergics}}
{{Flavonol}}


] ]
] ]
] ]
]
]