| Revision as of 12:21, 22 March 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (changes to watched fields - updated 'UNII_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (report errors or [[user talk:← Previous edit |
Latest revision as of 21:32, 17 September 2023 edit undoKoIobok (talk | contribs)Extended confirmed users1,350 edits Added Category:Alpha-Amino acids |
| (13 intermediate revisions by 12 users not shown) |
| Line 1: |
Line 1: |
|
{{Orphan|date=February 2009}} |
|
|
{{chembox |
|
{{chembox |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 400113393 |
|
| verifiedrevid = 420135650 |
|
| Name = Hypoglycin B |
|
| Name = Hypoglycin B |
|
| ImageFile = Hypoglycin B.PNG |
|
| ImageFile = Hypoglycin B.svg |
|
<!-- | ImageSize = 200px --> |
|
| ImageSize = 200px |
|
| ImageName = Hypoglycin B |
|
| ImageName = Hypoglycin B |
|
| IUPACName = (2S)-2-amino-4-(1S)-1-carboxy-2-<br />ethyl]carbamoyl]butanoic acid |
|
| IUPACName = γ-Glutamyl-3-alanine |
|
|
| SystematicName = (2''S'')-5-({(1''S'')-1-Carboxy-2-ethyl}amino)-5-oxopentanoic acid |
|
| OtherNames = Hypoglycine B |
|
|
|
| OtherNames = <small>L</small>-γ-Glutamyl-<small>L</small>-hypoglycin; <small>L</small>-γ-Glutamyl-3--<small>L</small>-alanine |
|
| Section1 = {{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
|
| SMILES = O=C(N(C(=O)O)C1C(=C)C1)CC(C(=O)O)N |
|
| SMILES = O=C(N(C(=O)O)C1C(=C)C1)CC(C(=O)O)N |
| Line 20: |
Line 20: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = UYDZYCPIQSRXKU-CIUDSAMLSA-N |
|
| StdInChIKey = UYDZYCPIQSRXKU-CIUDSAMLSA-N |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 502-37-4 |
|
| CASNo = 502-37-4 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = T83F0X4NGN |
|
|
| ChEBI = 6332 |
|
|
| KEGG = C08280 |
|
| RTECS = |
|
| RTECS = |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
| Formula = C<sub>12</sub>H<sub>18</sub>N<sub>2</sub>O<sub>5</sub> |
|
| C=12|H=18|N=2|O=5 |
|
| MolarMass = 270.1216 g/mol |
|
|
| Appearance = |
|
|
| Density = |
|
| Density = |
|
| Solubility = |
|
| Solubility = |
| Line 44: |
Line 47: |
|
| ExternalMSDS = |
|
| ExternalMSDS = |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = ?°C |
|
| FlashPt = |
|
| RPhrases = |
|
|
| SPhrases = }} |
|
|
}} |
|
}} |
|
|
}} |
| ⚫ |
'''Hypoglycin B''' is a naturally occurring organic compound in the species '']''. It is particularly concentrated in the fruit of the plant especially in the seeds. Hypoglycin B is toxic if ingested and is a causative agent of ]. It is an ] and chemically related to ]. |
|
|
|
|
|
⚫ |
'''Hypoglycin B''' is a naturally occurring organic compound in the species '']''. It is particularly concentrated in the fruit of the plant especially in the seeds. Hypoglycin B is toxic if ingested and is one of the causative agents of ].<ref>{{cite web | url = http://emedicine.medscape.com/article/1008792-overview | title = Ackee Fruit Toxicity | date = 28 March 2022 | publisher = ]}}</ref> It is a ] of ] and ]. |
|
|
|
|
|
==References== |
|
==References== |
|
|
{{reflist}} |
|
{{Unreferenced|date =September 2007}} |
|
|
<references/> |
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|