| Revision as of 15:08, 21 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 443866961 of page Ibrolipim for the Chem/Drugbox validation project (updated: 'ChEMBL', 'StdInChI'). |
Latest revision as of 18:46, 30 January 2023 edit Marbletan (talk | contribs)Extended confirmed users5,350 edits removed Category:Organobromides; added Category:Bromoarenes using HotCat |
| Line 1: |
Line 1: |
|
|
{{Chembox |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
|
| Verifiedfields = changed |
|
{{chembox |
|
|
|
| verifiedrevid = 461775154 |
|
⚫ |
| ImageFile = Ibrolipim structure.svg |
|
⚫ |
| ImageSize = 120 |
|
⚫ |
| PIN = Diethyl ({4-phenyl}methyl)phosphonate |
|
⚫ |
| OtherNames = |
|
⚫ |
|Section1={{Chembox Identifiers |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 07H1561618 |
|
| UNII = 07H1561618 |
|
⚫ |
| InChI = 1S/C19H20BrN2O4P/c1-3-25-27(24,26-4-2)13-14-5-7-15(8-6-14)19(23)22-18-10-9-17(20)11-16(18)12-21/h5-11H,3-4,13H2,1-2H3,(H,22,23) |
| ⚫ |
| ImageFile = Ibrolipim structure.png |
|
| ⚫ |
| ImageSize = 120 |
|
| ⚫ |
| IUPACName = diethyl {4-benzyl}phosphonate |
|
| ⚫ |
| OtherNames = |
|
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
| ⚫ |
| InChI = 1S/C19H20BrN2O4P/c1-3-25-27(24,26-4-2)13-14-5-7-15(8-6-14)19(23)22-18-10-9-17(20)11-16(18)12-21/h5-11H,3-4,13H2,1-2H3,(H,22,23) |
|
|
| InChIKey1 = KPRTURMJVWXURQ-UHFFFAOYSA-N |
|
| InChIKey1 = KPRTURMJVWXURQ-UHFFFAOYSA-N |
|
| InChI1 = 1S/C19H20BrN2O4P/c1-3-25-27(24,26-4-2)13-14-5-7-15(8-6-14)19(23)22-18-10-9-17(20)11-16(18)12-21/h5-11H,3-4,13H2,1-2H3,(H,22,23) |
|
| InChI1 = 1S/C19H20BrN2O4P/c1-3-25-27(24,26-4-2)13-14-5-7-15(8-6-14)19(23)22-18-10-9-17(20)11-16(18)12-21/h5-11H,3-4,13H2,1-2H3,(H,22,23) |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = |
|
|
| ChEMBL = 34234 |
|
| CASNo = 133208-93-2 |
|
| PubChem = 131601 |
|
| PubChem = 131601 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 116297 |
|
| ChemSpiderID = 116297 |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D03747 |
|
| KEGG = D03747 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = KPRTURMJVWXURQ-UHFFFAOYSA-N |
|
| StdInChIKey = KPRTURMJVWXURQ-UHFFFAOYSA-N |
|
| SMILES = Brc2cc(C#N)c(NC(=O)c1ccc(cc1)CP(=O)(OCC)OCC)cc2 |
|
| SMILES = Brc2cc(C#N)c(NC(=O)c1ccc(cc1)CP(=O)(OCC)OCC)cc2 |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C19H20BrN2O4P/c1-3-25-27(24,26-4-2)13-14-5-7-15(8-6-14)19(23)22-18-10-9-17(20)11-16(18)12-21/h5-11H,3-4,13H2,1-2H3,(H,22,23) |
|
| StdInChI = 1S/C19H20BrN2O4P/c1-3-25-27(24,26-4-2)13-14-5-7-15(8-6-14)19(23)22-18-10-9-17(20)11-16(18)12-21/h5-11H,3-4,13H2,1-2H3,(H,22,23) |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C19H20BrN2O4P |
|
|
|
| Formula = C<sub>19</sub>H<sub>20</sub>BrN<sub>2</sub>O<sub>4</sub>P |
|
| MolarMass = 451.25 |
|
|
| Appearance = |
|
| MolarMass = 451.25 |
|
| Density = |
|
| Appearance = |
|
| MeltingPt = |
|
| Density = |
|
| BoilingPt = |
|
| MeltingPt = |
|
| Solubility = |
|
| BoilingPt = |
|
|
| Solubility = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
|
| FlashPt = |
|
| MainHazards = |
|
| Autoignition = |
|
| FlashPt = |
|
|
| AutoignitionPt = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Ibrolipim''' ('''NO-1886''') is a ] lowering drug from the ] family, which acts as a ] activator. The discovery of the "statin" mevalonic acid synthesis inhibitors focused new attention on control of blood lipid levels as a measure to stave off heart disease. A number of compounds have been found that treat elevated lipid levels by other diverse mechanisms. The phosphonic acid derivative ibrolipim is believed to lower those levels by accelerating fatty acid oxidation.<ref name="pmid12847564">{{cite journal |vauthors=Yin W, Tsutsumi K |title=Lipoprotein lipase activator NO-1886 |journal=Cardiovascular Drug Reviews |volume=21 |issue=2 |pages=133–42 |year=2003 |pmid=12847564 |doi= 10.1111/j.1527-3466.2003.tb00111.x|doi-access=free }}</ref> |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
{{Major drug groups}} |
|
|
{{Statins}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |