| Revision as of 22:34, 18 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'DrugBank_Ref', 'ChEBI_Ref') per [[WP:CHEMVALID|Chem/Drugbox valida← Previous edit |
Latest revision as of 13:21, 7 November 2023 edit undoOAbot (talk | contribs)Bots440,440 editsm Open access bot: doi updated in citation with #oabot. |
| (31 intermediate revisions by 25 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 444303212 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| IUPAC_name = (E)-3-(1,3-benzodioxol-5-yl)-1-piperidin-1-ylprop-2-en-1-one |
|
|
⚫ |
| verifiedrevid = 451225156 |
|
⚫ |
| IUPAC_name = (2''E'')-3-(2''H''-1,3-Benzodioxol-5-yl)-1-(piperidin-1-yl)prop-2-en-1-one |
|
| image = Ilepcimide.png |
|
| image = Ilepcimide.png |
|
| width = 200px |
|
| width = 200px |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 23434-86-8 |
|
| CAS_number = 82857-82-7 |
|
| ATC_prefix = none |
|
| ATC_prefix = none |
|
| ATC_suffix = |
|
| ATC_suffix = |
|
| PubChem = 641115 |
|
| PubChem = 641115 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 5ML58O200F |
|
| UNII = 5ML58O200F |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 556435 |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C15H17NO3/c17-15(16-8-2-1-3-9-16)7-5-12-4-6-13-14(10-12)19-11-18-13/h4-7,10H,1-3,8-9,11H2/b7-5+ |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = BLPUOQGPBJPXRL-FNORWQNLSA-N |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=15 | H=17 | N=1 | O=3 |
|
| C=15 | H=17 | N=1 | O=3 |
|
| molecular_weight = 259.300 g/mol |
|
|
| smiles = C1CCN(CC1)C(=O)/C=C/C2=CC3=C(C=C2)OCO3 |
|
| smiles = C1CCN(CC1)C(=O)/C=C/C2=CC3=C(C=C2)OCO3 |
|
}} |
|
}} |
|
|
|
|
|
|
'''Ilepcimide''', also known as '''antiepilepserine''', is an ].<ref name="GanellinTriggle1996">{{cite book | vauthors = Ganellin CR, Triggle DJ | title = Dictionary of Pharmacological Agents | url = https://books.google.com/books?id=A0THacd46ZsC&pg=PA1116 | accessdate = 30 November 2012 | date = 21 November 1996 | publisher = CRC Press | isbn = 978-0-412-46630-4 | page = 1116}}</ref> It is a ] ] that was first synthesized by Chinese researchers as an ] of ], the main pungent compound and ] of ] (and of other plants in the family ]). |
|
'''Ilepcimide''' ('''Antiepilepserine''') is a ] ] used in ]. |
|
|
|
|
|
|
Ilepcimide has ] activity.<ref name="GanellinTriggle1996" /><ref>{{cite journal | vauthors = Liu GQ, Algeri S, Ceci A, Garattini S, Gobbi M, Murai S | title = Stimulation of serotonin synthesis in rat brain after antiepilepsirine, an antiepileptic piperine derivative | journal = Biochemical Pharmacology | volume = 33 | issue = 23 | pages = 3883–6 | date = December 1984 | pmid = 6210090 | doi = 10.1016/0006-2952(84)90055-8 | doi-access = free }}</ref><ref>{{cite journal | vauthors = Yan QS, Mishra PK, Burger RL, Bettendorf AF, Jobe PC, Dailey JW | title = Evidence that carbamazepine and antiepilepsirine may produce a component of their anticonvulsant effects by activating serotonergic neurons in genetically epilepsy-prone rats | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 261 | issue = 2 | pages = 652–9 | date = May 1992 | pmid = 1374472 }}</ref> |
|
|
|
|
|
==See also== |
|
|
* ] |
|
|
|
|
|
== References == |
|
== References == |
| Line 38: |
Line 52: |
|
{{Anticonvulsants}} |
|
{{Anticonvulsants}} |
|
|
|
|
|
⚫ |
] |
|
|
|
|
⚫ |
] |
|
] |
|
] |
|
] |
|
] |
| ⚫ |
] |
|
| ⚫ |
] |
|
|
|
|
|
|
|
|
|