| Revision as of 13:16, 2 December 2010 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref') per Chem/Drugbox validation (report [[Wikipedia_talk:Wi← Previous edit |
Latest revision as of 18:52, 7 November 2022 edit undoJWBE (talk | contribs)Extended confirmed users10,126 edits removed Category:Pyridines; added Category:Tetrahydropyridines using HotCat |
| (16 intermediate revisions by 12 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
| verifiedrevid = 400116034 |
|
| verifiedrevid = 400117271 |
|
|ImageFile=Indicaxanthin.svg |
|
| ImageFile=Indicaxanthin.svg |
|
|ImageSize=150px |
|
| ImageSize=150px |
|
|IUPACName=4--2,3-dihydro-pyridine-2,6-dicarboxylic acid |
|
| IUPACName=4--2,3-dihydro-pyridine-2,6-dicarboxylic acid |
|
|OtherNames= |
|
| OtherNames= |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 4807442 |
|
| ChemSpiderID = 4807442 |
|
| InChI = 1/C14H16N2O6/c17-12(18)9-6-8(7-10(15-9)13(19)20)3-5-16-4-1-2-11(16)14(21)22/h3,5-6,10-11H,1-2,4,7H2,(H3,17,18,19,20,21,22)/t10-,11-/m0/s1 |
|
| InChI = 1/C14H16N2O6/c17-12(18)9-6-8(7-10(15-9)13(19)20)3-5-16-4-1-2-11(16)14(21)22/h3,5-6,10-11H,1-2,4,7H2,(H3,17,18,19,20,21,22)/t10-,11-/m0/s1 |
| Line 14: |
Line 14: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = RJIIQBYZGJSODH-QWRGUYRKSA-N |
|
| StdInChIKey = RJIIQBYZGJSODH-QWRGUYRKSA-N |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
| ⚫ |
| CASNo=2181-75-1 |
|
|
|
| CASNo = 1632474-50-0 |
| ⚫ |
| PubChem=6096870 |
|
|
|
| CASNo1_Ref = {{cascite|correct|CAS}} |
| ⚫ |
| SMILES = O=C(O)\C2=C\C(=C\C=1/(C()=O)CCC1)C(C(=O)O)N2 |
|
|
⚫ |
| CASNo1 = 2181-75-1 |
|
|
| CASNo1_Comment = (non-specific) |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = J2R4J4M5NH |
|
⚫ |
| PubChem=6096870 |
|
⚫ |
| SMILES = O=C(O)\C2=C\C(=C\C=1/(C()=O)CCC1)C(C(=O)O)N2 |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>14</sub>H<sub>16</sub>N<sub>2</sub>O<sub>6</sub> |
|
| Formula=C<sub>14</sub>H<sub>16</sub>N<sub>2</sub>O<sub>6</sub> |
|
| MolarMass=308.29 g/mol |
|
| MolarMass=308.29 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Indicaxanthin''' is a type of ], a plant pigment present in ], ] cactus, and the red dragonfruit ]. It is a powerful ]. |
|
'''Indicaxanthin''' is a type of ], a plant pigment present in ]s, in '']'' flowers,<ref>{{cite journal |doi=10.1016/S0031-9422(00)86258-5 |title=Pigments of centrospermae—V. : Betaxanthins from ''Mirabilis jalapa'' L. |year=1965 |last1=Piattelli |first1=M. |last2=Minale |first2=L. |last3=Nicolaus |first3=R.A. |journal=Phytochemistry |volume=4 |issue=6 |pages=817–23}}</ref> in cacti such as prickly pears (''] sp.'') or the red dragonfruit ('']''). It is a powerful ]. |
|
|
|
|
|
==Medical uses== |
|
== Medical uses == |
|
⚫ |
It has been shown in a ] study for patients with ], that indicaxanthin can reduce ] generated in solution from ] and ], more effectively than either ] (a ] derivative) or ], possibly interfering with perferryl-Hb, a reactive intermediate in the ]-dependent Hb degradation.<ref>{{cite journal |doi=10.1080/10715760600554228 |title=Cytoprotective effects of the antioxidant phytochemical indicaxanthin in β-thalassemia red blood cells |year=2006 |last1=Tesoriere |first1=L. |last2=Allegra |first2=M. |last3=Butera |first3=D. |last4=Gentile |first4=C. |last5=Livrea |first5=M. A. |journal=Free Radical Research |volume=40 |issue=7 |pages=753–61 |pmid=16984002}}</ref> |
|
|
|
|
|
|
Indicaxanthin in antioxidant studies was more effective than ] at scavenging the ] cation radical.<ref>{{cite journal |doi=10.1021/jf025696p |title=Antioxidant Activities of Sicilian Prickly Pear (Opuntia ficus indica) Fruit Extracts and Reducing Properties of Its Betalains: Betanin and Indicaxanthin |year=2002 |last1=Butera |first1=Daniela |last2=Tesoriere |first2=Luisa |last3=Di Gaudio |first3=Francesca |last4=Bongiorno |first4=Antonino |last5=Allegra |first5=Mario |last6=Pintaudi |first6=Anna Maria |last7=Kohen |first7=Rohn |last8=Livrea |first8=Maria A. |journal=Journal of Agricultural and Food Chemistry |volume=50 |issue=23 |pages=6895–901 |pmid=12405794|hdl=10447/107910 |hdl-access=free }}</ref> |
| ⚫ |
It has been shown in a ] study for patients with ], that indicaxanthin can reduce ] generated in solution from ] and ], more effectively than either ] (a ] derivative) or ], possibly interfering with perferryl-Hb, a reactive intermediate in the ]-dependent Hb degradation.<ref>{{cite journal |author=Tesoriere L, Allegra M, Butera D, Gentile C, Livrea MA |title=Cytoprotective effects of the antioxidant phytochemical indicaxanthin in beta-thalassemia red blood cells |journal=Free Radic. Res. |volume=40 |issue=7 |pages=753–61 |year=2006 |month=July |pmid=16984002 |doi= 10.1080/10715760600554228|url=}}</ref> |
|
|
|
|
|
Indicaxanthin in antioxidant studies was more effective than ] at scavenging the ] cation radical.<ref></ref> |
|
|
|
|
|
|
==See also== |
|
==See also== |
| Line 52: |
Line 57: |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
|
|
|
|
|
] |
|