| Revision as of 19:17, 9 August 2011 editStemonitis (talk | contribs)Extended confirmed users179,488 edits citation no longer in press: add page nos.; etc.← Previous edit |
Latest revision as of 23:21, 18 August 2023 edit undoOAbot (talk | contribs)Bots440,440 editsm Open access bot: doi updated in citation with #oabot. |
| (16 intermediate revisions by 13 users not shown) |
| Line 1: |
Line 1: |
|
{{Chembox |
|
{{Chembox |
|
| verifiedrevid = 443874766 |
|
| verifiedrevid = 443919745 |
|
| Name=''myo''-Inositol 1,3,4,5,6-pentakisphosphate |
|
| Name=''myo''-Inositol 1,3,4,5,6-pentakisphosphate |
|
| ImageFile=myo-Inositol 1,3,4,5,6-pentakisphosphate.png |
|
| ImageFile=myo-Inositol 1,3,4,5,6-pentakisphosphate.png |
|
| ImageSize = |
|
| ImageSize = |
|
| ImageAlt = |
|
| ImageAlt = |
|
| IUPACName = |
|
| IUPACName = |
|
| OtherNames = |
|
| OtherNames = |
|
| Section1 = {{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 19951265 |
|
| ChemSpiderID = 19951265 |
|
| InChI = 1/C6H17O21P5/c7-1-2(23-28(8,9)10)4(25-30(14,15)16)6(27-32(20,21)22)5(26-31(17,18)19)3(1)24-29(11,12)13/h1-7H,(H2,8,9,10)(H2,11,12,13)(H2,14,15,16)(H2,17,18,19)(H2,20,21,22)/p-10/t1-,2+,3-,4-,5+,6+ |
|
| InChI = 1/C6H17O21P5/c7-1-2(23-28(8,9)10)4(25-30(14,15)16)6(27-32(20,21)22)5(26-31(17,18)19)3(1)24-29(11,12)13/h1-7H,(H2,8,9,10)(H2,11,12,13)(H2,14,15,16)(H2,17,18,19)(H2,20,21,22)/p-10/t1-,2+,3-,4-,5+,6+ |
| Line 17: |
Line 17: |
|
| StdInChIKey = CTPQAXVNYGZUAJ-KXXVROSKSA-D |
|
| StdInChIKey = CTPQAXVNYGZUAJ-KXXVROSKSA-D |
|
| CASNo = 20298-95-7 |
|
| CASNo = 20298-95-7 |
|
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
| ⚫ |
| CASOther = <ref></ref> |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| PubChem = |
|
|
|
| UNII = 8444PN9XUW |
| ⚫ |
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
⚫ |
| CASNo_Comment = <ref></ref> |
|
⚫ |
| PubChem = 482 |
|
|
| KEGG = C15991 |
|
|
| Beilstein = 7685231 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 57733 |
|
| ChEBI = 57733 |
|
| SMILES = O=P()()O1(OP()()=O)(OP()()=O)(O)(OP()()=O)1OP()()=O |
|
| SMILES = O=P()()O1(OP()()=O)(OP()()=O)(O)(OP()()=O)1OP()()=O |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
| C=6|H=17|O=21|P=5 |
|
| C=6|H=17|O=21|P=5 |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
| Section3 = {{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
|
|
|
|
'''Inositol pentakisphosphate''' (abbreviated '''IP5''') is a molecule derived from ] by adding a ] with the help of ] (IPMK). It is believed to be one of the many ]s in the ] family. It "is implicated in a wide array of biological and pathophysiological responses, including tumorigenesis, invasion and metastasis, therefore specific inhibitors of the kinase may prove useful in cancer therapy."<ref name= "IP Promotes apoptosis">{{cite journal | pmid=14755253 | year=2004 | last1=Piccolo | first1=E. | last2=Vignati | first2=S. | last3=Maffucci | first3=T. | last4=Innominato | first4=P. F. | last5=Riley | first5=A. M. | last6=Potter | first6=B. V. | last7=Pandolfi | first7=P. P. | last8=Broggini | first8=M. | last9=Iacobelli | first9=S. | title=Inositol pentakisphosphate promotes apoptosis through the PI 3-K/Akt pathway | volume=23 | issue=9 | pages=1754–1765 | doi=10.1038/sj.onc.1207296 | journal=]}}</ref> |
|
'''Inositol pentakisphosphate''' (abbreviated '''IP5''') is a molecule derived from ] by adding a ] with the help of ] (IPMK). It is believed to be one of the many ]s in the ] family. It "is implicated in a wide array of biological and pathophysiological responses, including tumorigenesis, invasion and metastasis, therefore specific inhibitors of the kinase may prove useful in cancer therapy."<ref name= "IP Promotes apoptosis">{{cite journal | pmid=14755253 | year=2004 | last1=Piccolo | first1=E. | last2=Vignati | first2=S. | last3=Maffucci | first3=T. | last4=Innominato | first4=P. F. | last5=Riley | first5=A. M. | last6=Potter | first6=B. V. | last7=Pandolfi | first7=P. P. | last8=Broggini | first8=M. | last9=Iacobelli | first9=S. | last10=Innocenti | first10=Paolo | last11=Falasca | first11=Marco | title=Inositol pentakisphosphate promotes apoptosis through the PI 3-K/Akt pathway | volume=23 | issue=9 | pages=1754–1765 | doi=10.1038/sj.onc.1207296 | journal=]| display-authors=8 | doi-access= }}</ref> |
|
|
|
|
|
IP5 also plays a role in defense signaling in plants. It potentiates the interaction of the plant hormone ] by its receptor.<ref>{{cite journal |last=Sheard |first=L. B. |year=2010 |title=Jasmonate perception by inositol-phosphate-potentiated COI1–JAZ co-receptor|journal=] |volume=468 |pages=400–405 |doi=10.1038/nature09430 |pmid=20927106 |pmc=2988090 |issue=7322}}</ref><ref>{{cite journal |last=Mosblech |first=A. |year=2010 |title=Jasmonic acid perception by COI1 involves inositol polyphosphates in ''Arabidopsis thaliana'' |journal=] | volume=65 |issue=6 |pages=949–957 |doi=10.1111/j.1365-313X.2011.04480.x |pmid=21205029}}</ref> |
|
IP5 also plays a role in defense signaling in plants. It potentiates the interaction of the plant hormone ] by its receptor.<ref>{{cite journal |last1=Sheard |first1=L. B. |year=2010 |title=Jasmonate perception by inositol phosphate-potentiated COI1-JAZ co-receptor|journal=] |volume=468 |pages=400–405 |doi=10.1038/nature09430 |pmid=20927106 |pmc=2988090 |issue=7322 |last2=Tan |first2=Xu |last3=Mao |first3=Haibin |last4=Withers |first4=John |last5=Ben-Nissan |first5=Gili |last6=Hinds |first6=Thomas R. |last7=Kobayashi |first7=Yuichi |last8=Hsu |first8=Fong-Fu |last9=Sharon |first9=Michal|last10=Browse |first10=John |last11=He |first11=Sheng Yang |last12=Rizo |first12=Josep |last13=Howe |first13=Gregg A. |last14=Zheng |first14=Ning |bibcode=2010Natur.468..400S |display-authors=8 }}</ref><ref>{{cite journal |last1=Mosblech |first1=A. |year=2010 |title=Jasmonic acid perception by COI1 involves inositol polyphosphates in ''Arabidopsis thaliana'' |journal=] | volume=65 |issue=6 |pages=949–957 |doi=10.1111/j.1365-313X.2011.04480.x |pmid=21205029 |last2=Thurow |first2=Corinna |last3=Gatz |first3=Christiane |last4=Feussner |first4=Ivo |last5=Heilmann |first5=Ingo|doi-access=free }}</ref> |
|
|
|
|
|
==References== |
|
==References== |
| Line 46: |
Line 51: |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|
|
{{Biochem-stub}} |
|
{{Biochem-stub}} |
|
|
|
|
] |
|