| Revision as of 14:31, 9 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Wikipedia_talk:WikiProject_Ch← Previous edit |
Latest revision as of 03:21, 4 March 2023 edit undoHtmlzycq (talk | contribs)Extended confirmed users, IP block exemptions3,917 edits removed Category:Isopropyl compounds; added Category:Isopropylamino compounds using HotCat |
| (43 intermediate revisions by 26 users not shown) |
| Line 1: |
Line 1: |
|
{{Unreferenced stub|auto=yes|date=December 2009}} |
|
|
{{Chembox |
|
{{Chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 443877662 |
|
| verifiedrevid = 443879220 |
|
|ImageFile=Iprodione.png |
|
| ImageFile =Iprodione 200.svg |
|
|ImageSize=200px |
|
| ImageSize = |
|
|IUPACName= 3-(3,5-dichlorophenyl)-''N''-isopropyl-2,4-dioxoimidazolidine-1-carboxamide |
|
|
|
| PIN = 3-(3,5-Dichlorophenyl)-2,4-dioxo-''N''-(propan-2-yl)imidazolidine-1-carboxamide |
|
|OtherNames=Glycophene<br>Promidione |
|
| OtherNames =Glycophene<br>Promidione |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
⚫ |
| CASNo =36734-19-7 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 34418 |
|
| ChemSpiderID = 34418 |
|
|
| EC_number = 253-178-9 |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = C11208 |
|
| KEGG = C11208 |
| Line 17: |
Line 20: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = ONUFESLQCSAYKA-UHFFFAOYSA-N |
|
| StdInChIKey = ONUFESLQCSAYKA-UHFFFAOYSA-N |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = S3AYV2A6EU |
| ⚫ |
| CASNo=36734-19-7 |
|
|
| PubChem=37517 |
|
| PubChem =37517 |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 28909 |
|
| ChEBI = 28909 |
|
| SMILES = O=C2N(c1cc(Cl)cc(Cl)c1)C(=O)CN2C(=O)NC(C)C |
|
| SMILES = O=C2N(c1cc(Cl)cc(Cl)c1)C(=O)CN2C(=O)NC(C)C |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|C=13|H=13|Cl=2|N=3|O=3 |
|
| C=13 | H=13 | Cl=2 | N=3 | O=3 |
|
| MolarMass=330.16662 |
|
| MolarMass =330.16662 |
|
| Appearance= |
|
| Appearance =White powder |
|
| Density= |
|
| Density = |
|
|
| MeltingPtC = 133.4 |
|
| MeltingPt= |
|
|
|
| BoilingPtC = 164.5 |
|
| BoilingPt= |
|
|
|
| BoilingPt_notes = (decomposes) |
|
| Solubility= |
|
|
|
| Solubility =12.2 ''mg/L'' at 20 °C <ref name=FAO>FAO, 2004 </ref> |
| ⚫ |
}} |
|
|
|
| Solvent1 = acetone |
| ⚫ |
|Section3= {{Chembox Hazards |
|
|
|
| Solubility1 = 342 g/L |
|
| MainHazards= |
|
|
|
| Solvent2 = hexane |
|
| FlashPt= |
|
|
|
| Solubility2 = 0.59 g/L |
|
| Autoignition= |
|
|
|
| Solvent3 = acetonitrile |
|
|
| Solubility3 = 168 g/L |
|
|
| Solvent4 = dichloromethane |
|
|
| Solubility4 = 450 g/L |
|
|
| Solvent5 = ethyl acetate |
|
|
| Solubility5 = 225 g/L |
|
|
|SolubleOther = in ]: 147 g/L; in ]: 10 g/L |
|
}} |
|
}} |
|
⚫ |
|Section3={{Chembox Hazards |
|
|
| GHSPictograms = {{GHS08}}{{GHS09}} |
|
|
| GHSSignalWord = Warning |
|
|
| HPhrases = {{H-phrases|351|410}} |
|
|
| PPhrases = {{P-phrases|201|202|273|281|308+313|391|405|501}} |
|
|
| MainHazards =Limited evidence of carcinogenic effect |
|
|
| FlashPt = |
|
|
| AutoignitionPt = |
|
⚫ |
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Iprodione''' is an ] ]. |
|
'''Iprodione''' is a ] ] and ]. |
|
|
|
|
|
==Application== |
|
==Application== |
|
Iprodion is used on crops affected by ], ], ] and other fungal diseases in plants. It is currently applied in a variety of crops: fruit, vegetables, ornamental trees and scrubs and on lawns. It is a contact fungicide that inhibits the germination of fungal spores and it blocks the growth of the fungal mycelium. |
|
Iprodione is used on crops affected by ], ], ] and other fungal diseases in plants. It is currently applied in a variety of crops: fruit, vegetables, ornamental trees and shrubs and on lawns. It is a contact fungicide that inhibits the germination of fungal spores and it blocks the growth of the fungal mycelium. |
|
|
|
|
|
It has been marketed under the brand name "Rovral" and "Chipco green" (both brands of ]). This chemical was developed originally by Rhône-Poulenc Agrochimie (later Aventis CropScience and in 2002 acquired by Bayer). ] on iprodione are currently expired. |
|
It has been marketed under the brand name "Rovral" and "Chipco green" (both brands of ]). This chemical was developed originally by Rhône-Poulenc Agrochimie (later Aventis CropScience and in 2002 acquired by Bayer). As of 2004 there were no composition patents on iprodione.<ref name=FAO/> |
|
|
|
|
|
|
] (Now part of ]) discovered that iprodione kills ] and filed for patent protection for those uses.<ref>Reuters. May 8, 2009 {{webarchive|url=https://web.archive.org/web/20150924141821/http://www.reuters.com/article/2009/05/08/idUS193822+08-May-2009+MW20090508 |date=2015-09-24 }}</ref> |
|
In 2010 Iprodione was launched in the United States as a nematicide with the brand name "Enclosure" by the agbiotech company ]. |
|
|
|
|
|
|
|
Iprodione was approved in the Turkish market under the brand name Devguard for use on tomatoes and cucumbers in 2009,<ref>AgroNews Nov. 2, 2009 </ref> and was approved in the US as Enclosure for use in commercial peanut production in May 2010.<ref>AgroNews. May. 24, 2010 </ref> |
| ⚫ |
] |
|
| ⚫ |
] |
|
| ⚫ |
] |
|
| ⚫ |
] |
|
|
|
|
|
|
|
Iprodione was approved in Europe in 2010,<ref>AgroNews. Sep. 3, 2010 </ref> but approval was not renewed in 2017.<ref>Regulation (EU) 2017/2091 </ref> |
|
{{Organic-compound-stub}} |
|
|
|
|
|
|
|
==References== |
|
] |
|
|
|
{{reflist}} |
|
] |
|
|
|
|
|
|
==External links== |
|
|
* {{PPDB|403}} |
|
|
|
|
⚫ |
] |
|
⚫ |
] |
|
⚫ |
] |
|
|
] |
|
|
] |
|
⚫ |
] |