| Revision as of 18:42, 3 April 2011 editWikitanvirBot (talk | contribs)144,145 editsm r2.7.1) (robot Adding: hu:Izocetán← Previous edit |
Latest revision as of 12:47, 12 January 2024 edit undoMazewaxie (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers113,590 editsm WP:GENFIXESTag: AWB |
| (25 intermediate revisions by 17 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 402189573 |
|
|
|
| Watchedfields = changed |
|
|Reference = <ref> at ]</ref> |
|
|
⚫ |
| verifiedrevid = 422182700 |
|
|ImageFile1=Isocetane.png |
|
| ImageFile = Isocetane.png |
|
|ImageSize1=200px |
|
|
|
| ImageFile_Ref = {{chemboximage|correct|??}} |
|
|ImageFile2=Isocetane3D.png |
|
|
|
| ImageSize = 160 |
|
|ImageSize2=200px |
|
|
|
| ImageName = Skeletal formula of icocetane |
|
|IUPACName=2,2,4,4,6,8,8-Heptamethylnonane |
|
|
|
| IUPACName = 2,2,4,4,6,8,8-Heptamethylnonane<ref>{{Cite web|title=2,2,4,4,6,8,8-heptamethylnonane - Compound Summary|url=https://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=20414&loc=ec_rcs|work=PubChem Compound|publisher=National Center for Biotechnology Information|access-date=12 March 2012|location=USA|date=26 March 2005|at=Identification and Related Records|archive-date=30 October 2013|archive-url=https://web.archive.org/web/20131030081219/http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=20414&loc=ec_rcs|url-status=live}}</ref> |
|
|OtherNames=Isohexadecane |
|
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
⚫ |
| CASNo = 4390-04-9 |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
⚫ |
| PubChem = 20414 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 131383 |
|
| ChemSpiderID = 19228 |
|
| ChemSpiderID = 19228 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| UNII = 8LP0677305 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 918X1OUF1E |
|
| EINECS = 224-506-8 |
|
|
| MeSHName = 2,2,4,4,6,8,8-heptamethylnonane |
|
| InChI = 1/C16H34/c1-13(10-14(2,3)4)11-16(8,9)12-15(5,6)7/h13H,10-12H2,1-9H3 |
|
|
⚫ |
| SMILES = C(C)(C)CC(C)CC(C)(C)CC(C)(C)C |
|
| InChIKey = VCLJODPNBNEBKW-UHFFFAOYAC |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C16H34/c1-13(10-14(2,3)4)11-16(8,9)12-15(5,6)7/h13H,10-12H2,1-9H3 |
|
| StdInChI = 1S/C16H34/c1-13(10-14(2,3)4)11-16(8,9)12-15(5,6)7/h13H,10-12H2,1-9H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = VCLJODPNBNEBKW-UHFFFAOYSA-N |
|
| StdInChIKey = VCLJODPNBNEBKW-UHFFFAOYSA-N |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
| ⚫ |
| CASNo=4390-04-9 |
|
| ⚫ |
| PubChem=20414 |
|
| ⚫ |
| SMILES = CC(CC(CC(CC(C)(C)C)(C)C)C)(C)C |
|
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>16</sub>H<sub>34</sub> |
|
| C=16 | H=34 |
|
|
| Appearance = Colourless liquid |
|
| MolarMass=226.44116 |
|
|
|
| Odor = Odourless |
|
| Appearance= |
|
|
| Density=0.793 g/mL |
|
| Density = 793 mg mL<sup>−1</sup> |
|
|
| BoilingPtK = 513.2 |
|
| MeltingPt= |
|
|
|
| VaporPressure = 130 Pa (at 20 °C) |
|
| BoilingPtC=240 |
|
|
|
| RefractIndex = 1.439 |
|
| Solubility= |
|
| ⚫ |
}} |
|
| ⚫ |
|Section3= {{Chembox Hazards |
|
|
| MainHazards= |
|
|
| FlashPt=204 °F |
|
|
| Autoignition= |
|
| ⚫ |
}} |
|
|
}} |
|
}} |
|
|
|Section3={{Chembox Thermochemistry |
|
|
| HeatCapacity = 458.80 J K<sup>−1</sup> mol<sup>−1</sup> |
|
⚫ |
}} |
|
⚫ |
|Section4={{Chembox Hazards |
|
|
| FlashPtC = 96.00 |
|
⚫ |
}} |
|
|
|Section5={{Chembox Related |
|
|
| OtherFunction_label = alkanes |
|
|
| OtherFunction = {{Unbulleted list|]|]|]}} |
|
|
}} |
|
|
}} |
|
|
'''Isocetane''' (2,2,4,4,6,8,8-heptamethylnonane) is a highly branched ] used as a reference in determining the ] of diesel. It has a cetane number of 15.<ref name="Speight2015">{{Cite book |last=Speight |first=James G. |url=https://www.worldcat.org/oclc/903318141 |title=Handbook of Petroleum Product Analysis. |publisher=Wiley |year=2015 |isbn=978-1-322-95015-0 |location=Hoboken, NJ |pages=158–159 |oclc=903318141}}</ref> Isocetane replaced ] in 1962 as the lower reference for cetane number (1-methylnaphthalene has cetane number zero) owing to the oxidation instability and difficulty of use of 1-methylnaphthalene in the reference engine.<ref>{{Cite web |url=http://www.sizes.com/units/cetane_number.htm |title=Cetane number |access-date=2007-03-01 |archive-date=2014-03-12 |archive-url=https://web.archive.org/web/20140312224837/http://www.sizes.com/units/cetane_number.htm |url-status=live }}</ref><ref name="Hannu">{{Cite tech report|first=Hannu|last=Jääskeläinen|title=Fuel Property Testing: Ignition Quality|year=2007|publisher=ECOpoint Inc.|work=DieselNet Technology Guide|url=https://dieselnet.com/tech/fuel_diesel_ignition.php|access-date=2021-02-24|archive-date=2019-06-26|archive-url=https://web.archive.org/web/20190626204319/https://www.dieselnet.com/tech/fuel_diesel_ignition.php|url-status=live}}</ref> |
|
|
|
|
|
|
Strictly speaking, if the standard meaning of ‘iso’ is followed, the name ''isocetane'' should be reserved for the isomer ]. However, 2,2,4,4,6,8,8-heptamethylnonane is by far the most important isomer of ] and so, historically, it has ended up with this name. |
|
'''Isocetane''' (2,2,4,4,6,8,8-heptamethylnonane) is a highly branched ] used as a reference in determining the ] of diesel.<ref> by Bill Siuru, ''Diesel Progress, North American Edition'', March, 2002</ref> It is given a cetane number of 15. Isocetane replaced ] as the lower reference for cetane number (1-methylnaphthalene has cetane number zero) owing to the expense of 1-methylnaphthalene, and difficulty in safe handling.<ref></ref> |
|
|
|
|
|
|
== References == |
|
==References== |
|
{{Reflist}} |
|
{{Reflist}} |
|
|
|
|
| Line 48: |
Line 56: |
|
|
|
|
|
|
|
|
|
{{organic-compound-stub}} |
|
{{Organic-compound-stub}} |
|
|
|
|
] |
|
|
] |
|