| Revision as of 09:53, 19 April 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 16:49, 17 September 2023 edit undoKoIobok (talk | contribs)Extended confirmed users1,350 edits Changed Category:Amino acids to Category:Alpha-Amino acids |
| (22 intermediate revisions by 12 users not shown) |
| Line 1: |
Line 1: |
|
{{Unreferenced|date=February 2007}} |
|
|
|
|
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 400693821 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 424832042 |
|
| ImageFile = isodesmosine.svg |
|
| ImageFile = isodesmosine.svg |
|
| ImageSize = |
|
| ImageSize = |
|
| IUPACName = |
|
| IUPACName = |
|
| OtherNames = |
|
| OtherNames = |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| Abbreviations = |
|
| Abbreviations = |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 991-01-5 |
|
| CASNo = 991-01-5 |
|
| EINECS = |
|
| EINECS = |
|
| PubChem = 13811 |
|
| PubChem = 13811 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| SMILES = |
|
|
| InChI = |
|
| ChemSpiderID = 13214 |
|
|
| SMILES = c1c(c(c(c1CCC(C(=O)O)N)CCCC(C(=O)O)N)CCCCC(C(=O)O)N)CCC(C(=O)O)N |
|
|
| InChI = 1/C24H39N5O8/c25-16(21(30)31)4-1-2-11-29-13-14(7-9-18(27)23(34)35)12-15(8-10-19(28)24(36)37)20(29)6-3-5-17(26)22(32)33/h12-13,16-19H,1-11,25-28H2,(H3-,30,31,32,33,34,35,36,37)/p+1 |
|
|
| InChIKey = RGXCTRIQQODGIZ-IKLDFBCSAD |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C24H39N5O8/c25-16(21(30)31)4-1-2-11-29-13-14(7-9-18(27)23(34)35)12-15(8-10-19(28)24(36)37)20(29)6-3-5-17(26)22(32)33/h12-13,16-19H,1-11,25-28H2,(H3-,30,31,32,33,34,35,36,37)/p+1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = RGXCTRIQQODGIZ-UHFFFAOYSA-O |
|
| RTECS = |
|
| RTECS = |
|
| MeSHName = |
|
| MeSHName = D007524 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
| ChEBI = |
|
| ChEBI = 64366 |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = |
|
| KEGG = |
|
|
}} |
|
| ATCCode_prefix = |
|
|
⚫ |
|Section2={{Chembox Properties |
|
| ATCCode_suffix = |
|
|
|
| C=24 |
|
| ATC_Supplemental =}} |
|
|
|
| H=40 |
| ⚫ |
| Section2 = {{Chembox Properties |
|
|
|
| N=5 |
|
| Formula = C<sub>24</sub>H<sub>40</sub>N<sub>5</sub>O<sub>8</sub> |
|
|
|
| O=8 |
|
| MolarMass = 526.603 g/mol |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| Melting_notes = |
|
| MeltingPt_notes = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Boiling_notes = |
|
| BoilingPt_notes = |
|
| Solubility = |
|
| Solubility = |
|
| SolubleOther = |
|
| SolubleOther = |
| Line 43: |
Line 52: |
|
| Viscosity = |
|
| Viscosity = |
|
| Dipole = }} |
|
| Dipole = }} |
|
| Section3 = {{Chembox Structure |
|
|Section3={{Chembox Structure |
|
| CrystalStruct = |
|
| CrystalStruct = |
|
| Coordination = |
|
| Coordination = |
|
| MolShape = |
|
| MolShape = |
|
| Dipole = }} |
|
| Dipole = }} |
|
| Section4 = {{Chembox Thermochemistry |
|
|Section4={{Chembox Thermochemistry |
|
| DeltaHf = |
|
| DeltaHf = |
|
| DeltaHc = |
|
| DeltaHc = |
|
| Entropy = |
|
| Entropy = |
|
| HeatCapacity = }} |
|
| HeatCapacity = }} |
|
| Section5 = {{Chembox Pharmacology |
|
|Section5={{Chembox Pharmacology |
|
| AdminRoutes = |
|
| AdminRoutes = |
|
| Bioavail = |
|
| Bioavail = |
| Line 65: |
Line 74: |
|
| Legal_AU = |
|
| Legal_AU = |
|
| Legal_CA = |
|
| Legal_CA = |
|
| PregCat = |
|
| Pregnancy_category = |
|
| PregCat_AU = |
|
| Pregnancy_AU = |
|
| PregCat_US = }} |
|
| Pregnancy_US = }} |
|
| Section6 = {{Chembox Explosive |
|
|Section6={{Chembox Explosive |
|
| ShockSens = |
|
| ShockSens = |
|
| FrictionSens = |
|
| FrictionSens = |
|
| ExplosiveV = |
|
| DetonationV = |
|
| REFactor = }} |
|
| REFactor = }} |
|
| Section7 = {{Chembox Hazards |
|
|Section7={{Chembox Hazards |
|
| ExternalMSDS = |
|
| ExternalSDS = |
|
| EUClass = |
|
|
| EUIndex = |
|
|
| MainHazards = |
|
| MainHazards = |
|
| NFPA-H = |
|
| NFPA-H = |
|
| NFPA-F = |
|
| NFPA-F = |
|
| NFPA-R = |
|
| NFPA-R = |
|
| NFPA-O = |
|
| NFPA-S = |
|
| RPhrases = |
|
|
| SPhrases = |
|
|
| RSPhrases = |
|
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
| ExploLimits = |
|
| ExploLimits = |
|
| PEL = }} |
|
| PEL = }} |
|
| Section8 = {{Chembox Related |
|
|Section8={{Chembox Related |
|
| OtherAnions = |
|
| OtherAnions = |
|
| OtherCations = |
|
| OtherCations = |
|
| OtherFunctn = |
|
| OtherFunction = |
|
| Function = |
|
| OtherFunction_label = |
|
| OtherCpds = }} |
|
| OtherCompounds = }} |
|
}} |
|
}} |
|
'''Isodesmosine''' is a ] derivative found in ]. |
|
|
|
|
|
|
|
'''Isodesmosine''' is a ] derivative found in ]. Isodesmosine is an isomeric pyridinium-based amino acid resulting from the condensation of four lysine residues between elastin proteins by ]. These represent ideal biomarkers for monitoring elastin turnover because these special cross-links are only found in mature elastin in mammals.<ref>{{cite journal | doi = 10.1016/j.matbio.2006.09.011 | pmid = 17112714 | title = Differential expression of two tropoelastin genes in zebrafish | journal = Matrix Biology | volume = 26 | issue = 2 | pages = 115–124 | year = 2007 | last1 = Miao | first1 = M. | last2 = Bruce | first2 = A.E.E. | last3 = Bhanji | first3 = T. | last4 = Davis | first4 = E.C. | last5 = Keeley | first5 = F.W. }}</ref> |
| ⚫ |
] |
|
|
|
|
|
|
|
==See also== |
|
|
* ] |
|
|
|
|
|
|
==References== |
| ⚫ |
{{Biochemistry-stub}} |
|
|
|
{{reflist}} |
|
|
|
|
|
⚫ |
] |
|
] |
|
|
|
|
|
|
|
|
⚫ |
{{Biochemistry-stub}} |