| Revision as of 21:12, 12 May 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 18:20, 19 August 2022 edit undoFswitzer4 (talk | contribs)Extended confirmed users10,572 editsm Added UNII |
| (26 intermediate revisions by 21 users not shown) |
| Line 1: |
Line 1: |
|
{{Orphan|date=February 2009}} |
|
|
{{chembox |
|
{{chembox |
|
| verifiedrevid = 339270638 |
|
| verifiedrevid = 428822081 |
|
|ImageFile=ITX.png |
|
| ImageFile=4-IPX General Formulae V.1.svg |
|
|ImageSize=200px |
|
| ImageSize=200px |
|
|
| PIN=4-(Propan-2-yl)-9''H''-thioxanthen-9-one |
|
|IUPACName=4-Isopropyl-9-thioxanthenone |
|
|
|OtherNames= |
|
| OtherNames= |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo=83846-86-0 |
|
| CASNo=83846-86-0 |
| ⚫ |
| PubChem=158403 |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| SMILES=CC(C)C1=CC=CC2=C1SC3=CC=CC=C3C2=O |
|
|
|
| UNII = PAF3CW7TJ8 |
|
⚫ |
| PubChem=158403 |
|
⚫ |
| SMILES=CC(C)C1=CC=CC2=C1SC3=CC=CC=C3C2=O |
|
|
| ChemSpiderID = 139351 |
|
|
| InChI = 1/C16H14OS/c1-10(2)11-7-5-8-13-15(17)12-6-3-4-9-14(12)18-16(11)13/h3-10H,1-2H3 |
|
|
| InChIKey = IKVYHNPVKUNCJM-UHFFFAOYAM |
|
|
| StdInChI = 1S/C16H14OS/c1-10(2)11-7-5-8-13-15(17)12-6-3-4-9-14(12)18-16(11)13/h3-10H,1-2H3 |
|
|
| StdInChIKey = IKVYHNPVKUNCJM-UHFFFAOYSA-N |
|
|
| RTECS = |
|
|
| EINECS = 281-065-4 |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=16|H=14|O=1|S=1 |
|
| Formula=C<sub>16</sub>H<sub>14</sub>OS |
|
|
|
| Appearance= |
|
| MolarMass=254.35 g/mol |
|
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
|
'''Isopropylthioxanthone''' ('''ITX''') is used as a ] in printing.<ref>{{cite web|url=http://www.chemicalland21.com/arokorhi/specialtychem/finechem/ISOPROPYLTHIOXANTHONE.htm|title=ISOPROPYLTHIOXANTHONE|publisher=]|accessdate=2013-06-02|url-status=dead|archiveurl=https://archive.today/20130119022240/http://www.chemicalland21.com/arokorhi/specialtychem/finechem/ISOPROPYLTHIOXANTHONE.htm|archivedate=2013-01-19}}</ref><ref>{{cite web|url=http://www2.dupont.com/Aniline/en_US/index.html|archiveurl=https://web.archive.org/web/20070313092438/http://www.firstchem.com/firstchem3.nsf/pages/itx_other.htm|archivedate=2007-03-13|title=Isopropylthioxanthone|date=2005-11-22|publisher=]|accessdate=2013-06-02}}</ref> |
|
'''Isopropyl thioxanthone''' (ITX) is used as a ] in printing. |
|
|
|
|
|
|
Recently, traces of isopropyl thioxanthone were found by Italian authorities in babies milk produced by Nestlé. {{Fact|date=April 2007}} |
|
In 2005, traces of ] thioxanthone were found by ] authorities in babies milk produced by ].<ref>{{cite web|url=http://news.bbc.co.uk/2/hi/europe/4459520.stm|title=Baby milk scare widens in Europe|date=2005-11-22|work=]|accessdate=2013-06-02}}</ref> |
|
|
|
|
|
==External links== |
|
== References == |
|
|
<references/> |
|
* http://www.chemicalland21.com/arokorhi/specialtychem/finechem/ISOPROPYLTHIOXANTHONE.htm |
|
|
* http://www.firstchem.com/firstchem3.nsf/pages/itx_other.htm |
|
|
* http://news.bbc.co.uk/2/hi/europe/4459520.stm |
|
|
|
|
|
| ⚫ |
] |
|
|
] |
|
|
] |
|
] |
|
⚫ |
] |
|
|
|
|
|
|
|
|
{{aromatic-stub}} |
|
{{aromatic-stub}} |
|
|
|
|
] |
|
|
] |
|
|
] |
|