| Revision as of 06:23, 3 December 2010 editحسن علي البط (talk | contribs)Extended confirmed users, Pending changes reviewers19,940 editsNo edit summary← Previous edit |
Latest revision as of 18:15, 20 August 2024 edit undo2601:18e:c37e:4c10:580d:8c63:4646:ac89 (talk)No edit summary |
| (58 intermediate revisions by 36 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| verifiedrevid = 444328279 |
|
| Name = Isoquercitin |
|
|
| ImageFile = Isoquercitin.svg |
|
| Name = Isoquercetin |
|
|
| ImageFile = Isoquercitin.svg |
|
| ImageSize = 250px |
|
| ImageSize = 250px |
|
| ImageName = Isoquercitin structure |
|
| ImageName = Isoquercitrin structure |
|
|
| IUPACName = 3-(β-<small>D</small>-Glucopyranosyloxy)-3′,4′,5,7-tetrahydroxyflavone |
|
| IUPACName = 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-[(2''S'',3''R'',4''S'',5''S'',6''R'')-3,4, |
|
|
5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
|
| SystematicName = 2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-3-{oxy}-4''H''-1-benzopyran-4-one |
|
| OtherNames= Isoquercitrin<br>Isoquercitroside<br>isoquercitin<br>trifoliin<br>Isotrifolin<br>trifoliin A<br>Isohyperoside<br>Isotrifoliin<br>Quercetin-3-glucoside<br>Quercetin-3-O-glucoside |
|
| OtherNames= Isoquercitroside<br>Isoquercitrin<br>Isoquercetin<br>Trifoliin<br>Isotrifolin<br>Trifoliin A<br>Isohyperoside<br>Isotrifoliin<br>Quercetin-3-glucoside<br>Quercetin-3-''O''-glucoside<br>Quercetin 3-''O''-β-<small>D</small>-glucopyranoside |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = 21637-25-2 |
|
|
| PubChem = 5280804 |
|
| CASNo = 482-35-9 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| SMILES = C1=CC(=C(C=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)OC4C(C(C(C(O4)CO)O)O)O)O)O |
|
|
|
| UNII = 6HN2PC637T |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = C05623 |
|
|
| PubChem = 5280804 |
|
|
| ChemSpiderID = 4444361 |
|
⚫ |
| SMILES = C1=CC(=C(C=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O4((((O4)CO)O)O)O)O)O |
|
|
| InChI = 1/C21H20O12/c22-6-13-15(27)17(29)18(30)21(32-13)33-20-16(28)14-11(26)4-8(23)5-12(14)31-19(20)7-1-2-9(24)10(25)3-7/h1-5,13,15,17-18,21-27,29-30H,6H2/t13-,15-,17+,18-,21+/m1/s1 |
|
|
| InChIKey = OVSQVDMCBVZWGM-QSOFNFLRBX |
|
|
| StdInChI = 1S/C21H20O12/c22-6-13-15(27)17(29)18(30)21(32-13)33-20-16(28)14-11(26)4-8(23)5-12(14)31-19(20)7-1-2-9(24)10(25)3-7/h1-5,13,15,17-18,21-27,29-30H,6H2/t13-,15-,17+,18-,21+/m1/s1 |
|
|
| StdInChIKey = OVSQVDMCBVZWGM-QSOFNFLRSA-N |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=21 | H=20 | O=12 |
|
| Formula = C<sub>21</sub>H<sub>20</sub>O<sub>12</sub> |
|
|
|
| Density = |
|
| MolarMass = 464.37 g/mol |
|
|
⚫ |
| MeltingPt = |
|
| ExactMass = 464.095476 u |
|
|
| Density = |
|
| BoilingPt = |
| ⚫ |
| MeltingPt = <!-- °C --> |
|
|
| BoilingPt = |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
'''Isoquercetin''', '''isoquercitrin''' or '''isotrifoliin'''<ref>{{cite web|url=https://pubchem.ncbi.nlm.nih.gov/compound/5280804#section=Top |title=Isoquercetin |publisher=] |access-date=2018-09-11}}</ref> is a ], a type of chemical compound. It is the 3-''O''-] of ]. Isoquercitrin can be isolated from various plant species including '']'' (])<ref>{{Cite journal |vauthors=Singh UP, Singh DP, Singh M, etal |title=Characterization of phenolic compounds in some Indian mango cultivars |journal=International Journal of Food Sciences and Nutrition |volume=55 |issue=2 |pages=163–9 |year=2004 |pmid=14985189 |doi=10.1080/09637480410001666441}}</ref> and '']'' (the Noble rhubarb). It is also present in the leaves of '']'', '']'' (]).<ref name="pmid18997283">{{cite journal| author=Panda S, Kar A| title=Antidiabetic and antioxidative effects of ''Annona squamosa'' leaves are possibly mediated through quercetin-3-O-glucoside | journal=BioFactors | year= 2007 | volume= 31 | issue= 3-4 | pages= 201–210 | pmid=18997283 |doi=10.1002/biof.5520310307}}</ref><ref>{{Cite journal | doi = 10.1021/jf020926l | title = Simultaneous determination of all polyphenols in vegetables, fruits, and teas | year = 2003 | last1 = Sakakibara | first1 = H | last2 = Honda | first2 = Y | last3 = Nakagawa | first3 = S | last4 = Ashida | first4 = H | last5 = Kanazawa | first5 = K | journal = Journal of Agricultural and Food Chemistry | volume = 51 | issue = 3 | pages = 571–81 | pmid = 12537425}}</ref> and '']''<ref>C. Brevis, M. Quezada, P. Bustamante, L. Carrasco, A. Ruiz, S. Donoso, Huevil (Vestia foetida) poisoning of cattle in Chile ''The Veterinary record'' 156(14):452-3 May 2005</ref> |
|
'''Isoquercitin''' is a chemical compound. It can be isolated from ]es and from '']'', the Noble rhubarb or Sikkim rhubarb, a giant herbaceous plant native to the Himalaya. Quercetin glycosides are also present in tea<ref></ref>. |
|
|
|
|
|
|
⚫ |
== Spectral data == |
|
It is the 3-O-] of ]. |
|
|
⚫ |
The ] for isoquercetin is 254.8 and 352.6 ]. |
|
|
|
|
|
|
== Potential clinical uses == |
| ⚫ |
==Spectral datas== |
|
|
|
Isoquercetin is presently being investigated for prevention of ] in selected cancer patients<ref></ref> and as an anti-] agent in kidney cancer patients treated with ].<ref></ref> |
|
{| border="1" cellspacing="0" cellpadding="3" style="margin: 0 0 0 0.5em; background: #FFFFFF; border-collapse: collapse; border-color: #C0C090;" |
|
|
|
|
|
|
|
There is a single case report of its use in the successful treatment of ], a difficult to treat pruritic eruption of the skin.<ref>{{cite journal| |
|
! {{chembox header}} | ] |
|
|
|
title = Use of Isoquercetin in the Treatment of Prurigo Nodularis |url=http://jddonline.com/articles/dermatology/S1545961617P1156X/1 |date=November 2017 | volume=16 | issue=11 | pages=1156–1158 |journal=Journal of Drugs in Dermatology |first1=Christine M. |last1=Pennesi |first2=John |last2=Neely |first3=Ames G. |last3=Marks Jr. |first4=S. |last4=Alison Basak}}</ref> |
|
|- |
|
|
| ] |
|
| ⚫ |
| 254.8 ; 352.6 ] |
|
|
|- |
|
|
| ] |
|
|
| ? |
|
|
|- |
|
|
|
|
|
|
|
However it belongs to the ] categories of chemicals.<ref>{{Cite journal | journal = Nature | year = 2014| volume = 513| issue = 7519 | pages = 481–483 | title = Chemistry: Chemical con artists foil drug discovery |author1=J Baell |author2=M A Walters | doi = 10.1038/513481a |name-list-style=amp | pmid= 25254460 | doi-access = free }}</ref> |
|
! {{chembox header}} | ] |
|
|
|- |
|
|
| Major absorption bands |
|
|
| ? ]<sup>−1</sup> |
|
|
|- |
|
|
|
|
|
|
⚫ |
== References == |
|
! {{chembox header}} | ] |
|
|
|- |
|
|
| ] <!-- Link to image of spectrum --> |
|
|
|- |
|
|
| ] <!-- Link to image of spectrum --> |
|
|
|- |
|
|
| Other NMR data <!-- Insert special data e.g. <sup>19</sup>F chem. shifts, omit if not used --> |
|
|
|- |
|
|
|
|
|
! {{chembox header}} | ] |
|
|
|- |
|
|
| Masses of <br>main fragments |
|
|
| <!-- Give list of major fragments --> |
|
|
|- |
|
|
|} |
|
|
|
|
| ⚫ |
==References== |
|
|
{{Reflist}} |
|
{{Reflist}} |
|
|
|
|
|
|
== See also == |
| ⚫ |
{{flavonol}} |
|
|
|
* ] |
|
|
|
|
|
⚫ |
{{flavonol|state=collapsed}} |
| ⚫ |
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
⚫ |
] |
|
{{Polyphenol-stub}} |
|
|
|
] |