| Revision as of 14:32, 2 December 2010 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref') per Chem/Drugbox validation (report [[Wikipedia_talk:Wi← Previous edit |
Latest revision as of 15:57, 15 July 2023 edit undoJü (talk | contribs)Extended confirmed users2,896 edits png –––> svg |
| (14 intermediate revisions by 13 users not shown) |
| Line 1: |
Line 1: |
|
|
{{short description|Chemical compound}} |
|
{{chembox |
|
{{chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 400125566 |
|
| verifiedrevid = 400127212 |
|
| ImageFile = Jacaric acid.png |
|
| ImageFile = Jacaric acid Structural Formula V.1.svg |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
| IUPACName = (8''Z'',10''E'',12''Z'')-Octadeca-8,10,12-trienoic acid |
|
| PIN = (8''Z'',10''E'',12''Z'')-Octadeca-8,10,12-trienoic acid |
|
| OtherNames = Jarcaric acid |
|
| OtherNames = Jacaric acid |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 4445944 |
|
| ChemSpiderID = 4445944 |
| Line 14: |
Line 16: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = DQGMPXYVZZCNDQ-KDQYYBQISA-N |
|
| StdInChIKey = DQGMPXYVZZCNDQ-KDQYYBQISA-N |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 28872-28-8 |
|
| CASNo = 28872-28-8 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = APY53D8J4D |
|
| PubChem = 5282817 |
|
| PubChem = 5282817 |
|
| SMILES = O=C(O)CCCCCC/C=C\C=C\C=C/CCCCC |
|
| SMILES = O=C(O)CCCCCC/C=C\C=C\C=C/CCCCC |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=18|H=30|O=2 |
|
| C=18 | H=30 | O=2 |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
| Line 25: |
Line 30: |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
|
|
|
|
'''Jacaric acid''' is a ] ]. The melting point of this fatty acid is 44 °C. It occurs naturally in the seeds of the '']'' which contain about 36% jacaric acid.<ref>Gunstone, F.D et al. (2007). The Lipid Handbook with CD-ROM, Boca Raton: CRC Press. ISBN 0-8493-9688-3</ref> |
|
'''Jacaric acid''' is a ] ] with a melting point of 44 °C. It occurs naturally in the seeds of the '']'', which contain about 36% jacaric acid.<ref>Gunstone, F.D et al. (2007). The Lipid Handbook with CD-ROM, Boca Raton: CRC Press. {{ISBN|0-8493-9688-3}}</ref> |
|
|
|
|
|
==References== |
|
==References== |
| Line 37: |
Line 42: |
|
|
|
|
|
] |
|
] |
|
|
] |
|
|
|
|
] |
|