| Revision as of 05:37, 2 February 2011 editWalkerma (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers22,182 editsm "Other" name switched to the name before the move← Previous edit |
Latest revision as of 08:29, 6 October 2024 edit undoOrenburg1 (talk | contribs)Extended confirmed users165,400 editsm sp |
| (61 intermediate revisions by 33 users not shown) |
| Line 1: |
Line 1: |
|
|
{{refimprove|date=January 2015}} |
|
{{lowercase title}} |
|
{{lowercase title}} |
|
{{chembox |
|
{{chembox |
|
|ImageFile=Strophanthidin.svg |
|
| Name = k-Strophanthidin |
|
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
|
| verifiedrevid = 417597410 |
|
|
| ImageFile_Ref = {{chemboximage|correct|??}} |
|
|
| ImageFile=Strophanthidin.svg |
|
|ImageSize= |
|
|ImageSize= |
|
|
|IUPACName = 3β,5,14-Trihydroxy-5β-card-20(22)-enolid-19-al |
|
|IUPACName= 3,5,14-trihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopentaphenanthrene-10-carbaldehyde <ref name=Spt2>{{cite web |
|
|
|
|SystematicName = (1''R'',3a''S'',3b''R'',5a''S'',7''S'',9a''S'',9b''S'',11a''R'')-3a,5a,7-Trihydroxy-11a-methyl-1-(5-oxo-2,5-dihydrofuran-3-yl)hexadecahydro-9a''H''-cyclopentaphenanthrene-9a-carbaldehyde |
|
| last = 新药研发咨询中心 |
|
|
|
|OtherNames = 3β,5,14-Trihydroxy-19-oxo-5β,20(22)-cardenolide,<br> Cymarigenen,<br> Strophanthidin |
|
| first = |
|
|
| authorlink = |
|
|
| coauthors = |
|
|
| title = k-Strophanthidin |
|
|
| work = |
|
|
| publisher = |
|
|
| date = |
|
|
| url = http://www.chemdrug.com/databases/10_0_liirhkqpgmmwghyb.html |
|
|
| doi = |
|
|
| accessdate = 2 May 2009 }}</ref> |
|
|
|OtherNames= 3β,5,14-Trihydroxy-19-oxo-5β,20(22)-cardenolide,<br> Cymarigenen,<br> Strophanthidin |
|
|
|Section1= {{Chembox Identifiers |
|
|Section1= {{Chembox Identifiers |
|
|
|
|
| CASNo=66-28-4 |
|
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| CASOther = <ref name=spt>{{cite web |
|
|
|
| UNII = W5O632DN33 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 111743 |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
|
| CASNo=66-28-4 |
|
|
| CASNo_Comment = <ref name=spt>{{cite web |
|
| last = ] |
|
| last = ] |
|
| first = |
|
|
| authorlink = |
|
| authorlink = |
|
| coauthors = |
|
|
| title = Strophanthidin |
|
| title = Strophanthidin |
|
| work = |
|
|
| publisher = |
|
| publisher = |
|
| date = |
|
|
| url = http://www.sigmaaldrich.com/catalog/Lookup.do?N5=DISPLAY_CAS&N3=mode+matchpartialmax&N4=66-28-4&D7=0&D10=&N25=0&N1=S_ID&ST=RS&F=PR |
|
| url = http://www.sigmaaldrich.com/catalog/Lookup.do?N5=DISPLAY_CAS&N3=mode+matchpartialmax&N4=66-28-4&D7=0&D10=&N25=0&N1=S_ID&ST=RS&F=PR |
|
| format = |
|
| format = |
| Line 32: |
Line 30: |
|
| accessdate = 2 May 2009 }}</ref> |
|
| accessdate = 2 May 2009 }}</ref> |
|
| PubChem=6185 |
|
| PubChem=6185 |
|
| SMILES= |
|
|
| MeSHName=Strophanthidin |
|
| MeSHName=Strophanthidin |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 5950 |
|
|
| SMILES = C12CC3(1(CC2C4=CC(=O)OC4)O)CC5(3(CC(C5)O)C=O)O |
|
|
| InChI = 1/C23H32O6/c1-20-6-3-17-18(4-8-22(27)11-15(25)2-7-21(17,22)13-24)23(20,28)9-5-16(20)14-10-19(26)29-12-14/h10,13,15-18,25,27-28H,2-9,11-12H2,1H3/t15-,16+,17-,18+,20+,21-,22-,23-/m0/s1 |
|
|
| InChIKey = ODJLBQGVINUMMR-HZXDTFASBJ |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C23H32O6/c1-20-6-3-17-18(4-8-22(27)11-15(25)2-7-21(17,22)13-24)23(20,28)9-5-16(20)14-10-19(26)29-12-14/h10,13,15-18,25,27-28H,2-9,11-12H2,1H3/t15-,16+,17-,18+,20+,21-,22-,23-/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = ODJLBQGVINUMMR-HZXDTFASSA-N |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2= {{Chembox Properties |
|
| Formula=C<sub>23</sub>H<sub>32</sub>O<sub>6</sub> |
|
| Formula=C<sub>23</sub>H<sub>32</sub>O<sub>6</sub> |
|
| MolarMass=404.497 g/mol |
|
| MolarMass=404.5 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density=1.43 g/mL |
|
| MeltingPt= |
|
| MeltingPtC= 169 |
|
|
| BoilingPtC= 620.7 |
|
| BoilingPt= |
|
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3= {{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards=Toxic |
|
| FlashPt= |
|
| FlashPt= |
|
| Autoignition= |
|
| AutoignitionPt= |
|
}} |
|
}} |
|
}} |
|
}} |
|
'''k-Strophanthidin''' is a ] found in species of the ] '']''. It is the ] of k-strophanthin, an ] of ]. |
|
'''k-Strophanthidin''' is a ] found in species of the ] '']''. It is the ] of k-strophanthin, an ] of ]. k-strophanthin is found in the ripe seeds of ] and in the lily ]. |
|
|
|
|
|
K-Strophantidin can be differentiated into{{Citation needed|date=January 2015}}: |
|
|
* k-Strophanthin-α, h-Strophanthin, Cymarin, Strophanthidin-D-cymarosid (CAS: 508-77-0) |
|
|
* k-Strophanthin-β, k-Strophanthin, Strophosid, Strophanthidin-glucocymarosid (CAS: 560-53-2) |
|
|
* k-Strophanthin-γ,k-Strophanthosid, Strophanthidin-diglucocymarosid (CAS: 33279-57-1) |
|
|
* Convallatoxin or Strophanthidin-L-rhamnosid (CAS: 508-75-8) |
|
|
* Convallosid or Strophanthidin-glucorhamnosid (CAS: 13473-51-3) |
|
|
|
|
|
Strophantidin is a cardiac glycoside which mechanism of action is similar to Digitalis, Ouabain and digitoxin. It specifically inhibits the membrane protein Na+/ K+ ATPase in muscle tissue (heart) which can lead to Ca2+ overload, diastolic dysfunction, arrhythmias and ultimately to heart failure and death. |
|
|
Native African tribes used Strophantidin among other toxins as arrow poison. |
|
|
|
|
|
== History == |
|
|
|
|
|
=== 1505 === |
|
|
] of the plant ] was found by the Portuguese at Melinde in East Africa. Acokanthera schimperi belonging to the family ] is a small tree. |
|
|
|
|
|
=== 1858 – 1863 === |
|
|
In 1858 – 1863, the Scottish missionary and explorer, Dr ], led a River Zambesi Expedition in Central Africa. In addition to other arrow poisons, Dr Meller found among the Manganja hills a specimen of Strophanthus kombe (a climbing plant of considerable size) at the end of 1861. This plant, specimen of the seed and the extracted arrow poison were sent to Sir W. J. Hocker at Kew Gardens Herbarium in England and also to Europe. Several species of Strophanthus were also used by natives of West Africa as sources of arrow poison including S.hispidus, S. kombe, S.sarmentosus and S. gratus. In 1862, Dr. William Sharpey, Professor of Anatomy and Physiology at University College, London, recognized the extract as a cardiac poison. |
|
|
|
|
|
=== 1865 – 1885 === |
|
|
In 1865, Pelikan of St. Petersburg and also British Drs. Fagge and Stevenson recognized that the action of Strophanthus was similar to that of Digitalis, a foxglove plant. Thomas R. Fraser, Professor of material medicals and therapeutics in Edinburgh also worked on frogs, birds and mammals with that "Kombe arrow poison". He found that the primary action was on the heart, but noted that voluntary muscles were gradually impaired. In 1885, Fraser had isolated a ] from S. kombe and called it strophanthin, a result which he presented at a meeting of the British Medical Association in Cardiff. Galenical preparations of strophanthus came to be commonly prescribed for cardiac patients. The German pharmacologist, ], had determined the glucosidal nature of digitalis in 1874. Devoid of nitrogen, glycosides are ether-type compounds, derived from sugars and hydroxyl compounds. Aglycone or genin is glycoside with a non-sugar, while glucoside is a glycoside with a sugar such as glucose. The strophanthin from seeds of S. Kombe came to be called strophanthin-K, that from seeds of S- hispidus strophanthin-H and that from seeds of S. gratus or wood of A. schimperi was called strophanthin-G. |
|
|
|
|
|
=== 1900 - 1960 === |
|
|
Dr. Feilchenfeld of Berlin administered strophanthus as premedicant before anesthesia. Albert Fraenkel, pharmacologist in ], saw strophanthus as therapeutical in cardiac failure (emergency cases initially). So strophanthin-K (Kombetin) were used oral and intravenous. In 1925, it was recognized that absorption of strophanthus from the gut was less complete than that of digitalis. As consequence, its oral use was declined, whereas IV use was increased. Between 1910 and 1935, Fraenkel reported tens of thousands IV injections of strophanthin without complications. Bruno Kisch (New York City) noted that ouabain (strophanthin-G) has a positive ionotropic activity and faster onset than digitalis. He also found out that the use of cardiac stimulant might alleviate myocardial depression in the presence of shock (first treatment on humans with shock was in 1950). Ouabain get used in anesthesia 1955 in Britain. But in 1960, ]s as catecholamines were used in management of shock so that the use of strophanthin declined. |
|
|
|
|
|
== Production K-Strophanthidin == |
|
|
Strophanthin can be isolated from Acokanthera schimperi (family of Apocynaceae), from African plant sources (arrow poisons). Strophanthin-K can be found in seeds of S. kombe. Isolation of k-strophanthin can be done using high performance liquid chromatography (HPLC) followed by detection with electrospray ionization mass-spectrometry (ESI-MS) using RP-C-18 column (1% formic acid in water/acetonitrile as mobile phase). For details see . |
|
|
|
|
|
== Metabolism in the human body == |
|
|
'''K-strophanthidin''' can enter the body by oral ingestion or intravenously. There is a significant difference in urinary excretion between those two possibilities. The ] of k-strophanthidin when ingested orally is 23.3 hours whereas the half-life after intravenous injection is only 13.4 hours. After 24 hours already 80% of that compound is eliminated from the body. Most of the substance is excreted as a conjugated metabolites, only a small amount is excreted unchanged. There are three metabolic routes possible for k-strophanthidin. The first is the cleavage of the cymarose residue of cymarin (k-strophanthidin-alpha) which leads to k-strophantidin. Secondly, a reduction of C<sub>19</sub> aldehyde group of cymarin or k-strophanthidin can take place. This results in the formation of cymarol and k-strophanthidol. The third important route is the conjugation of cymarin and its metabolites with ] and sulfate at the sugar residue or C<sub>3</sub> of the genin. This is the main route of urinary excretion. The metabolization routes do not differ considering the method of administration (orally or intravenously) so it is still unclear why the half-life differs that much. |
|
|
|
|
|
== Medical use and effects == |
|
|
Cymarin (or k-strophanthidin) is a ] which works as an '''inhibitor''' of Na<sup>+</sup> /K<sup>+</sup>-ATPase . This inhibition has an ] on the cardiac muscles increasing their force by approximately 100%. The inhibition of that protein leads to its major effect, an increase of the <sub>i</sub>. This leads to an influx of Ca<sup>2+</sup> via the Na<sup>+</sup> /Ca<sup>2+</sup>-exchanger driven by the emerged Na<sup>+</sup> gradient. That influx drives the ] of the cardiac muscles to take up and release Ca<sup>2+</sup>. This leads to the mentioned inotropic effect. |
|
|
This only occurs between a given dose between 0.1 μmol/L and 0.5 μmol/L. Beneath the minimum dose there is no significant effect. Above the maximum dose toxic effects occur such as Ca<sup>2+</sup>-overload, diastolic dysfunction and ]. The toxic effect is also influenced by the mechanism of action of a protein called ] which regulates the sodium pump in the heart. Depending on the efficiency of this protein toxic effects can be more severe respectively occur faster or can be lessened by it. |
|
|
The inotropic and toxic effect of strophanthidin is already tested in failing human ] where it can be used therapeutically to '''strengthen''' the failing heart if dosed correctly. |
|
|
|
|
|
==See also== |
|
|
*] |
|
|
*] |
|
|
*] |
|
|
*] |
|
|
*] |
|
|
*] |
|
|
*] |
|
|
|
|
|
== References == |
|
== References == |
|
{{Reflist}} |
|
{{Reflist}} |
|
|
|
|
|
==Further reading== |
|
|
{{More footnotes|article|date=July 2014}} |
|
|
*{{cite journal |vauthors=Bolognesi R, Cucchini F, Giaroli P, Manca C |title=Different effects of acute intravenous administration of k-strophanthidin and prenalterol on the diastolic phase of left ventricular function in patients with coronary arterial disease |journal=International Journal of Cardiology |volume=32 |issue=1 |pages=29–34 |date=July 1991 |pmid=1864667 |doi=10.1016/0167-5273(91)90041-M}} |
|
|
*{{cite journal |vauthors=Ferrier GR, Moe GK |title=Effect of calcium on acetylstrophanthidin-induced transient depolarizations in canine Purkinje tissue |journal=Circulation Research |volume=33 |issue=5 |pages=508–15 |date=November 1973 |pmid=4752852 |doi=10.1161/01.RES.33.5.508|doi-access=free }} |
|
|
*{{cite journal |vauthors=Strobach H, Wirth KE, Rojsathaporn K |title=Absorption, metabolism and elimination of strophanthus glycosides in man |journal=Naunyn-Schmiedeberg's Archives of Pharmacology |volume=334 |issue=4 |pages=496–500 |date=December 1986 |pmid=3821940 |doi=10.1007/bf00569392|s2cid=1092125 }} |
|
|
*{{cite journal |vauthors=Fricke U, Klaus W |title=The influence of reduced serum potassium level on the toxicity of some cardenolides in guinea pigs |journal=Basic Research in Cardiology |volume=76 |issue=1 |pages=62–78 |year=1981 |pmid=7236178 |doi=10.1007/bf01908163|s2cid=31319066 }} |
|
|
*{{cite journal |author=McKenzie AG |title=The rise and fall of strophanthin |journal=International Congress Series |volume=1242 |date=December 2002 |pages=95–100 |doi=10.1016/S0531-5131(02)00729-X}} |
|
|
*{{cite journal |author=Morgan JP |title=The effects of digitalis on intracellular calcium transients in mammalian working myocardium as detected with aequorin |journal=Journal of Molecular and Cellular Cardiology |volume=17 |issue=11 |pages=1065–75 |date=November 1985 |pmid=3908693 |doi=10.1016/S0022-2828(85)80122-X}} |
|
|
*{{cite journal |vauthors=Qi YJ, Su SW, Li JX, Li JH, Guo F, Wang YL |title=Different Na+/K+-ATPase signal pathways was involved in the increase of i induced by strophanthidin in normal and failing isolated guinea pig ventricular myocytes |journal=Acta Pharmacologica Sinica |volume=29 |issue=11 |pages=1313–8 |date=November 2008 |pmid=18954525 |doi=10.1111/j.1745-7254.2008.00897.x|doi-access=free }} |
|
|
*{{cite journal |vauthors=Bolognesi R, Cucchini F, Javernaro A, Zeppellini R, Manca C, Visioli O |title=Effects of acute K-strophantidin administration on left ventricular relaxation and filling phase in coronary artery disease |journal=The American Journal of Cardiology |volume=69 |issue=3 |pages=169–72 |date=January 1992 |pmid=1731453 |doi=10.1016/0002-9149(92)91298-I}} |
|
|
*{{cite journal |vauthors=Song H, Karashima E, Hamlyn JM, Blaustein MP |title=Ouabain-digoxin antagonism in rat arteries and neurones |journal=The Journal of Physiology |volume=592 |issue=5 |pages=941–69 |date=March 2014 |pmid=24344167 |doi=10.1113/jphysiol.2013.266866 |pmc=3948557}} |
|
|
*{{cite journal |vauthors=Aceto E, Vassalle M |title=On the mechanism of the positive inotropy of low concentrations of strophanthidin |journal=The Journal of Pharmacology and Experimental Therapeutics |volume=259 |issue=1 |pages=182–9 |date=October 1991 |pmid=1920115 |url=http://jpet.aspetjournals.org/cgi/pmidlookup?view=long&pmid=1920115}} |
|
|
*{{cite journal |vauthors=Iacono G, Vassalle M |title=On the mechanism of the different sensitivity of Purkinje and myocardial fibers to strophanthidin |journal=The Journal of Pharmacology and Experimental Therapeutics |volume=253 |issue=1 |pages=1–12 |date=April 1990 |pmid=2329497 |url=http://jpet.aspetjournals.org/cgi/pmidlookup?view=long&pmid=2329497}} |
|
|
*{{cite journal |vauthors=von Lewinski D, Bisping E, Elgner A, Kockskämper J, Pieske B |title=Mechanistic insight into the functional and toxic effects of Strophanthidin in the failing human myocardium |journal=European Journal of Heart Failure |volume=9 |issue=11 |pages=1086–94 |date=November 2007 |pmid=17956764 |doi=10.1016/j.ejheart.2007.08.004|doi-access=free }} |
|
|
*{{cite journal |vauthors=Altamirano J, Li Y, DeSantiago J, Piacentino V, Houser SR, Bers DM |title=The inotropic effect of cardioactive glycosides in ventricular myocytes requires Na+-Ca2+ exchanger function |journal=The Journal of Physiology |volume=575 |issue=3 |pages=845–54 |date=September 2006 |pmid=16825310 |pmc=1995692 |doi=10.1113/jphysiol.2006.111252}} |
|
|
*{{cite journal |vauthors=Berret E, Nehmé B, Henry M, Toth K, Drolet G, Mouginot D |title=Regulation of central Na+ detection requires the cooperative action of the NaX channel and α1 Isoform of Na+/K+-ATPase in the Na+-sensor neuronal population |journal=The Journal of Neuroscience |volume=33 |issue=7 |pages=3067–78 |date=February 2013 |pmid=23407962 |doi=10.1523/JNEUROSCI.4801-12.2013|pmc=6619214 |doi-access=free }} |
|
|
*{{cite journal |vauthors=Grosa G, Allegrone G, Del Grosso E |title=LC-ESI-MS/MS characterization of strophanthin-K |journal=Journal of Pharmaceutical and Biomedical Analysis |volume=38 |issue=1 |pages=79–86 |date=June 2005 |pmid=15907623 |doi=10.1016/j.jpba.2004.12.008}} |
|
|
|
|
|
{{Cardiac glycosides}} |
|
{{Cardiac glycosides}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
{{biochem-stub}} |
|
|
|
|
|
] |
|