| Revision as of 09:04, 30 July 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChEMBL_Ref') per Chem/Drugbox validation (report errors or [[user ta← Previous edit |
Latest revision as of 03:17, 21 December 2024 edit undoMr.choppers (talk | contribs)Autopatrolled, Extended confirmed users, Pending changes reviewers69,326 edits Undid revision 1263815862 by PragyaanRover (talk) WP:OVERLINKTag: Undo |
| (29 intermediate revisions by 19 users not shown) |
| Line 1: |
Line 1: |
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 430979716 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| ImageFile = Kasugamycin.png |
|
|
⚫ |
| verifiedrevid = 442175301 |
|
⚫ |
| ImageFile = Kasugamycin structure.svg |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
| IUPACName = 2-amino-2-oxyoxan-3-yl]iminoacetic acid |
|
| IUPACName = 2-amino-2-oxyoxan-3-yl]iminoacetic acid |
| Line 14: |
Line 16: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = PVTHJAPFENJVNC-MHRBZPPQSA-N |
|
| StdInChIKey = PVTHJAPFENJVNC-MHRBZPPQSA-N |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 6980-18-3 |
|
| CASNo = 6980-18-3 |
|
|
| CASNo2_Ref = {{cascite|correct|CAS}} |
| ⚫ |
| CASOther = <br>19408-46-9 (]) |
|
|
|
| CASNo2 = 19408-46-9 |
|
|
| CASNo2_Comment = (]) |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = O957UYB9DY |
|
|
| UNII2 = SXA18D440T |
|
|
| UNII2_Ref = {{fdacite|correct|FDA}} |
|
⚫ |
| UNII2_Comment = (]) |
|
| PubChem = 65174 |
|
| PubChem = 65174 |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = C17968 |
|
| KEGG = C17968 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 81419 |
|
| SMILES = OC(=O)C(=N)N2C(N)(O1(O)(O)(O)(O)1O)O2C |
|
| SMILES = OC(=O)C(=N)N2C(N)(O1(O)(O)(O)(O)1O)O2C |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
| C=14|H=27|N=3|O=10 |
|
| C=14|H=25|N=3|O=9 |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
| Section3 = {{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
|
|
|
|
'''Kasugamycin''' (Ksg) is an ] ] that was originally isolated in 1965, from ''Streptomyces kasugaensis'', a '']'' strain found near the Kasuga shrine in Nara, ]. Kasugamycin was discovered by ], who also discovered ] and ], as a drug which could prevent growth of a fungus causing rice blast disease. It was later found to inhibit bacterial growth also. It exists as a white, crystalline substance with the chemical formula C<sub>14</sub>H<sub>28</sub>ClN<sub>3</sub>O<sub>10</sub> (kasugamycin hydrochloride). It is also known as kasumin. |
|
'''Kasugamycin''' (Ksg) is an ] ] that was originally isolated in 1965, from '']'', a '']'' strain found near the ] in ], ]. Kasugamycin was discovered by ], who also discovered ] and ], as a drug that prevent growth of a fungus causing ]. It was later found to inhibit bacterial growth also. It exists as a white, crystalline substance with the chemical formula C<sub>14</sub>H<sub>28</sub>ClN<sub>3</sub>O<sub>10</sub> (kasugamycin hydrochloride). It is also known as kasumin.<ref>{{cite encyclopedia |author=Franz Müller |author2=Peter Ackermann |author3=Paul Margot |title=Fungicides, Agricultural, 2. Individual Fungicides|encyclopedia=Ullmann's Encyclopedia of Industrial Chemistry|publisher=Wiley-VCH|place=Weinheim|year=2012|doi=10.1002/14356007.o12_o06|isbn=978-3-527-30673-2 }}</ref> |
|
|
|
|
|
==Mechanism of action== |
|
==Mechanism of action== |
|
Like many of the known natural ], kasugamycin inhibits proliferation of bacteria by tampering with their ability to make new ], the ] being the major target. Kasugamycin inhibits protein synthesis at the step of ] initiation. Kasugamycin inhibition is thought to occur by direct competition with initiator ]. Recent experiments suggest that kasugamycin indirectly induces dissociation of P-site-bound fMet-tRNA<sup>fMet</sup> from 30S subunits through perturbation of the ], thereby interfering with translation initiation. |
|
Like many of the known natural ]s, kasugamycin inhibits proliferation of bacteria by tampering with their ability to make new ]s, the ] being the major target. Kasugamycin inhibits protein synthesis at the step of ] initiation. Kasugamycin inhibition is thought to occur by direct competition with initiator ]. Recent experiments suggest that kasugamycin indirectly induces dissociation of P-site-bound fMet-tRNA<sup>fMet</sup> from 30S subunits through perturbation of the ], thereby interfering with translation initiation.{{cn|date=March 2023}} |
|
|
|
|
|
Kasugamycin specifically inhibits translation initiation of canonical but not of leaderless mRNA. For initiation on leaderless mRNA, the overlap between mRNA and kasugamycin is reduced and the binding of tRNA is further stabilized by the presence of the 50S subunit, minimizing Ksg efficacy. |
|
Kasugamycin specifically inhibits translation initiation of canonical but not of leaderless mRNA. For initiation on leaderless mRNA, the overlap between mRNA and kasugamycin is reduced and the binding of tRNA is further stabilized by the presence of the 50S subunit, minimizing Ksg efficacy. |
|
Kasugamycin also induces the formation of unusual 61S ribosomes in vivo, which are proficient in selectively translating leaderless mRNA. 61S particles are stable and are devoid of more than six proteins of the small subunit, including the functionally important proteins S1 and S12. |
|
Kasugamycin also induces the formation of unusual 61S ribosomes in vivo, which are proficient in selectively translating leaderless mRNA. 61S particles are stable and are devoid of more than six proteins of the small subunit, including the functionally important proteins S1 and S12.{{cn|date=March 2023}} |
|
|
|
|
|
==Structural basis for kasugamycin action== |
|
==Structural basis for kasugamycin action== |
|
The ] of kasugamycin in complex with the ''Escherichia coli'' 70S ribosome has been determined at 3.5-A resolution. The structure reveals that the drug binds within the messenger RNA channel of the 30S subunit between the universally conserved G926 and A794 nucleotides in 16S ], which are sites of kasugamycin resistance. The kasugamycin binding sites are present on top of helix 44 (h44), spanning the region between h24 and h28, which contacts the conserved nucleotides A794 and G926. Neither binding position overlaps with P-site tRNA. Instead, kasugamycin mimics the codon nucleotides at the P and E sites by binding within the path of the mRNA, thus perturbing the mRNA-tRNA codon-anticodon interaction. |
|
The structure of the kasugamycin-70S ribosome complex from ''Escherichia coli'' has been determined by ] at 3.5-A resolution. The drug binds within the messenger RNA channel of the 30S subunit between the universally conserved G926 and A794 nucleotides in 16S ], which are sites of kasugamycin resistance. The kasugamycin binding sites are present on top of helix 44 (h44), spanning the region between h24 and h28, which contacts the conserved nucleotides A794 and G926. Neither binding position overlaps with P-site tRNA. Instead, kasugamycin mimics the codon nucleotides at the P and E sites by binding within the path of the mRNA, thus perturbing the mRNA-tRNA codon-anticodon interaction.{{cn|date=March 2023}} |
|
|
|
|
|
==Resistance== |
|
==Resistance== |
|
Low level resistance to kasugamycin is acquired by ] in the 16S rRNA ] KsgA which ] the nucleotides A1518 and A1519 in 16S rRNA. Spontaneous ksgA mutations conferring a modest level of resistance to kasugamycin occur at a high frequency of 10<sup>–6</sup>. Once cells acquire the ksgA mutations, they produce high-level kasugamycin resistance at an extraordinarily high frequency (100-fold greater frequency than that observed in the ksgA+ strain). |
|
Low level resistance to kasugamycin is acquired by ]s in the 16S rRNA ] KsgA which ] the nucleotides A1518 and A1519 in 16S rRNA. Spontaneous ksgA mutations conferring a modest level of resistance to kasugamycin occur at a high frequency of 10<sup>−6</sup>. Once cells acquire the ksgA mutations, they produce high-level kasugamycin resistance at an extraordinarily high frequency (100-fold greater frequency than that observed in the ksgA+ strain).{{cn|date=March 2023}} |
|
|
|
|
|
Surprisingly, kasugamycin resistance mutations do not inhibit binding of the drug to the ribosome. Present structural and biochemical results indicate that inhibition by kasugamycin and kasugamycin resistance are closely linked to the structure of the mRNA at the junction of the peptidyl-tRNA and exit-tRNA sites (P and E sites). |
|
Surprisingly, kasugamycin resistance mutations do not inhibit binding of the drug to the ribosome. Present structural and biochemical results indicate that inhibition by kasugamycin and kasugamycin resistance are closely linked to the structure of the mRNA at the junction of the peptidyl-tRNA and exit-tRNA sites (P and E sites){{cn|date=March 2023}} |
|
|
|
|
|
==References== |
|
==References== |
|
|
<references /> |
| ⚫ |
1. Okuyama, A., Machiyama, N., Kinoshita, T., and Tanaka, N. (1971). Inhibition by kasugamycin of initiation complex formation on 30S ribosomes. Biochem. Biophys. Res. Commun. 43, 196–199. |
|
|
|
|
|
|
|
==Further reading== |
|
2. Schluenzen, F., Takemoto, C., Wilson, D.N., Kaminishi, T., Harms, J.M., Hanawa-Suetsugu, K., Szaflarski, W., Kawazoe, M., Shirouzu, M., Nierhaus, K.H., et al. (2006). The antibiotic kasugamycin mimics mRNA nucleotides to destabilize tRNA binding and inhibit canonical translation initiation. Nat. Struct. Mol. Biol. 13, 871–878. |
|
|
⚫ |
1. Okuyama, A., Machiyama, N., Kinoshita, T., and Tanaka, N. (1971). Inhibition by kasugamycin of initiation complex formation on 30S ribosomes. Biochem. Biophys. Res. Commun. 43, 196–199. |
|
|
|
|
|
3. Schuwirth, B.S., Day, J.M., Hau, C.W., Janssen, G.R., Dahlberg, A.E., Cate, J.H., and Vila-Sanjurjo, A. (2006). Structural analysis of kasugamycin inhibition of translation. Nat. Struct. Mol. Biol. 13, 879–886. |
|
2. Schluenzen, F., Takemoto, C., Wilson, D.N., Kaminishi, T., Harms, J.M., Hanawa-Suetsugu, K., Szaflarski, W., Kawazoe, M., Shirouzu, M., Nierhaus, K.H., et al. (2006). The antibiotic kasugamycin mimics mRNA nucleotides to destabilize tRNA binding and inhibit canonical translation initiation. Nat. Struct. Mol. Biol. 13, 871–878. |
|
|
|
|
|
|
3. Schuwirth, B.S., Day, J.M., Hau, C.W., Janssen, G.R., Dahlberg, A.E., Cate, J.H., and Vila-Sanjurjo, A. (2006). Structural analysis of kasugamycin inhibition of translation. Nat. Struct. Mol. Biol. 13, 879–886. |
| ⚫ |
4. Kaberdina A.C., Szaflarski W., Nierhaus K.H., and Moll I. (2009). An Unexpected Type of Ribosomes Induced by Kasugamycin: A Look into Ancestral Times of Protein Synthesis?. Mol. Cell. 33(2):141-2. |
|
|
|
|
|
|
⚫ |
4. Kaberdina A.C., Szaflarski W., Nierhaus K.H., and Moll I. (2009). An Unexpected Type of Ribosomes Induced by Kasugamycin: A Look into Ancestral Times of Protein Synthesis?. Mol. Cell. 33(2):141-2. |
| ⚫ |
5. Ochi K., Kim J., Tanaka Y., Wang G., Masuda K., Nanamiya H., Okamoto S., Tokuyama S., Adachi Y. and Kawamura F. (2009). Inactivation of KsgA, a 16S rRNA Methyltransferase, Causes Vigorous Emergence of Mutants with High-Level Kasugamycin Resistance. Antimicrobial Agents and Chemotherapy, 53,1 (193-201). |
|
|
|
|
| ⚫ |
6. Mankin A. (2006). Antibiotic blocks mRNA path on the ribosome. Nature Structural & Molecular Biology - 13, 858 – 860. |
|
|
|
|
|
|
⚫ |
5. Ochi K., Kim J., Tanaka Y., Wang G., Masuda K., Nanamiya H., Okamoto S., Tokuyama S., Adachi Y. and Kawamura F. (2009). Inactivation of KsgA, a 16S rRNA Methyltransferase, Causes Vigorous Emergence of Mutants with High-Level Kasugamycin Resistance. Antimicrobial Agents and Chemotherapy, 53,1 (193-201). |
|
|
|
|
|
⚫ |
6. Mankin A. (2006). Antibiotic blocks mRNA path on the ribosome. Nature Structural & Molecular Biology - 13, 858 – 860. |
|
|
|
|
|
] |
|
] |
|
|
|
|
] |
|