| Revision as of 01:21, 1 July 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (changes to verified fields - updated 'ChEMBL_Ref') per Chem/Drugbox validation (report errors or bugs)← Previous edit |
Latest revision as of 12:43, 19 January 2025 edit undoMaverickBlazer (talk | contribs)12 edits Removed side explanation and linked to the main article instead.Tags: Visual edit Mobile edit Mobile web edit |
| (34 intermediate revisions by 28 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{drugbox |
|
|
|
{{cs1 config|name-list-style=vanc}} |
|
| Verifiedfields = changed |
|
|
|
{{Drugbox |
| ⚫ |
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
⚫ |
| verifiedrevid = 443949789 |
|
⚫ |
| IUPAC_name = (2''S'',6''R'',11''R'')-3-(cyclopropylmethyl)-8-hydroxy-6,11-dimethyl-3,4,5,6-tetrahydro-2,6-methano-3-benzazocin-1(2''H'')-one |
|
⚫ |
| image = Ketazocine structure.svg |
|
|
|
|
|
<!--Clinical data--> |
|
|
| tradename = |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = Oral |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
⚫ |
| CAS_number = 36292-69-0 |
|
⚫ |
| ATC_prefix = none |
|
⚫ |
| ATC_suffix = |
|
⚫ |
| PubChem = 3054741 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 2316328 |
|
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 6IO4IG518S |
|
| UNII = 6IO4IG518S |
|
⚫ |
| KEGG_Ref = {{keggcite|correct|kegg}} |
| ⚫ |
| verifiedrevid = 400126983 |
|
|
⚫ |
| KEGG = D04649 |
| ⚫ |
| IUPAC_name = (2''S'',6''R'',11''R'')-3-(cyclopropylmethyl)-8-hydroxy-6,11-dimethyl-3,4,5,6-tetrahydro-2,6-methano-3-benzazocin-1(2''H'')-one |
|
|
|
|
| ⚫ |
| image = Ketazocine.svg |
|
|
|
<!--Chemical data--> |
|
| InChI = 1/C18H23NO2/c1-11-16-17(21)14-6-5-13(20)9-15(14)18(11,2)7-8-19(16)10-12-3-4-12/h5-6,9,11-12,16,20H,3-4,7-8,10H2,1-2H3/t11-,16-,18+/m0/s1 |
|
|
⚫ |
| C=18 | H=23 | N=1 | O=2 |
|
| InChIKey = HQBZLVPZOGIAIQ-SDDDUWNIBX |
|
|
⚫ |
| smiles = O=C2c1c(cc(O)cc1)3((2N(CC3)CC4CC4)C)C |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C18H23NO2/c1-11-16-17(21)14-6-5-13(20)9-15(14)18(11,2)7-8-19(16)10-12-3-4-12/h5-6,9,11-12,16,20H,3-4,7-8,10H2,1-2H3/t11-,16-,18+/m0/s1 |
|
| StdInChI = 1S/C18H23NO2/c1-11-16-17(21)14-6-5-13(20)9-15(14)18(11,2)7-8-19(16)10-12-3-4-12/h5-6,9,11-12,16,20H,3-4,7-8,10H2,1-2H3/t11-,16-,18+/m0/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = HQBZLVPZOGIAIQ-SDDDUWNISA-N |
|
| StdInChIKey = HQBZLVPZOGIAIQ-SDDDUWNISA-N |
| ⚫ |
| CAS_number = 36292-69-0 |
|
| ⚫ |
| ATC_prefix = none |
|
| ⚫ |
| ATC_suffix = |
|
| ⚫ |
| PubChem = 3054741 |
|
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ⚫ |
| ChemSpiderID = 2316328 |
|
| ⚫ |
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
| ⚫ |
| KEGG = D04649 |
|
| ⚫ |
| C = 18 | H = 23 | N = 1 | O = 2 |
|
|
| molecular_weight = 285.38 g/mol |
|
| ⚫ |
| smiles = O=C2c1c(cc(O)cc1)3((2N(CC3)CC4CC4)C)C |
|
| ⚫ |
| bioavailability = |
|
| ⚫ |
| metabolism = |
|
| ⚫ |
| elimination_half-life = |
|
| ⚫ |
| excretion = |
|
| ⚫ |
| pregnancy_category = |
|
| ⚫ |
| legal_status = ? |
|
| ⚫ |
| routes_of_administration = Oral |
|
|
}} |
|
}} |
|
⚫ |
'''Ketazocine''' (]), also known as '''ketocyclazocine''', is a ] derivative used in ] research. Ketazocine, for which the receptor is named, is an ] opioid that binds to the ].<ref>{{cite journal | vauthors = Leander JD | title = Effects of ketazocine, ethylketazocine and phenazocine on schedule-controlled behavior: antagonism by naloxone | journal = Neuropharmacology | volume = 21 | issue = 9 | pages = 923–8 | date = September 1982 | pmid = 6128693 | doi = 10.1016/0028-3908(82)90085-5 | s2cid = 38692038 }}</ref> |
|
|
|
|
|
|
Activation of this receptor is known to cause sleepiness, a decrease in pain sensation and (potentially) ], ], and ]. It also causes an increase in urine production because it inhibits the release of ]. |
| ⚫ |
'''Ketazocine''' (]), also known as '''ketocyclazocine''', is a ] derivative used in ] research. Ketocyclazocine is an ] opioid that binds to the ].<ref>{{cite journal |journal=Neuropharmacology |year=1982 Sep |volume=21 |issue=9 |pages=923–8 |title=Effects of ketazocine, ethylketazocine and phenazocine on schedule-controlled behavior: antagonism by naloxone |author=Leander JD |pmid=6128693 }}</ref> |
|
|
|
|
|
|
⚫ |
Unlike other opioids, substances that only bind to the κ receptor theoretically do not depress the ]. |
|
Activation of this receptor causes a decrease in pain sensations and increased sleepiness but can also cause psychological symptoms such as feelings of unease, ], and ]. It also causes an increase in urine production because it inhibits the release of vasopressin. (] is an ] substance that assists in regulating fluid and electrolyte balance in the body and decreases the amount of water released into the urine.) |
|
|
|
|
|
|
|
The crystal structure of ketazocine was determined in 1983.<ref>{{cite journal | vauthors= Verlinde CL, De Ranter CJ | title = (1S, 5R, 9R)-2-Cyclopropylmethyl-2'-hydroxy-5, 9-dimethyl-8-oxo-6, 7-benzomorphan hydrochloride monohydrate (ketazocine), C18H23NO2. HCl. H2O | journal= Acta Crystallogr. C| year = 1983 | volume = 39 | issue = 12 | pages= 1703–1706 | doi = 10.1107/S0108270183009828 | bibcode = 1983AcCrC..39.1703V }}</ref> |
| ⚫ |
Unlike other opioids, substances that only bind to the kappa receptor theoretically do not impair the normal drive to breathe. |
|
|
|
|
|
|
== See also == |
|
== See also == |
|
* ] |
|
* ] |
|
|
* ] |
|
|
|
|
|
== References == |
|
== References == |
|
{{reflist|2}} |
|
{{Reflist}} |
|
{{Opioids}} |
|
|
|
|
|
|
|
{{Hallucinogens}} |
| ⚫ |
] |
|
|
|
{{Opioidergics}} |
| ⚫ |
] |
|
| ⚫ |
] |
|
| ⚫ |
] |
|
| ⚫ |
] |
|
|
|
|
|
|
⚫ |
] |
|
] |
|
|
⚫ |
] |
|
⚫ |
] |
|
⚫ |
] |
|
⚫ |
] |