Revision as of 19:12, 18 April 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 07:20, 6 January 2024 edit undoMaxim Masiutin (talk | contribs)Extended confirmed users, IP block exemptions, Pending changes reviewers31,042 edits Misc citation tidying. Put the {{Short description}} template first as prescribed by MOS:ORDER. |
(23 intermediate revisions by 19 users not shown) |
Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
|
{{cs1 config|name-list-style=vanc}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
⚫ |
| verifiedrevid = 295751117 |
|
|
|
| Watchedfields = changed |
|
| IUPAC_name = 2-[(4''R'',5''S'',6''S'',7''R'',9''R'',10''R'',11''E'',13''E'',16''R'')-6-[(2''S'',3''R'',4''R'',5''S'',6''R'') |
|
|
⚫ |
| verifiedrevid = 424731909 |
|
-5-[(2''S'',4''R'',5''S'',6''S'')-4,5-Dihydroxy-4,6-dimethyloxan- |
|
|
|
| IUPAC_name = oxy}-4-(dimethylamino)-3-hydroxy-6-methyltetrahydro-2H-pyran-2-yl]oxy}-4,10-dihydroxy-5-methoxy-9,16-dimethyl-2-oxooxacyclohexadeca-11,13-dien-7-yl]acetaldehyde (non-preferred name) |
|
2-yl]oxy-4-dimethylamino-3-hydroxy-6-methyloxan-2-yl]oxy-4,10-dihydroxy- |
|
|
⚫ |
| image = kitasamycin.png |
|
5-methoxy-9,16-dimethyl-2-oxo-1-oxacyclohexadeca-11,13-dien-7-yl]acetaldehyde |
|
|
|
|
⚫ |
| image = kitasamycin.png |
|
|
|
<!--Clinical data--> |
⚫ |
| CAS_number = 39405-35-1 |
|
|
| synonyms = Turimycin |
|
| tradename = |
|
|
| Drugs.com = {{drugs.com|international|kitasamycin}} |
|
| CAS_supplemental = |
|
|
| ATCvet = yes |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
⚫ |
| ATC_prefix = J01 |
|
|
⚫ |
| pregnancy_category = |
⚫ |
| ATC_suffix = FA93 |
|
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
⚫ |
| ATC_supplemental = |
|
|
| PubChem = 5282189 |
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| DrugBank = |
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
⚫ |
| chemical_formula = |
|
|
⚫ |
| legal_status = |
⚫ |
| C=35 | H=59 | N=1 | O=13 |
|
|
⚫ |
| routes_of_administration = |
|
| molecular_weight = 701.84 g/mol |
|
|
|
|
|
| bioavailability = |
|
|
|
<!--Pharmacokinetic data--> |
⚫ |
| protein_bound = |
|
|
| metabolism = |
|
| bioavailability = |
|
⚫ |
| protein_bound = |
|
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
|
<!--Identifiers--> |
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
|
|
| CAS_number_Ref = {{cascite|correct|CAS}} |
⚫ |
| pregnancy_category= |
|
|
⚫ |
| CAS_number = 22875-15-6 |
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
|
| UNII = VW9SY2S5WL |
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
|
|
| ATCvet = yes |
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
|
⚫ |
| ATC_prefix = J01 |
⚫ |
| legal_status = |
|
|
⚫ |
| ATC_suffix = FA93 |
⚫ |
| routes_of_administration = |
|
|
⚫ |
| ATC_supplemental = |
|
|
| PubChem = 5282189 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 1909061 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 4445382 |
|
|
|
|
|
<!--Chemical data--> |
|
⚫ |
| chemical_formula = |
|
⚫ |
| C=35 | H=59 | N=1 | O=13 |
|
|
| synonyms = Turimycin |
|
|
| smiles = C1C/C=C/C=C/((C((((CC(=O)O1)O)OC)O2((((O2)C)O3C(((O3)C)O)(C)O)N(C)C)O)CC=O)C)O |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C35H59NO13/c1-19-16-23(14-15-37)31(32(44-8)25(39)17-26(40)45-20(2)12-10-9-11-13-24(19)38)49-34-29(41)28(36(6)7)30(21(3)47-34)48-27-18-35(5,43)33(42)22(4)46-27/h9-11,13,15,19-25,27-34,38-39,41-43H,12,14,16-18H2,1-8H3/b10-9+,13-11+/t19-,20-,21-,22+,23+,24+,25-,27+,28-,29-,30-,31+,32+,33+,34+,35-/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = XYJOGTQLTFNMQG-KJHBSLKPSA-N |
|
}} |
|
}} |
|
|
|
|
|
'''Kitasamycin''' (]) is a ]. It is produced by streptomyces kitasatoensis.{{Fact|date=May 2009}} The drug has antimicrobial activity against a wide spectrum of pathogens.{{Vague|date=May 2009}} |
|
'''Kitasamycin''' (]) is a ]. It is produced by ''Streptomyces kitasatoensis''.<ref name="pmid26339801">{{cite journal | vauthors = Zheng Q, Gao S | title = The effect of surfactant on fermentation of kitasamycin in Streptomyces kitasatoensis | journal = Biotechnology and Applied Biochemistry | volume = 63 | issue = 6 | pages = 895–900 | date = November 2016 | pmid = 26339801 | doi = 10.1002/bab.1443 | s2cid = 7290695 }}</ref> The drug has antimicrobial activity against a wide spectrum of pathogens. There are several generic names of this drug such as:<ref>{{cite web | title = Kitasamycin | url = https://www.drugs.com/international/kitasamycin.html | archive-url = https://web.archive.org/web/20121020200912/https://www.drugs.com/international/kitasamycin.html | archive-date = 20 October 2012 | work = Drugs.com }}</ref> |
|
|
* Kitasamycin (OS: BAN, JAN, USAN) |
|
|
* Kitasamycine (OS: DCF) |
|
|
* C 637 (IS) |
|
|
* Katasamycin (IS) |
|
|
* Leucomycin (IS) |
|
|
* Kitasamycin (PH: JP XV) |
|
|
* Kitasamycin Acetate (OS: JAN) |
|
|
* Leucomycin Acetate (IS) |
|
|
* Kitasamycin Acetate (PH: JP XV) |
|
|
* Kitasamycin Tartrate (OS: JAN) |
|
|
* Leucomycin Tartrate (IS) |
|
|
* Kitasamycin Tartrate (PH: JP XV) |
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
] |
|
] |
Line 40: |
Line 77: |
|
|
|
|
|
{{antibiotic-stub}} |
|
{{antibiotic-stub}} |
|
|
|
|
|
{{Macrolides, lincosamides and streptogramins}} |