Browse history interactively

Page 1

Page 1Revision 1

Page 2

Page 2Revision 2

← Previous editContent deleted Content addedVisualWikitext

Revision as of 19:12, 18 April 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit		Latest revision as of 07:20, 6 January 2024 edit undoMaxim Masiutin (talk | contribs)Extended confirmed users, IP block exemptions, Pending changes reviewers31,042 edits Misc citation tidying. Put the {{Short description}} template first as prescribed by MOS:ORDER.
(23 intermediate revisions by 19 users not shown)
Line 1:		Line 1:
			{{Short description|Chemical compound}}
			{{cs1 config|name-list-style=vanc}}
	{{Drugbox		{{Drugbox
			| Verifiedfields = changed
⚫	| verifiedrevid = 295751117
			| Watchedfields = changed
	| IUPAC_name = 2-[(4''R'',5''S'',6''S'',7''R'',9''R'',10''R'',11''E'',13''E'',16''R'')-6-[(2''S'',3''R'',4''R'',5''S'',6''R'')
		⚫	| verifiedrevid = 424731909
	-5-[(2''S'',4''R'',5''S'',6''S'')-4,5-Dihydroxy-4,6-dimethyloxan-
			| IUPAC_name = oxy}-4-(dimethylamino)-3-hydroxy-6-methyltetrahydro-2H-pyran-2-yl]oxy}-4,10-dihydroxy-5-methoxy-9,16-dimethyl-2-oxooxacyclohexadeca-11,13-dien-7-yl]acetaldehyde (non-preferred name)
	2-yl]oxy-4-dimethylamino-3-hydroxy-6-methyloxan-2-yl]oxy-4,10-dihydroxy-
		⚫	| image = kitasamycin.png
	5-methoxy-9,16-dimethyl-2-oxo-1-oxacyclohexadeca-11,13-dien-7-yl]acetaldehyde
⚫	| image = kitasamycin.png
			<!--Clinical data-->
⚫	| CAS_number = 39405-35-1
	| synonyms = Turimycin		| tradename =
			| Drugs.com = {{drugs.com|international|kitasamycin}}
	| CAS_supplemental =
	| ATCvet = yes		| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
		⚫	| pregnancy_US = <!-- A / B / C / D / X -->
⚫	| ATC_prefix = J01
		⚫	| pregnancy_category =
⚫	| ATC_suffix = FA93
		⚫	| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
⚫	| ATC_supplemental =
	| PubChem = 5282189		| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
	| DrugBank =		| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
		⚫	| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
⚫	| chemical_formula =
		⚫	| legal_status =
⚫	| C=35 | H=59 | N=1 | O=13
		⚫	| routes_of_administration =
	| molecular_weight = 701.84 g/mol
	| bioavailability =
			<!--Pharmacokinetic data-->
⚫	| protein_bound =
	| metabolism =		| bioavailability =
		⚫	| protein_bound =
			| metabolism =
	| elimination_half-life =		| elimination_half-life =
	| excretion =		| excretion =
	| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
			<!--Identifiers-->
⚫	| pregnancy_US = <!-- A / B / C / D / X -->
			| CAS_number_Ref = {{cascite|correct|CAS}}
⚫	| pregnancy_category=
		⚫	| CAS_number = 22875-15-6
⚫	| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
			| UNII_Ref = {{fdacite|correct|FDA}}
	| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
			| UNII = VW9SY2S5WL
	| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
			| ATCvet = yes
⚫	| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
		⚫	| ATC_prefix = J01
⚫	| legal_status =
		⚫	| ATC_suffix = FA93
⚫	| routes_of_administration =
		⚫	| ATC_supplemental =
			| PubChem = 5282189
			| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
			| DrugBank =
			| ChEMBL_Ref = {{ebicite|changed|EBI}}
			| ChEMBL = 1909061
			| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
			| ChemSpiderID = 4445382
			<!--Chemical data-->
		⚫	| chemical_formula =
		⚫	| C=35 | H=59 | N=1 | O=13
			| synonyms = Turimycin
			| smiles = C1C/C=C/C=C/((C((((CC(=O)O1)O)OC)O2((((O2)C)O3C(((O3)C)O)(C)O)N(C)C)O)CC=O)C)O
			| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
			| StdInChI = 1S/C35H59NO13/c1-19-16-23(14-15-37)31(32(44-8)25(39)17-26(40)45-20(2)12-10-9-11-13-24(19)38)49-34-29(41)28(36(6)7)30(21(3)47-34)48-27-18-35(5,43)33(42)22(4)46-27/h9-11,13,15,19-25,27-34,38-39,41-43H,12,14,16-18H2,1-8H3/b10-9+,13-11+/t19-,20-,21-,22+,23+,24+,25-,27+,28-,29-,30-,31+,32+,33+,34+,35-/m1/s1
			| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
			| StdInChIKey = XYJOGTQLTFNMQG-KJHBSLKPSA-N
	}}		}}
	'''Kitasamycin''' (]) is a ]. It is produced by streptomyces kitasatoensis.{{Fact|date=May 2009}} The drug has antimicrobial activity against a wide spectrum of pathogens.{{Vague|date=May 2009}}		'''Kitasamycin''' (]) is a ]. It is produced by ''Streptomyces kitasatoensis''.<ref name="pmid26339801">{{cite journal | vauthors = Zheng Q, Gao S | title = The effect of surfactant on fermentation of kitasamycin in Streptomyces kitasatoensis | journal = Biotechnology and Applied Biochemistry | volume = 63 | issue = 6 | pages = 895–900 | date = November 2016 | pmid = 26339801 | doi = 10.1002/bab.1443 | s2cid = 7290695 }}</ref> The drug has antimicrobial activity against a wide spectrum of pathogens. There are several generic names of this drug such as:<ref>{{cite web | title = Kitasamycin | url = https://www.drugs.com/international/kitasamycin.html | archive-url = https://web.archive.org/web/20121020200912/https://www.drugs.com/international/kitasamycin.html | archive-date = 20 October 2012 | work = Drugs.com }}</ref>
			* Kitasamycin (OS: BAN, JAN, USAN)
			* Kitasamycine (OS: DCF)
			* C 637 (IS)
			* Katasamycin (IS)
			* Leucomycin (IS)
			* Kitasamycin (PH: JP XV)
			* Kitasamycin Acetate (OS: JAN)
			* Leucomycin Acetate (IS)
			* Kitasamycin Acetate (PH: JP XV)
			* Kitasamycin Tartrate (OS: JAN)
			* Leucomycin Tartrate (IS)
			* Kitasamycin Tartrate (PH: JP XV)
			== References ==
			{{Reflist}}
	]		]
Line 40:		Line 77:
	{{antibiotic-stub}}		{{antibiotic-stub}}
			{{Macrolides, lincosamides and streptogramins}}