| Revision as of 17:00, 10 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[WP:CHEMVALID|Chem/Drugbox validation← Previous edit |
Latest revision as of 02:53, 3 May 2023 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 edits add semisystematic name |
| (16 intermediate revisions by 14 users not shown) |
| Line 1: |
Line 1: |
|
{{Wikify|date=September 2011}} |
|
|
|
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 423309720 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 449561436 |
|
| Name = Kumatakenin |
|
| Name = Kumatakenin |
|
| ImageFile = Kumatakenin.PNG |
|
| ImageFile = Kumatakenin.svg |
|
| ImageSize = 200px |
|
|
| ImageName = Chemical structure of kumatakenin |
|
| ImageName = Chemical structure of kumatakenin |
|
| IUPACName = 5-hydroxy-2-(4-hydroxyphenyl)-3,7-dimethoxychromen-4-one |
|
| IUPACName = 4′,5-Dihydroxy-3,7-dimethoxyflavone |
|
|
| SystematicName = 5-Hydroxy-2-(4-hydroxyphenyl)-3,7-dimethoxy-4''H''-1-benzopyran-4-one |
|
| OtherNames = Jaranol<br>Kumatakillin<br>5,4'-dihydroxy-3,7-dimethoxyflavone |
|
| OtherNames = Jaranol<br>Kumatakillin<br>5,4'-Dihydroxy-3,7-dimethoxyflavone<br>3,7-Dimethoxyl kaempferol<br>Kamatakenin |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 3301-49-3 |
|
| CASNo = 3301-49-3 |
|
| CASNo_Ref = |
|
| CASNoOther = |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| CASOther = |
|
|
|
| UNII = 5FAQ11412T |
|
| PubChem = 5318869 |
|
| PubChem = 5318869 |
|
| SMILES = COC1=CC(=C2C(=C1)OC(=C(C2=O)OC)C3=CC=C(C=C3)O)O |
|
| SMILES = COC1=CC(=C2C(=C1)OC(=C(C2=O)OC)C3=CC=C(C=C3)O)O |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| InChI = |
|
|
|
| ChemSpiderID = 4477326 |
|
|
| InChI = 1/C17H14O6/c1-21-11-7-12(19)14-13(8-11)23-16(17(22-2)15(14)20)9-3-5-10(18)6-4-9/h3-8,18-19H,1-2H3 |
|
|
| InChIKey = BJBUTJQYZDYRMJ-UHFFFAOYAI |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C17H14O6/c1-21-11-7-12(19)14-13(8-11)23-16(17(22-2)15(14)20)9-3-5-10(18)6-4-9/h3-8,18-19H,1-2H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = BJBUTJQYZDYRMJ-UHFFFAOYSA-N |
|
| MeSHName = |
|
| MeSHName = |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=17 |
|
| Formula = C<sub>17</sub>H<sub>14</sub>O<sub>6</sub> |
|
|
|
| H=14 |
|
| MolarMass = 314.28 g/mol |
|
|
|
| O=6 |
|
| ExactMass = 314.079038 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPt = |
|
| BoilingPt = <!-- °C --> |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Kumatakenin''' is an ]. It can be found in '']''.<ref> |
|
'''Kumatakenin''' is an ]. It can be found in '']''.<ref>{{Cite journal | doi = 10.1007/BF00563758| title = Kumatakenin from Astragalus membranaceus| journal = Chemistry of Natural Compounds| volume = 8| issue = 3| pages = 382| year = 1972| last1 = Dungérdorzh| first1 = D| last2 = Petrenko| first2 = V. V| doi-access = free}}</ref> |
|
|
|
|
|
==References== |
|
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
{{flavonol}} |
|
{{flavonol}} |
|
|
|
|
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
|
{{Natural-phenol-stub}} |
|
{{phenol-stub}} |