| Revision as of 20:30, 20 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Wik← Previous edit |
Latest revision as of 01:05, 10 February 2024 edit undoBeland (talk | contribs)Autopatrolled, Administrators236,908 editsm convert special characters found by Misplaced Pages:Typo Team/moss (via WP:JWB) |
| (23 intermediate revisions by 19 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
| verifiedrevid = 449583842 |
|
| verifiedrevid = 451561741 |
|
| IUPAC_name = (4R)-6-acetyl-4-(di-''n''-propylamino)-1,3,4,5-tetrahydrobenzindole |
|
| IUPAC_name = (4R)-6-acetyl-4-(di-''n''-propylamino)-1,3,4,5-tetrahydrobenzindole |
|
| image = LY293284_structure.png |
|
| image = LY293284_structure.png |
| Line 7: |
Line 8: |
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| legal_status = |
|
| legal_status = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| IUPHAR_ligand = 19 |
|
|
| CAS_number_Ref = {{cascite|correct|CAS}} |
|
| CAS_number = 141318-62-9 |
|
| CAS_number = 141318-62-9 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 92MME29XHM |
|
| PubChem = 132345 |
|
| PubChem = 132345 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| ChemSpiderID = 116875 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=19 | H=26 | N=2 | O=1 |
|
| C=19 | H=26 | N=2 | O=1 |
|
| molecular_weight = 298.423 g/mol |
|
|
| smiles = CCCN(CCC)1CC2=CNC3=C2C(=C(C=C3)C(=O)C)C1 |
|
| smiles = CCCN(CCC)1CC2=CNC3=C2C(=C(C=C3)C(=O)C)C1 |
|
|
| StdInChI = 1S/C19H26N2O/c1-4-8-21(9-5-2)15-10-14-12-20-18-7-6-16(13(3)22)17(11-15)19(14)18/h6-7,12,15,20H,4-5,8-11H2,1-3H3/t15-/m0/s1 |
|
|
| StdInChIKey = CKYZLYQSDNLGPT-HNNXBMFYSA-N |
|
}} |
|
}} |
|
|
|
|
|
'''LY-293,284''' is a research chemical developed by the pharmaceutical company ] and used for scientific studies. It acts as a ] and selective ] ] ]. It was derived through structural simplification of the ] based hallucinogen ],<ref name="pmid9622555">{{cite journal |author=Monte AP, Marona-Lewicka D, Lewis MM, Mailman RB, Wainscott DB, Nelson DL, Nichols DE |title=Substituted naphthofurans as hallucinogenic phenethylamine-ergoline hybrid molecules with unexpected muscarinic antagonist activity |journal=Journal of Medicinal Chemistry |volume=41 |issue=12 |pages=2134–45 |year=1998 |month=June |pmid=9622555 |doi=10.1021/jm980076u |url=}}</ref> but is far more selective for 5-HT<sub>1A</sub> with over 1000x selectivity over other serotonin receptor subtypes and other targets.<ref name="pmid7523657">{{cite journal |author=Foreman MM, Fuller RW, Rasmussen K, Nelson DL, Calligaro DO, Zhang L, Barrett JE, Booher RN, Paget CJ, Flaugh ME |title=Pharmacological characterization of LY293284: A 5-HT1A receptor agonist with high potency and selectivity |journal=The Journal of Pharmacology and Experimental Therapeutics |volume=270 |issue=3 |pages=1270–81 |year=1994 |month=September |pmid=7523657 |doi= |url=}}</ref> It has ] effects in animal studies.<ref name="pmid9784072">{{cite journal |author=Cao BJ, Rodgers RJ |title=Comparative effects of novel 5-HT1A receptor ligands, LY293284, LY315712 and LY297996, on plus-maze anxiety in mice |journal=Psychopharmacology |volume=139 |issue=3 |pages=185–94 |year=1998 |month=October |pmid=9784072 |doi= |url=}}</ref> |
|
'''LY-293284''' is a research chemical developed by the pharmaceutical company ] and used for scientific studies. It acts as a ] and selective ] ] ]. It was derived through structural simplification of the ] based psychedelic ],<ref name="pmid9622555">{{cite journal |vauthors=Monte AP, Marona-Lewicka D, Lewis MM, Mailman RB, Wainscott DB, Nelson DL, Nichols DE |title=Substituted naphthofurans as hallucinogenic phenethylamine-ergoline hybrid molecules with unexpected muscarinic antagonist activity |journal=Journal of Medicinal Chemistry |volume=41 |issue=12 |pages=2134–45 |date=June 1998 |pmid=9622555 |doi=10.1021/jm980076u }}</ref> but is far more selective for 5-HT<sub>1A</sub> with over 1000× selectivity over other serotonin receptor subtypes and other targets.<ref name="pmid7523657">{{cite journal |vauthors=Foreman MM, Fuller RW, Rasmussen K, Nelson DL, Calligaro DO, Zhang L, Barrett JE, Booher RN, Paget CJ, Flaugh ME |title=Pharmacological characterization of LY293284: A 5-HT1A receptor agonist with high potency and selectivity |journal=The Journal of Pharmacology and Experimental Therapeutics |volume=270 |issue=3 |pages=1270–81 |date=September 1994 |pmid=7523657 }}</ref> It has ] effects in animal studies.<ref name="pmid9784072">{{cite journal |vauthors=Cao BJ, Rodgers RJ |title=Comparative effects of novel 5-HT1A receptor ligands, LY293284, LY315712 and LY297996, on plus-maze anxiety in mice |journal=Psychopharmacology |volume=139 |issue=3 |pages=185–94 |date=October 1998 |pmid=9784072 |doi= 10.1007/s002130050703|s2cid=9466299 }}</ref> |
|
|
|
|
|
|
|
|
|
==See also== |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
|
|
|
== References == |
|
== References == |
|
{{Reflist}} |
|
{{Reflist}} |
|
|
|
|
|
|
|
|
|
|
|
{{Serotonergics}} |
|
{{Serotonergics}} |
| Line 33: |
Line 41: |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
{{nervous-system-drug-stub}} |
|
{{nervous-system-drug-stub}} |