| Revision as of 21:25, 13 March 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 23:36, 17 October 2022 edit undoCitation bot (talk | contribs)Bots5,424,096 edits Add: s2cid, authors 1-1. Removed parameters. Some additions/deletions were parameter name changes. | Use this bot. Report bugs. | Suggested by Smasongarrison | Category:Disaccharides | #UCB_Category 42/42 |
| (27 intermediate revisions by 19 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 391978314 |
|
|
|
| Watchedfields = changed |
| ⚫ |
|Reference=<ref>''Merck Index'', 11th Edition, '''5219'''</ref> |
|
|
⚫ |
| verifiedrevid = 418675191 |
|
|ImageFile=Lactobionic acid.png |
|
| ImageFile=Lactobionic acid.svg |
|
|ImageSize=150px |
|
| ImageSize=150px |
|
|IUPACName= <small>(2R,3R,4R)-2,3,5,6-tetrahydroxy-4-oxy]hexanoic acid</small> |
|
| IUPACName= (2''R'',3''R'',4''R'')-2,3,5,6-Tetrahydroxy-4-oxy]hexanoic acid |
|
|OtherNames=Galactosylgluconic acid |
|
| OtherNames=Galactosylgluconic acid |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
| ⚫ |
| CASNo=96-82-2 |
|
|
|
| CASNo_Ref = {{cascite|correct|??}} |
| ⚫ |
| PubChem=16219560 |
|
|
⚫ |
| CASNo=96-82-2 |
| ⚫ |
| SMILES=O1(O)(O)(O((O)CO)()(O)(O)C(O)=O)O1CO |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 65R938S4DV |
|
|
| ChEBI = 55481 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 7040 |
|
⚫ |
| PubChem= 7314 |
|
⚫ |
| SMILES=O1(O)(O)(O((O)CO)()(O)(O)C(O)=O)O1CO |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>12</sub>H<sub>22</sub>O<sub>12</sub> |
|
| C=12 | H=22 | O=12 |
|
⚫ |
| Appearance=Syrup<ref name=Merck >''Merck Index'', 11th Edition, '''5219'''</ref> |
|
| MolarMass=358.29588 |
|
|
|
| Density= |
|
| Appearance=Syrup |
|
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
|
| Solubility=Freely soluble<ref name=Merck/> |
|
| BoilingPt= |
|
|
| Solubility= |
|
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Lactobionic acid''', 4-''O''-β-galactopyranosyl-<small>D</small>-gluconic acid contains ] and ] and can be formed by oxidation of lactose, a disaccharide. The ] ] of lactobionic acid is known as '''lactobionate'''. |
|
'''Lactobionic acid''' (4-''O''-β-galactopyranosyl-<small>D</small>-gluconic acid) is a ]. It is a ] formed from ] and ]. It can be formed by oxidation of ]. The ] ] of lactobionic acid is known as '''lactobionate'''. |
|
|
|
|
|
As an ], lactobionic acid can form ] with mineral cations such as ], ], ] and ]. Calcium lactobionate is a ] used as a stabilizer. Potassium lactibionate is added to organ preservation solutions such as ] to provide ] support and prevent cell swelling. Mineral salts of lactobionic acid are also used for mineral supplementation. |
|
As an ], lactobionic acid can form ] with mineral cations such as ], ], ] and ]. Calcium lactobionate is a ] used as a stabilizer. Potassium lactobionate is added to organ preservation solutions such as ] or CoStorSol to provide ] support and prevent cell swelling. Mineral salts of lactobionic acid are also used for mineral supplementation. |
|
|
|
|
|
Lactobionic acid is also used in the cosmetics industry as an antioxidant,<ref>a salt form; for example, the antibiotic ] is used as the salt ] when intravenously delivered. |
|
Lactobionic acid is also used in the cosmetics industry as an ]<ref>{{Cite journal |last1=Tasic-Kostov |first1=M. |last2=Pavlovic |first2=D. |last3=Lukic |first3=M. |last4=Jaksic |first4=I. |last5=Arsic |first5=I. |last6=Savic |first6=S. |date=2012-10-12 |title=Lactobionic acid as antioxidant and moisturizing active in alkyl polyglucoside-based topical emulsions: the colloidal structure, stability and efficacy evaluation |url=https://pubmed.ncbi.nlm.nih.gov/22691034 |journal=International Journal of Cosmetic Science |volume=34 |issue=5 |pages=424–434 |doi=10.1111/j.1468-2494.2012.00732.x |issn=1468-2494 |pmid=22691034|s2cid=2854711 }}</ref> and in the pharmaceutical industry as an ] for ]. For example, the antibiotic ] is used as the salt ] when intravenously delivered. |
|
|
|
|
|
==References== |
|
==References== |
|
<references/> |
|
<references/> |
|
|
|
|
==External links== |
|
|
* |
|
|
* |
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
] |
|
] |
|