| Revision as of 11:47, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 477020789 of page Laminaribiose for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 14:27, 3 May 2023 edit LegionMammal978 (talk | contribs)Extended confirmed users7,894 edits fix mistake, add semisystematic name |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 421157643 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| ImageFile=Laminaribiose.png |
|
|
⚫ |
| verifiedrevid = 477168953 |
| ⚫ |
| ImageSize=200px |
|
|
⚫ |
| ImageFile = Laminaribiose.png |
| ⚫ |
| IUPACName= <small>(2''R'',3''S'',4''S'',5''R'',6''S'')-2-(Hydroxymethyl)-6-oxyoxane-3,4,5-triol</small> |
|
|
⚫ |
| ImageSize = 200px |
| ⚫ |
| OtherNames=3-beta-D-Glucosyl-D-glucose |
|
|
|
| IUPACName = 3-β-{{small|D}}-Glucopyranosyl-(1→3)-{{small|D}}-glucose |
|
⚫ |
| SystematicName = (2''R'',3''S'',4''R'',5''R'')-2,4,5,6-Tetrahydroxy-3-<nowiki/>{oxy}hexanal |
|
⚫ |
| OtherNames = 3-β-{{small|D}}-Glucosyl-{{small|D}}-glucose |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
⚫ |
| PubChem = 439637 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| ChemSpiderID = 109093 |
|
| ChemSpiderID = 388710 |
|
| InChI = 1/C12H22O11/c13-1-4(16)7(18)11(5(17)2-14)23-12-10(21)9(20)8(19)6(3-15)22-12/h2,4-13,15-21H,1,3H2/t4-,5+,6-,7-,8-,9+,10-,11-,12+/m1/s1 |
|
|
⚫ |
| SMILES = O(1(O)(OC(O)1O)CO)2O(CO)(O)(O)2O |
|
| InChIKey = YGEHCIVVZVBCLE-CRLSIFLLBS |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
| StdInChI = 1S/C12H22O11/c13-1-4(16)7(18)11(5(17)2-14)23-12-10(21)9(20)8(19)6(3-15)22-12/h2,4-13,15-21H,1,3H2/t4-,5+,6-,7-,8-,9+,10-,11-,12+/m1/s1 |
|
| StdInChI = 1S/C12H22O11/c13-1-3-5(15)7(17)8(18)12(22-3)23-10-6(16)4(2-14)21-11(20)9(10)19/h3-20H,1-2H2/t3-,4-,5-,6-,7+,8-,9-,10+,11?,12+/m1/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
| StdInChIKey = YGEHCIVVZVBCLE-CRLSIFLLSA-N |
|
| StdInChIKey = QIGJYVCQYDKYDW-LCOYTZNXSA-N |
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = <!-- blanked - oldvalue: 34980-39-7 --> |
|
| CASNo = 34980-39-7 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| PubChem = 122350 |
|
|
|
| UNII = 0WN3D69UW4 |
| ⚫ |
| SMILES = O=C(O)(O1O((O)(O)1O)CO)(O)(O)CO |
|
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>12</sub>H<sub>22</sub>O<sub>11</sub> |
|
| Formula=C<sub>12</sub>H<sub>22</sub>O<sub>11</sub> |
|
| MolarMass=342.30 g/mol |
|
| MolarMass=342.30 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density=1.768 g/mL |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Laminaribiose C<sub>12</sub>H<sub>22</sub>O<sub>11</sub>''' is a ] which is used notably in the ] field and as an ]. It is in general obtained by ] or by ] of natural ] of plant origin.<ref>{{cite patent| number=6632940|country=US}}</ref> It is also a product of the ] of ]. <ref>{{Cite journal|doi =10.1111/j.1365-2621.1966.tb01905.x|title =The Thermal Degradation of Sugars I. Thermal Polymerization of Glucose|year =1966|last1 =Sugisawa|first1 =Hirqshi|last2 =Edo|first2 =Hiroshi|journal =Journal of Food Science|volume =31|issue =4|pages =561}}</ref> |
|
|
|
|
|
==References== |
|
|
<references/> |
|
|
|
|
|
] |
|
|
|
|
|
{{organic-compound-stub}} |