| Revision as of 11:20, 23 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 451223770 of page Laninamivir for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CAS_number'). |
Latest revision as of 12:58, 23 September 2024 edit Tom.Reding (talk | contribs)Autopatrolled, Extended confirmed users, Page movers, Template editors3,769,355 editsm WP:STUBSPACING followupTag: AWB |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 444483789 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| IUPAC_name = (4S,5R,6R)-5-acetamido-4-carbamimidamido-6--5,6-dihydro-4H-pyran-2-carboxylic acid |
|
|
⚫ |
| verifiedrevid = 462088695 |
| ⚫ |
| image = Laninamivir.png |
|
|
⚫ |
| IUPAC_name = (4S'',''5''R'',6''R'')-5-acetamido-4-carbamimidamido-6--5,6-dihydro-4''H''-pyran-2-carboxylic acid |
|
⚫ |
| image = Laninamivir.svg |
|
|
| width = 200px |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| routes_of_administration = Inhalation |
|
| routes_of_administration = Inhalation |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| CAS_number = <!-- blanked - oldvalue: 203120-17-6 --> |
|
| CAS_number = 203120-17-6 |
|
| ATC_prefix = none |
|
| ATC_prefix = J05 |
|
|
| ATC_suffix = AH04 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 466246 |
|
| ChEMBL = 466246 |
|
| PubChem = 502272 |
|
| PubChem = 502272 |
| Line 21: |
Line 27: |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=13 | H=22 | N=4 | O=7 |
|
| C=13 | H=22 | N=4 | O=7 |
|
| molecular_weight = 346.33638 g/mol |
|
|
| smiles = O=C(O)C=1O((OC)(O)CO)(NC(=O)C)(/N=C(\N)N)C=1 |
|
| smiles = O=C(O)C=1O((OC)(O)CO)(NC(=O)C)(/N=C(\N)N)C=1 |
|
| InChI = 1/C13H22N4O7/c1-5(19)16-9-6(17-13(14)15)3-8(12(21)22)24-11(9)10(23-2)7(20)4-18/h3,6-7,9-11,18,20H,4H2,1-2H3,(H,16,19)(H,21,22)(H4,14,15,17)/t6-,7+,9+,10+,11+/m0/s1 |
|
|
| InChIKey = QNRRHYPPQFELSF-CNYIRLTGBV |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C13H22N4O7/c1-5(19)16-9-6(17-13(14)15)3-8(12(21)22)24-11(9)10(23-2)7(20)4-18/h3,6-7,9-11,18,20H,4H2,1-2H3,(H,16,19)(H,21,22)(H4,14,15,17)/t6-,7+,9+,10+,11+/m0/s1 |
|
| StdInChI = 1S/C13H22N4O7/c1-5(19)16-9-6(17-13(14)15)3-8(12(21)22)24-11(9)10(23-2)7(20)4-18/h3,6-7,9-11,18,20H,4H2,1-2H3,(H,16,19)(H,21,22)(H4,14,15,17)/t6-,7+,9+,10+,11+/m0/s1 |
| Line 31: |
Line 34: |
|
| StdInChIKey = QNRRHYPPQFELSF-CNYIRLTGSA-N |
|
| StdInChIKey = QNRRHYPPQFELSF-CNYIRLTGSA-N |
|
}} |
|
}} |
|
|
] |
|
|
'''Laninamivir''' ('''CS-8958''') is a ] that is a drug used for the treatment and ] of ] and ].<ref name="pmid18955520">{{cite journal | vauthors = Yamashita M, Tomozawa T, Kakuta M, Tokumitsu A, Nasu H, Kubo S | title = CS-8958, a prodrug of the new neuraminidase inhibitor R-125489, shows long-acting anti-influenza virus activity | journal = Antimicrobial Agents and Chemotherapy | volume = 53 | issue = 1 | pages = 186–192 | date = January 2009 | pmid = 18955520 | pmc = 2612152 | doi = 10.1128/AAC.00333-08 }}</ref> It is currently in Phase III clinical trials.<ref name="pmid19067613">{{cite journal | vauthors = Hayden F | title = Developing new antiviral agents for influenza treatment: what does the future hold? | journal = Clinical Infectious Diseases | volume = 48 Suppl 1 | issue = S1 | pages = S3-13 | date = January 2009 | pmid = 19067613 | doi = 10.1086/591851 | series = 48 | doi-access = free }}</ref> It is a long-acting neuraminidase inhibitor administered by nasal inhalation.<ref name="samson review">{{cite journal | vauthors = Samson M, Pizzorno A, Abed Y, Boivin G | title = Influenza virus resistance to neuraminidase inhibitors | journal = Antiviral Research | volume = 98 | issue = 2 | pages = 174–185 | date = May 2013 | pmid = 23523943 | doi = 10.1016/j.antiviral.2013.03.014 }}</ref> |
|
|
|
|
|
Laninamivir was approved for influenza treatment in Japan in 2010 and for prophylaxis in 2013. It is currently marketed under the name '''Inavir''' by Daiichi Sankyo. Biota Pharmaceuticals <ref>{{Cite web |url=http://www.biotapharma.com/ |title=Aviragen Therapeutics - Home |access-date=2013-04-12 |archive-date=2016-04-17 |archive-url=https://web.archive.org/web/20160417124102/http://www.biotapharma.com/ |url-status=dead }}</ref> and Daiichi Sankyo co-own Laninamivir. On 1 April 2011, BARDA awarded up to an estimated U$231m to Biota Pharmaceuticals (Formerly Biota Holdings Ltd) wholly owned subsidiary, Biota Scientific Management Pty Ltd, for the advanced development of Laninamivir in the US.<ref>{{Cite web |url=http://www.biotapharma.com/?page=1021001&subpage=1021019 |title=Biota Pharmaceuticals - Home |access-date=2013-04-12 |archive-date=2016-03-05 |archive-url=https://web.archive.org/web/20160305125510/http://biotapharma.com/?page=1021001&subpage=1021019 |url-status=dead }}</ref> It is under clinical evaluations in other countries.<ref name="samson review" /><ref>{{cite book | vauthors = Ishjida T | chapter = Treatment Guidelines for Influenza Virus Infection: What Does the Recent Guideline State? | veditors = Fujita J | title = Influenza: Advances in Diagnosis and Management | series = Respiratory Disease Series: Diagnostic Tools and Disease Managements. | publisher = Springer | location = Singapore | doi = 10.1007/978-981-15-9109-9_13 | isbn = 978-981-15-9109-9 | chapter-url = https://books.google.com/books?id=J0UIEAAAQBAJ&dq=Laninamivir+clinical+evaluations+in+other+countries&pg=PA132 | date = 2020 | pages = 129–136 (132) | s2cid = 228892521 }}</ref> |
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
{{RNA antivirals}} |
|
|
{{Influenza}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{antiinfective-drug-stub}} |