| Revision as of 12:31, 4 January 2011 editNono64 (talk | contribs)Autopatrolled, Pending changes reviewers, Rollbackers96,246 editsm cleanup← Previous edit |
Latest revision as of 08:07, 28 December 2022 edit undoPashihiko (talk | contribs)Extended confirmed users3,559 editsNo edit summary |
| (29 intermediate revisions by 21 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
|
| verifiedrevid = 405874929 |
|
| Name = Lariciresinol |
|
| Name = Lariciresinol |
|
| ImageFile = Lariciresinol.svg |
|
| ImageFile = Lariciresinol.svg |
|
| ImageSize = 200px |
|
|
| ImageName = Chemical structure of lariciresinol |
|
| ImageName = Chemical structure of lariciresinol |
|
| IUPACName = <nowiki>4--3-(hydroxymethyl)oxolan-2-yl]-2-methoxyphenol</nowiki> |
|
| IUPACName = <nowiki>4--3-(hydroxymethyl)oxolan-2-yl]-2-methoxyphenol</nowiki> |
|
| OtherNames = <!-- <br> --> |
|
| OtherNames = <!-- <br> --> |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| CASNo = 27003-73-2 |
|
| CASNo = 27003-73-2 |
|
| CASNo_Ref = |
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASOther = |
|
| CASNoOther = |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 73XCE5OZB0 |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = C10646 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 518421 |
|
| PubChem = 332427 |
|
| PubChem = 332427 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| SMILES = COC1=C(C=CC(=C1)CC2COC(C2CO)C3=CC(=C(C=C3)O)OC)O |
|
|
| InChI = |
|
| ChemSpiderID = 294521 |
|
|
| SMILES = COc1cc(ccc1O)C2CO(2CO)c3ccc(c(c3)OC)O |
|
|
| InChI = 1/C20H24O6/c1-24-18-8-12(3-5-16(18)22)7-14-11-26-20(15(14)10-21)13-4-6-17(23)19(9-13)25-2/h3-6,8-9,14-15,20-23H,7,10-11H2,1-2H3/t14-,15-,20+/m0/s1 |
|
|
| InChIKey = MHXCIKYXNYCMHY-AUSJPIAWBV |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C20H24O6/c1-24-18-8-12(3-5-16(18)22)7-14-11-26-20(15(14)10-21)13-4-6-17(23)19(9-13)25-2/h3-6,8-9,14-15,20-23H,7,10-11H2,1-2H3/t14-,15-,20+/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = MHXCIKYXNYCMHY-AUSJPIAWSA-N |
|
| MeSHName = |
|
| MeSHName = |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>20</sub>H<sub>24</sub>O<sub>6</sub> |
|
| Formula = C<sub>20</sub>H<sub>24</sub>O<sub>6</sub> |
|
| MolarMass = 360.40 g/mol |
|
| MolarMass = 360.40 g/mol |
|
| ExactMass = 360.157289 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPt = |
|
| BoilingPt = <!-- °C --> |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
'''Lariciresinol''' is a ], i.e., a type of ]s. It is the precursor to ]s by the action of gut microflora. Enterolignans are of interest because they are speculated to exhibit beneficial medicinal properties. |
|
'''Lariciresinol''' is a ], a type of phenylpropanoids. |
|
|
|
|
|
|
==References== |
|
==Occurrence== |
|
|
In food, it is found in ] seeds and in '']'' vegetables.<ref>{{Cite journal | doi = 10.1079/BJN20051371| pmid = 15877880| title = Lignan contents of Dutch plant foods: A database including lariciresinol, pinoresinol, secoisolariciresinol and matairesinol| journal = British Journal of Nutrition| volume = 93| issue = 3| pages = 393–402| year = 2007| last1 = Milder| first1 = Ivon E. J| last2 = Arts| first2 = Ilja C. W| last3 = Putte| first3 = Betty van de| last4 = Venema| first4 = Dini P| last5 = Hollman| first5 = Peter C. H| doi-access = free}}</ref> It is also found in the bark and wood of white fir ('']'').<ref>{{Cite journal | doi = 10.1016/j.indcrop.2013.10.005| title = Chemical composition of the silver fir (Abies alba) bark extract Abigenol® and its antioxidant activity| journal = Industrial Crops and Products| volume = 52| pages = 23–28| year = 2014| last1 = Benković| first1 = Eva Tavčar| last2 = Grohar| first2 = Tina| last3 = Žigon| first3 = Dušan| last4 = Švajger| first4 = Urban| last5 = Janeš| first5 = Damjan| last6 = Kreft| first6 = Samo| last7 = Štrukelj| first7 = Borut}}</ref> |
| ⚫ |
{{reflist}} |
|
|
|
|
|
|
==See also== |
|
== See also == |
|
* ] |
|
* ] |
|
|
|
|
|
== References == |
|
⚫ |
{{reflist}} |
|
|
|
|
|
{{Lignan}} |
|
{{Lignan}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
{{polyphenol-stub}} |
|
{{aromatic-stub}} |