| Revision as of 06:12, 20 April 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 00:52, 5 July 2024 edit undoPlantdrew (talk | contribs)Autopatrolled, Extended confirmed users, New page reviewers645,769 edits spelling |
| (23 intermediate revisions by 16 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 401005339 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| Name = Leucopelargonidin |
|
|
⚫ |
| verifiedrevid = 424979294 |
| ⚫ |
| ImageFile = Leucopelargonidin.svg |
|
|
⚫ |
| Name = Leucopelargonidin |
| ⚫ |
| ImageSize = 250px |
|
|
⚫ |
| ImageFile = Leucopelargonidin.svg |
| ⚫ |
| IUPACName = (2''R'',3''S'',4''S'')-2-(4-hydroxyphenyl)-3,4-dihydro-2H-chromene-3,4,5,7-tetrol |
|
|
⚫ |
| ImageSize = 200px |
| ⚫ |
| OtherNames = (2''R'',3''S'',4''S'')-3,4,5,7,3,4-hexahydroxyflavan<br>(+)Leucopelargonidin<br>cis-3,4-leucopelargonidin<br>Leucopelargonidine |
|
|
|
| IUPACName = (2''R'',3''S'',4''S'')-Flavan-3,4,4′,5,7-pentol |
| ⚫ |
| Section1= {{Chembox Identifiers |
|
|
⚫ |
| SystematicName = (2''R'',3''S'',4''S'')-2-(4-Hydroxyphenyl)-3,4-dihydro-2''H''-1-benzopyran-3,4,5,7-tetrol |
| ⚫ |
| CASNo = 520-17-2 |
|
|
⚫ |
| OtherNames = (+)-Leucopelargonidin<br>''cis''-3,4-Leucopelargonidin<br>Leucopelargonidine |
| ⚫ |
| PubChem = 440073 |
|
|
⚫ |
|Section1={{Chembox Identifiers |
|
| SMILES = C1=CC(=CC=C1C2C(C(C3=C(C=C(C=C3O2)O)O)O)O)O |
|
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
⚫ |
| CASNo = 98919-66-5 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = S3K37SML4S |
|
⚫ |
| PubChem = 440073 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 17343 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 389080 |
|
|
| SMILES = c1cc(ccc12((c3c(cc(cc3O2)O)O)O)O)O |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C15H14O6/c16-8-3-1-7(2-4-8)15-14(20)13(19)12-10(18)5-9(17)6-11(12)21-15/h1-6,13-20H/t13-,14-,15+/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = FSVMLWOLZHGCQX-SOUVJXGZSA-N |
|
|
|
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=15 | H=14 | O=6 |
|
| Formula = C<sub>15</sub>H<sub>14</sub>O<sub>6</sub> |
|
|
|
| Appearance = |
|
| MolarMass = 290.26 g/mol |
|
|
|
| Density = |
|
| ExactMass = 290.079038 |
|
|
| Appearance = |
|
| MeltingPt = |
|
| Density = |
|
| BoilingPt = |
|
| MeltingPt = |
|
| Solubility = |
|
| BoilingPt = |
|
|
| Solubility = |
|
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Leucopelargonidin''' is a colorless chemical compound related to ]s. It can be found in '']'' (East Indian walnut), in the fruit of '']'' (Cashew), in the fruit of '']'' (Areca nut), in the fruit of '']'' (Hindi Chaulmoogra), in the rhizome of '']'' (Arizona dock), in '']'' (Corn) and in '']'' (Chinese date)<ref></ref>. |
|
'''Leucopelargonidin''' is a colorless chemical compound related to ]s. It can be found in '']'' (East Indian walnut), in the fruit of '']'' (Cashew), in the fruit of '']'' (Areca nut), in the fruit of '']'' (Hindi Chaulmoogra), in the rhizome of '']'' (Arizona dock), in '']'' (Corn) and in '']'' (Chinese date).<ref></ref> |
|
|
|
|
|
(+)-Leucopelargonidin can be synthesized from (+)-] by ] reduction<ref name="Heller">. |
|
(+)-Leucopelargonidin can be synthesized from (+)-] by ] reduction.<ref name="Heller">{{cite journal | doi = 10.1007/BF00393505 | title = Leucoanthocyanidins as intermediates in anthocyanidin biosynthesis in flowers of Matthiola incana R. Br | year = 1985 | last1 = Heller | first1 = Werner | last2 = Britsch | first2 = Lothar | last3 = Forkmann | first3 = Gert | last4 = Grisebach | first4 = Hans | journal = Planta | volume = 163 | issue = 2 | pages = 191–196 | pmid=24249337| s2cid = 20854538 }}</ref> |
|
|
|
|
|
==Metabolism== |
|
==Metabolism== |
|
] uses ''cis''-3,4-leucopelargonidin and ] to produce (+)-] (aromadedrin), NADPH, and H<sup>+</sup>. |
|
] uses ''cis''-3,4-leucopelargonidin and ] to produce (+)-aromadendrin, NADPH, and H<sup>+</sup>. |
|
|
|
|
<br>] transforms cis-3,4-leucopelargonidin into ]<ref></ref>. |
|
|
|
] transforms ''cis''-3,4-leucopelargonidin into ]. |
|
|
|
|
|
==References== |
|
==References== |
| Line 46: |
Line 60: |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
] |
|
|
|
|
|
|
{{biochem-stub}} |
|
{{biochem-stub}} |