| Revision as of 02:52, 11 April 2011 editGrutness (talk | contribs)Autopatrolled, Administrators316,061 editsmNo edit summary← Previous edit |
Latest revision as of 21:41, 1 June 2019 edit undoGraeme Bartlett (talk | contribs)Administrators249,514 edits pubchem and inchi |
| (11 intermediate revisions by 10 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 401005360 |
|
| verifiedrevid = 423447281 |
| ⚫ |
| name = Leucopeonidin |
|
|
| ImageFile = Leucopeonidin.PNG |
|
| Name = Leucopeonidin |
|
⚫ |
| ImageFile = Leucopeonidin.svg |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
| IUPACName = 2-(4-Hydroxy-3-methoxyphenyl)chromenylium-3,5,7-triol |
|
| IUPACName = 2-(4-Hydroxy-3-methoxyphenyl)chromenylium-3,5,7-triol |
|
| OtherNames = |
|
| OtherNames = |
|
| Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
| ⚫ |
| CASNo = 20408-92-8 |
|
|
|
| CASNo_Ref = {{cascite|correct|??}} |
| ⚫ |
| PubChem = |
|
|
⚫ |
| CASNo = 20408-92-8 |
| ⚫ |
| SMILES = OC1C(O)C2C(C=C(O)C=C2O)OC1c(cc3OC)ccc3O |
|
|
⚫ |
| PubChem = 57459454 |
|
⚫ |
| SMILES = OC1C(O)C2C(C=C(O)C=C2O)OC1c(cc3OC)ccc3O |
|
|
| StdInChI=1S/C16H18O7/c1-22-11-4-7(2-3-9(11)18)16-15(21)14(20)13-10(19)5-8(17)6-12(13)23-16/h2-6,12-21H,1H3 |
|
|
| StdInChIKey = ZZNPEGJLMUWYNN-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=16|H=18|O=7 |
|
| Formula=C<sub>16</sub>H<sub>18</sub>O<sub>7</sub> |
|
|
⚫ |
| Appearance = |
|
| MolarMass = 322.30 g/mol |
|
|
|
| Density= |
|
| ExactMass = 322.10525288 |
|
|
|
| MeltingPt= |
| ⚫ |
| Appearance = |
|
|
| Density= |
|
| BoilingPt= |
|
| MeltingPt= |
|
| Solubility= |
|
| BoilingPt= |
|
|
| Solubility= |
|
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Leucopeonidin''' is a ]. <!-- It can be found --> |
|
'''Leucopeonidin''' is a ]. |
|
|
|
|
|
A leucopeonidin ], found in the bark of '']'', shows ] effects<ref> |
|
A leucopeonidin ] is found in the bark of '']''.<ref>{{Cite journal | pmid = 8500813| year = 1993| last1 = Cherian| first1 = S| title = Antidiabetic effects of a glycoside of leucopelargonidin isolated from Ficus bengalensis Linn| journal = Indian Journal of Experimental Biology| volume = 31| issue = 1| pages = 26–9| last2 = Augusti| first2 = K. T}}</ref> |
|
|
|
|
|
==References== |
|
==References== |
| Line 39: |
Line 41: |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
{{Natural-phenol-stub}} |
|
{{phenol-stub}} |