Misplaced Pages

Leukotriene B4: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 03:50, 1 March 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit Latest revision as of 21:22, 13 April 2024 edit undo109.241.162.167 (talk) no sentence 
(44 intermediate revisions by 29 users not shown)
Line 1: Line 1:
{{DISPLAYTITLE:Leukotriene B<sub>4</sub>}}
{{chembox {{chembox
| Name = Leukotriene B<sub>4</sub>
⚫ | verifiedrevid = 265824082
| Verifiedfields = changed
| Watchedfields = changed
⚫ | verifiedrevid = 416501457
| ImageFile = Leukotriene B4.svg | ImageFile = Leukotriene B4.svg
| ImageSize = | ImageSize =
| PIN = (5''S'',6''Z'',8''E'',10''E'',12''R'',14''Z'')-5,12-Dihydroxyicosa-6,8,10,14-tetraenoic acid
| IUPACName =
| OtherNames = | OtherNames =
| Section1 = {{Chembox Identifiers |Section1={{Chembox Identifiers
| IUPHAR_ligand = 2487
⚫ | CASNo = 71160-24-2
| PubChem = 169 | Abbreviations =
| CASNo_Ref = {{cascite|correct|??}}
| SMILES =
⚫ | CASNo = 71160-24-2
⚫ | MeSHName = Leukotriene+B4
| UNII_Ref = {{fdacite|correct|FDA}}
⚫ }}
| UNII = 1HGW4DR56D
⚫ | Section2 = {{Chembox Properties
| Formula = C20H32O4 | EINECS =
| MolarMass = 336.466 | PubChem = 5280492
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
⚫ | Appearance =
| Density = | ChemSpiderID = 4444132
| ChEMBL_Ref = {{ebicite|changed|EBI}}
⚫ | MeltingPt =
| BoilingPt = | ChEMBL = 65061
| SMILES = CCCCC/C=C\C(/C=C/C=C/C=C\(CCCC(=O)O)O)O
⚫ }}
| InChI = 1/C20H32O4/c1-2-3-4-5-6-9-13-18(21)14-10-7-8-11-15-19(22)16-12-17-20(23)24/h6-11,14-15,18-19,21-22H,2-5,12-13,16-17H2,1H3,(H,23,24)/b8-7+,9-6-,14-10+,15-11-/t18-,19-/m1/s1
⚫ | Section3 = {{Chembox Hazards
| InChIKey = VNYSSYRCGWBHLG-AMOLWHMGBE
⚫ | Solubility =
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
⚫ | MainHazards =
| StdInChI = 1S/C20H32O4/c1-2-3-4-5-6-9-13-18(21)14-10-7-8-11-15-19(22)16-12-17-20(23)24/h6-11,14-15,18-19,21-22H,2-5,12-13,16-17H2,1H3,(H,23,24)/b8-7+,9-6-,14-10+,15-11-/t18-,19-/m1/s1
⚫ | FlashPt =
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| Autoignition =
| StdInChIKey = VNYSSYRCGWBHLG-AMOLWHMGSA-N
⚫ }}
| RTECS =
⚫ | MeSHName =
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 15647
| KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG = C02165
⚫ }}
⚫ |Section2={{Chembox Properties
| C = 20 | H = 32 | O = 4
⚫ | Appearance =
| Density =
⚫ | MeltingPt =
| MeltingPt_notes =
| BoilingPt =
| BoilingPt_notes =
⚫ | Solubility =
| SolubleOther =
| Solvent =
| pKa =
| pKb =
⚫ }}
⚫ |Section7={{Chembox Hazards
| ExternalSDS =
⚫ | MainHazards =
| NFPA-H =
| NFPA-F =
| NFPA-R =
| NFPA-S =
⚫ | FlashPt =
| AutoignitionPt =
| ExploLimits =
| PEL =
⚫ }}
}} }}
⚫ '''Leukotriene B4''' is a ] involved in ]. It is produced from ]s in response to inflammatory mediators and is able to induce the adhesion and activation of leukocytes on the ], allowing them to bind to and cross it into the tissue<ref name="robspath">{{cite book | title=Robbins Pathologic Basis of Disease| last=Cotran| coauthors=Kumar, Collins| publisher=W.B Saunders Company| location=Philadelphia| isbn=0-7216-7335-X}}</ref>. In ]s, it is also a potent ], and is able to induce the formation of ] and the release of ] enzymes by these cells<ref name="robspath" />.


'''Leukotriene B<sub>4</sub>''' ('''LTB<sub>4</sub>''') is a ] involved in ]. It has been shown to promote insulin resistance in obese mice.
⚫ ]


==References== ==Biochemistry==
⚫ LTB<sub>4</sub> is a leukotriene involved in ]. It is produced from ]s in response to inflammatory mediators and is able to induce the adhesion and activation of leukocytes on the ], allowing them to bind to and cross it into the tissue.<ref name="robspath">{{cite book | title=Robbins Pathologic Basis of Disease| last=Cotran|author2=Kumar, Collins | publisher=W.B Saunders Company| location=Philadelphia| isbn=0-7216-7335-X| year=1999}}</ref> In ]s, it is also a potent ], and is able to induce the formation of ] and the release of ] enzymes by these cells.<ref name="robspath" /> It is synthesized by ] from ].<ref name=P09960>{{cite web|url=https://www.uniprot.org/uniprot/P09960|access-date=9 April 2013|title=LTA4H|website=uniprot}}</ref>
{{reflist}}


⚫ ]
⚫ {{Leukotrienes}}


== Diabetes ==
⚫ ]
A study at the University of California, San Diego School of Medicine has shown that LTB<sub>4</sub> promotes ] in obese mice.<ref>{{Cite web|url=https://health.ucsd.edu/news/releases/Pages/2015-02-23-type-2-diabetes-and-obesity-molecular-link.aspx|title=Molecular Link between Obesity and Type 2 Diabetes Reveals Potential Therapy|url-status=dead|archive-url=https://web.archive.org/web/20220218115035/http://health.ucsd.edu/news/releases/Pages/2015-02-23-type-2-diabetes-and-obesity-molecular-link.aspx|archive-date=2022-02-18|website=UC San Diego Health}}</ref> ] is the major cause of insulin resistance in ].<ref>{{cite journal|journal=Nature Medicine|title=LTB4 promotes insulin resistance in obese mice by acting on macrophages, hepatocytes and myocytes|volume=21|issue=3|date=2015|pages=239–247|doi=10.1038/nm.3800|pmid=25706874 | last1 = Li | first1 = P | last2 = Oh | first2 = DY | last3 = Bandyopadhyay | first3 = G | last4 = Lagakos | first4 = WS | last5 = Talukdar | first5 = S | last6 = Osborn | first6 = O | last7 = Johnson | first7 = A | last8 = Chung | first8 = H | last9 = Maris | first9 = M | last10 = Ofrecio | first10 = JM | last11 = Taguchi | first11 = S | last12 = Lu | first12 = M | last13 = Olefsky | first13 = JM| pmc = 4429798 }}</ref>


==References==
{{Reflist|30em}}


⚫ {{Leukotrienes}}
{{biochemistry-stub}}
{{Leukotriene signaling modulators}}
{{PPAR modulators}}


⚫ ]
]
]