| Revision as of 07:35, 18 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 470965034 of page Limonin for the Chem/Drugbox validation project (updated: 'ChEBI', 'CASNo'). |
Latest revision as of 04:16, 21 December 2022 edit Zefr (talk | contribs)Extended confirmed users, Pending changes reviewers69,143 edits →External links: used in article |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 470610873 |
|
| verifiedrevid = 477498078 |
|
| ImageFile = Limonin.svg |
|
| ImageFile = Limonin.svg |
|
| ImageSize = |
|
| ImageSize = |
|
|
| ImageFile1 = Limonin molecule ball.png |
|
| IUPACName = 7,16-Dioxo-7,16-dideoxylimondiol |
|
|
|
| ImageSize1 = 220 |
| ⚫ |
| OtherNames = limonoate D-ring-lactone,<br>limonoic acid di-delta-lactone |
|
|
|
| ImageAlt1 = Ball-and-stick model of limonin |
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
|
|
| PIN = (2a''R'',4a''R'',4b''R'',5a''S'',8''S'',8a''S'',10a''R'',10b''R'',14a''S'')-8-(Furan-3-yl)-2,2,4a,8a-tetramethyldecahydro-11''H'',13''H''-oxirenopyranofuronaphthopyran-4,6,13(2''H'',5a''H'')-trione |
| ⚫ |
| CASNo_Ref = {{cascite|correct|??}} |
|
|
⚫ |
| OtherNames = {{ubl|Limonoate D-ring-lactone|Limonoic acid di-δ-lactone|7,16-Dioxo-7,16-dideoxylimondiol}} |
|
| CASNo = <!-- blanked - oldvalue: 1180-71-8 --> |
|
|
⚫ |
|Section1={{Chembox Identifiers |
| ⚫ |
| ChEBI = 16226 |
|
|
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CASNo = 1180-71-8 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = L0F260866S |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
⚫ |
| ChEBI = 16226 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 517449 |
|
| PubChem = 179651 |
|
| PubChem = 179651 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 156367 |
|
| ChemSpiderID = 156367 |
|
| SMILES = O=C46(C)72O7C(=O)O(c1ccoc1)2(C)CC635COC(=O)C5OC(3C4)(C)C |
|
| SMILES = O=C46(C)72O7C(=O)O(c1ccoc1)2(C)CC635COC(=O)C5OC(3C4)(C)C |
|
| InChI = 1/C26H30O8/c1-22(2)15-9-16(27)24(4)14(25(15)12-31-18(28)10-17(25)33-22)5-7-23(3)19(13-6-8-30-11-13)32-21(29)20-26(23,24)34-20/h6,8,11,14-15,17,19-20H,5,7,9-10,12H2,1-4H3/t14-,15-,17-,19-,20+,23-,24-,25+,26+/m0/s1 |
|
| InChI = 1/C26H30O8/c1-22(2)15-9-16(27)24(4)14(25(15)12-31-18(28)10-17(25)33-22)5-7-23(3)19(13-6-8-30-11-13)32-21(29)20-26(23,24)34-20/h6,8,11,14-15,17,19-20H,5,7,9-10,12H2,1-4H3/t14-,15-,17-,19-,20+,23-,24-,25+,26+/m0/s1 |
|
| InChIKey = KBDSLGBFQAGHBE-MSGMIQHVBF |
|
| InChIKey = KBDSLGBFQAGHBE-MSGMIQHVBF |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C26H30O8/c1-22(2)15-9-16(27)24(4)14(25(15)12-31-18(28)10-17(25)33-22)5-7-23(3)19(13-6-8-30-11-13)32-21(29)20-26(23,24)34-20/h6,8,11,14-15,17,19-20H,5,7,9-10,12H2,1-4H3/t14-,15-,17-,19-,20+,23-,24-,25+,26+/m0/s1 |
|
| StdInChI = 1S/C26H30O8/c1-22(2)15-9-16(27)24(4)14(25(15)12-31-18(28)10-17(25)33-22)5-7-23(3)19(13-6-8-30-11-13)32-21(29)20-26(23,24)34-20/h6,8,11,14-15,17,19-20H,5,7,9-10,12H2,1-4H3/t14-,15-,17-,19-,20+,23-,24-,25+,26+/m0/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = KBDSLGBFQAGHBE-MSGMIQHVSA-N |
|
| StdInChIKey = KBDSLGBFQAGHBE-MSGMIQHVSA-N |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>26</sub>H<sub>30</sub>O<sub>8</sub> |
|
| Formula = C<sub>26</sub>H<sub>30</sub>O<sub>8</sub> |
|
| MolarMass = 470.52 g/mol |
|
| MolarMass = 470.52 g/mol |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
{{distinguish|Limonene}} |
|
|
'''Limonin''' is a ], and a bitter, white, crystalline substance found in ] and other plants. It is also known as '''limonoate D-ring-lactone''' and '''limonoic acid di-delta-lactone'''. Chemically, it is a member of the class of compounds known as ]s. |
|
|
|
|
|
==Sources== |
|
|
Limonin is enriched in citrus fruits and is often found at higher concentrations in seeds, for example ] and ] seeds.<ref name=pubchem/> |
|
|
|
|
|
==Presence in citrus products== |
|
|
Limonin and other limonoid compounds contribute to the ] of some citrus food products. Researchers have proposed removal of limonoids from ] and other products (known as "debittering") through the use of ].<ref>{{Cite journal |
|
|
| last1 = Fayoux | first1 = S. P. C. |
|
|
| last2 = Hernandez | first2 = R. J. |
|
|
| last3 = Holland | first3 = R. V. |
|
|
| doi = 10.1111/j.1750-3841.2007.00283.x |
|
|
| title = The Debittering of Navel Orange Juice Using Polymeric Films |
|
|
| journal = Journal of Food Science |
|
|
| volume = 72 |
|
|
| issue = 4 |
|
|
| pages = E143–E154 |
|
|
| year = 2007 |
|
|
| pmid = 17995766 |
|
|
| pmc = |
|
|
}}</ref> |
|
|
|
|
|
==Research== |
|
|
Limonin is under ] to assess its possible biological properties.<ref name="pubchem">{{cite web |title=Limonin |url=https://pubchem.ncbi.nlm.nih.gov/compound/Limonin |publisher=PubChem, US National Library of Medicine |access-date=21 December 2022 |date=17 December 2022}}</ref> |
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
==External links== |
|
|
* (Agricultural Research Service, USDA) |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |